A voltaic electrochemical cell is constructed using the following reaction. The half-cell components are separated by a salt bridge. Cd(s) + Sn2*(aq)– Cd²*(aq) + Sn(s) Write the reactions that take place at the anode and at the cathode, the direction in which the electrons migrate in the external circuit, and the direction the anions in the salt bridge migrate. Use smallest possible integer coefficients. If a box is not needed, leave it blank. Enter the reaction that takes place at the anode. Include state symbols: CDs Enter the reaction that takes place at the cathode. Include state symbols: In the external circuit, electrons migrate the Cd electrode the Sn2+ from v to electrode. Anions migrate the Cd compartment. (from v the salt bridge to Submit Show Approach Show Tutor Steps

A voltaic electrochemical cell is constructed using the following reaction. The half-cell components are separated by a salt bridge. Cd(s) + Sn2(aq)– Cd²(aq) + Sn(s) Write the reactions that take place at the anode and at the cathode, the direction in which the electrons migrate in the external circuit, and the direction the anions in the salt bridge migrate. Use smallest possible integer coefficients. If a box is not needed, leave it blank. Enter the reaction that takes place at the anode. Include state symbols: CDs Enter the reaction that takes place at the cathode. Include state symbols: In the external circuit, electrons migrate the Cd electrode the Sn2+ from v to electrode. Anions migrate the Cd compartment. (from v the salt bridge to Submit Show Approach Show Tutor Steps

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ______ electrode to the ____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the _____ half-cell.
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)