a) Provide the name of the coordination complex Na[COCI,(NH3),] b) Calculate the orbital multiplicity for a Cr* assuming it is a free ion (Not complex). c) Calculate the spin multiplicity of a metal ion Cr** assuming a high spin crystal field.

a) Provide the name of the coordination complex Na[COCI,(NH3),] b) Calculate the orbital multiplicity for a Cr* assuming it is a free ion (Not complex). c) Calculate the spin multiplicity of a metal ion Cr** assuming a high spin crystal field.

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter26: Molecular Absorption Spectrometry

Section: Chapter Questions

Problem 26.30QAP

See similar textbooks

Related questions

Q: The metal ion, M2+, formed a paramagnetic tetrahedral complex [MJ4]2+, having three unpaired…

A: Given: We have to calculate the hybridization of given M2+ ion.

Q: e) Calculate the spin multiplicity of a metal ion Cr* assuming a high spin crystal field.

A: To calculate the spin multiplicity of Cr3+ metal ion

Q: The thermodynamic stability of coordination compounds depends on, а. AG¢ b. magnetic susceptibility…

A: The thermodynamic stability of coordination compound depends on the following factors.

Q: Explain the following: (i) Nickel does not form low spin octahedral complexes. (ii) The Tt-complexes…

A: Nickel does not form low spin octahedral complexes. Because, the electronic configuration of Nickel…

Q: Consider the following metal ion d-electron configuration and crystal field in octahedral complexes:…

A: Crystal Field Stabilizing Energy (CFSE),in terms of ∆° and P: CFSE =[-0.4 p+0.6 q ] ∆° +m Pwhere,p…

Q: What would you expect the coordination sphere for the complex ion formed from Ni^2+ and…

A: In coordination chemistry, the first coordination sphere refers to the array of molecules and ions…

Q: The ligand substitution in organometallic complexes is very similar to that of coordination…

Q: By using valence bond theory and ligand field theory, prove [Fe(acac)3] is a paramagnetic high spin…

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3 Name => Triamminetrichloridochromate(III)

Q: What determine whether a molecule or ion complex is chiral? How would you differentiate between…

A: A chiral is an object that is not identically super-imposable with a mirror image of itself. An…

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

Q: Draw one facial and one meridional (fac- and mer-) isomer of the coordination complex of the general…

A: In MX3 Y3 octahedral compound , if three identical ligand occupy one face of octahedron, it is…

Q: Show how the coordination of two MeHNCH2CH2NH2 ligands to a metal atom in a square planar complex…

A: Optical isomers: Two compound having same molecular formula but different in spatial arrangement…

Q: octahedral complex is found to absorb visible light, with the absorption maximum occurring at 507…

A: The absorption with maximum wavelength by an electron is equal to the energy difference between…

Q: A four-coordinate complex MA2B2 is prepared and found tohave two different isomers. Is it possible…

Q: 3. The coordination geometries around the nickel atom in the nominally six-coordinate complexes…

Q: 4. The structure of [Cu(NH3)4]²+ is known to be square planar. Using the ligand o orbitals only,…

A: Given that Square planer metal complex [Cu(NH3)4]2+ (ML4) Draw orbitals symmetries of the central…

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

Q: C1....... Cu ***.... CI 5. Answer the following questions related to crystal field splitting. A. For…

Q: 2. Determine which of the following four coordinate complexes are tetrahedral and which are square…

A: There are number of theories have been proposed to determine the structure, magnetic behaviours of…

Q: By taking into account the following complexes: A) [Co(en):]³* B)[CoCl3Br3]+ a) Give the oxidation…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: 3(a) Considering a Fe coordination complex, [Fe(CN),d, state whether you expect the complex to be…

Q: The metal ion, M2+, formed a paramagnetic tetrahedral complex [MJ4]2+, having three unpaired…

A: The given metal ion is M2+

Q: Though both [COF6]3 and [Co(CN)6]³- octahedral complexes, the crystal field stabilization energy…

A: If weak field ligand is present,than no pairing occur and filling of electron occur according to…

Q: 2. Rank the ligands in order of their increasing effect on Act for Cr³+. Do this by looking at the…

Q: Mo(PMes)3(C6HS)2

Q: Find SALCs and construct the MO diagram for a transition metal complex with octahedral symmetry.

Q: Heating 2.0 mol of a coordination compound gives 1.0mol NH3, 2.0 mol H2O, 1.0 mol HCl, and 1.0…

A: The chemical equation must be:

Q: Give the systematic name for the following coordination compound: CI- .F Со

A: While naming any complex ion, the ligands are always named before the metal ion. If multiple ligands…

Q: Ocatahedral” Cu (II) complexes are often described as having a (4+2)- coordination pattern. Suggest…

A: The central metal copper is attached with the six H2O ligands then this complex will be the…

Q: Provide the name of the coordination complex Na[CoCl4(NH3)2] b) Calculate the orbital multiplicity…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: catahedral” Cu (II) complexes are often described as having a (4+2)- coordination pattern. Suggest…

Q: b) The high-spin đ complex (Cr(H:O)J* is labile, but the low-spin d' complex ion [Cr(CN)e]* is…

Q: explain and prove if [Fe(acac)3] is diamagnetic high spin octahedral complex using valence bond…

A: Acac is strong feild ligand, so according to VBT pairing take place and formation inner sphere…

Q: [FeF6]° , [Fe(CN)«]+

A: If the complex have unfilled orbitals, i.e., unpaired electrons, it is called a paramagnetic…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: a. Briefly describe the chelate effect b. Give the structure of a ligand that will exhibit the…

A: The metal complex carrying the ligand that is chelating (two or more donating sites) is named as…

Q: ce the following coordination complexes in order of bility constant, Bn. Justify your answer.…

A: Chelating agents are the chemical compounds that react with metal ions to form stable water…

Q: Z= Determine the coordination compound formula: 1.500=3 Coordination compound Formula: (0INH3)5 Cl 2…

A: Coordination compounds are the compounds which are the complex in which the metal atom is surrounded…

Q: f)) "Crystal field theory provides a basis for explaining the features of transition metal…

A: Two statements based on coordination complexes, which are to be explained.

Q: b) Consider (Co(CI).F and (Co(NH3)e]* ions. i. Illustrate the energy level splitting diagram for…

A: Since Cl is weak field ligand then the complex shows high spin And NH3 is strong field ligand shows…

Q: The complex Mo(CO)3(NCC2H5)3 has the infrared spectrum shown below. Is this complex more likely the…

A: The mentioned complex is Mo(CO)3(NCC2H5)3

Q: Why are there both high-spin and low-spin octahedral com-plexes but only high-spin tetrahedral…

Q: The three complex ions [Mn(CN),]³-, [Mn(CN),J*¯, and [Mn(CN),]³- have all been synthesized and all…

A: All three complexes has cyanide ligand, CN- which is a strong field ligand , thus all complexes are…

Q: Crystal field splitting can impact the properties of coordination complexes. In particular, whether…

Q: The octahedral complex ion [Co(NH3)6]** has fewer unpaired spins than the octahedral complex ion…

Q: Write the formula for a complex formed between Ag+ and NH, with a coordination number of 2. formula:…

Q: b) Calculate the orbital multiplicity for a Cr3+ assuming it is a free ion (Not complex). c)…

A: Orbital multiplicity of a metal is its total no.of orientations of orbital angular momentum L. which…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

100%

a) Provide the name of the coordination
complex Na[COCI,(NH3),]
b) Calculate the orbital multiplicity for a
Cr** assuming it is a free ion (Not
complex).
c) Calculate the spin multiplicity of a
metal ion Cr* assuming a high spin
crystal field.
d) Calculate the quantum number S for
metal ion Cr 3* assuming a high spin
crystal field splitting.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Calculate total spin moment (S) for the Mn complex. * +2.0 +2.5 +1.5 +1.0
1. Calculate spin only magnetic moment (μs) for the Mn complex. 5.92 bohr / 2.83 / 3.87 / 4.9 ? 2. What is the hybridization of the Mn complex? d3sp3 / dsp3 / sp3 / sp3d2 ? 3. Calculate the CFSE for the high-spin complex. 2.00 Δo / -0.60 Δo / +2.00 Δo / 0.00 Δo ?
By using valence bond theory and ligand field theory, prove that [Ru(OMe)2(PMe3)4] is a paramagnetic high spin octahedral complex. (acac = acetylacetonato)
Account for any differences in the number of unpaired electrons between [Co(H2O)6](BF4)2and [Co(9S3)2](BF4)2, [Ni(H2O)6](BF4)2 and [Ni(9S3)2](BF4)2, and [Fe(H2O)6](BF4)2 and[Fe(9S3)2](BF4)2. a.Your answer must include a labeled d-orbital splitting diagram for each complexshowing the number of unpaired electrons. b.Which is higher in the spectrochemical series, i.e., gives the largest crystal fieldsplitting, H2O or 9S3? 9S3 = 1,4,7-trithiacyclononane
Calculate the total spin of this complex ion [NiCl6] 4-
Determine the symmetry representations of CO stretching vibrations of a Mn(CO)5Br complex, which has a pseudo-octahedral structure with CO ligands at five corners and a Br ligand at the sixth corner. Which of the CO stretching vibrations are active in IR absorption and which in Raman spectra? can you show graphically
1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain the experimental observations that the SeF6 unit in Cs2[SeF6] is C2v and looks like six of the seven vertices of a capped trigonal prism are occupied by F, but the SeCl6 unit in Cs2[SeCl6] has Oh symmetry ?
Find SALCs and construct the MO diagram for a transition metal complex with octahedral symmetry.
How does temperature play a role in coordination complexes?