A sample of 0.0300 mol of COCl₂ gas was placed in a 1.50-L container. When the gas is heated, the concentration of CO at equilibrium was 7.57x10³ M. Calculate K, for the reaction CO (g) + Cl₂ (g) → COCI₂ (g).

A sample of 0.0300 mol of COCl₂ gas was placed in a 1.50-L container. When the gas is heated, the concentration of CO at equilibrium was 7.57x10³ M. Calculate K, for the reaction CO (g) + Cl₂ (g) → COCI₂ (g).

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 67E: At 25C, Kp. = 2.9 103 for the reaction NH4OCONH2(s)2NH3(g)+CO2(g) In an experiment carried out at...

See similar textbooks

Similar questions

. The equilibrium constant for the reaction 2NOCl(g)2NO(g)+Cl2(g)has the value 9.2106at a particular temperature. The system is analyzed at equilibrium, and it is found that the concentrations of NOCl(g) and NO(g) are 0.44 M and 1.5103M. respectively. What is the concentration of Cl2(g) in the equilibrium system under these conditions?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
. For the reaction CaCO3(s)CaO(s)+CO2(g)the equilibrium constant K has the form K=[CO2]. Using a handbook to find density information about CaCO3(s) and CaO(s), show that the concentrations of the two solids (the number of moles contained in 1 L of volume) are constant.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
. Suppose K=4.5103at a certain temperature for the reaction PCl5(g)PCl3(g)+Cl2(g)If it is found that the concentration of PCl5is twice the concentration of PCl3, what must be the concentration of Cl2under these conditions?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
. Suppose that for the reaction 2N2O(g)+O2(g)4NO((g))it is determined, at a particular temperature, that the equilibrium concentrations arc [NO(g)]=0.00341M,[N2O(g)]=0.0293M, and [O2(g)]=0.0325M. Calculate the value of K for the reaction at this temperature.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The following reaction is earned out at 500 K in a container equipped with a movable piston. A(g)+B(g)C(g);Kc=10(at500K) After the reaction has reached equilibrium, the container has the composition depicted here. Suppose the container volume is doubled. a How does the equilibrium composition shift? b How does the concentration of each of the reactants and the product change? (That is, does the concentration increase, decrease, or stay the same?)
At a certain temperature, the reaction Xe(g)+2F2(g)XeF4(g)gives a 50.0% yield of XeF4, starting with Xe(Pxe=0.20atm) and F2(PF2=0.40atm). Calculate K at this temperature. What must the initial pressure of F2 be to convert 75.0% of the xenon to XeF4?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
At 25C, Kp. = 2.9 103 for the reaction NH4OCONH2(s)2NH3(g)+CO2(g) In an experiment carried out at 25C, a certain amount of NH4OCONH2 is placed in an evacuated rigid container and allowed to come to equilibrium. Calculate the total pressure in the container at equilibrium.