a. CH3-CH-CH2-CH2-C-H CH3 b. CH,-CH,-CH-C-H CH2 CH3

Q: What is the correct IUPAC name for the following structure: OH

A: Write IUPAC name of the given structure ---

Q: What is the IUPAC name for the compound shown? Spelling and punctuation count.…

A:

Q: What is the IUPAC name for the following compound? H. O 4-benzylbutanal O 3-phenylpropanal O…

A:

Q: #80

A: a) It is an aldehyde and the common name is formaldehyde.

Q: B. Give the common name for each ether. (a) H3C-0-CH2CH3 (b) H3C-0-CH3

A: The given compounds have an "ether" functional group.

Q: Give the IUPAC name for each ketone: CH3 (CH3)3C. b. c. (CH3)3CCOC(CH3)3 a. Name the following…

A:

Q: I. Give the IUPAC and common names of the following ethers. Common Name IUPAC Name 1. H3C CH3 CH3 to…

A: Given compounds are :

Q: CH3 HO. CH CH3 CH3 menthol

A:

Q: Give the IUPAC name for each aldehyde. CHO CHO a. (CHa),CC(CH3),CH,CHO b. С. С- CI

A: The IUPAC name of given aldehydes has to be provided. (a) The given aldehyde is…

Q: Assign an IUPAC name to each of the following esters. a. CH3-CH2-CH2-C-0-CH2-CH3 b.…

A:

Q: a) b) c) LL НО OH OH

A: Three organic compounds are given in the question and their name is asked according to the rules set…

Q: Draw the molecule that corresponds to each IUPAC name. (a) (Z)-hept-3-enedial; (b)…

A:

Q: Which of the following is the IUPAC name for the compound below? CH3 CH CH-CH-CH2-CH2 CH; OH…

A: Numbering of compound done from that side from which the OH group is getting less number.   As the…

Q: Present the IUPAC name for the following structure: OH Br H3CH,C

A: Since you have posted multiple questions, we are entitled to answer only 1.

Q: 1.5 Ethers 1. Draw the structural formula for each of the following ethers a. 3-Ethoxypentane b.…

A: Given ethers are : Structural formula of the compound = ?

Q: Give the structure corresponding to each IUPAC name:  a) 3-methyl-3-pentanol b) 4-methyl…

A: While writing the IUPAC name first identify the parent chain and then the functional group.

Q: Naming and Drawing Ethers Draw each of the following ethers a) b) c) ethyl-1-propyl ether…

A:

Q: Give the IUPAC name for each compound. CH3 CH2CH3 Br a. PHCH(CH3)2 b. С. d.

A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…

Q: A. Explain why each name is incorrect. Write the correct IUPAC name for the intended compound. 1.…

A: The correct names of the given compounds are.

Q: Draw the condensed structural formula for the ether produced by each of the following reactions: H+…

A:

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: Give the IUPAC name for each aldehyde. а) CH3 b) H || CH-CHCH— С —н CH3CH2CH2-C-CH¿CH3 CHO CH3 c)…

A: IUPAC name of the organic compound is composed of the following three components:Root name = depends…

Q: Provide IUPAC names for each structure below H. CH3 H H.

A: The IUPAC (International Union of Pure and Applied Chemistry) nomenclature is used to names the…

Q: 9. What is the IUPAC of the following compound? (CH3CH2)3COH a) 2-Ethyl-2-pentanol b)…

A: Given,

Q: Give the IUPAC name for each compound.

A: a). The aldehyde contains four carbon straight chain. It is a derivative of butane. Numbering from…

Q: 12. What is the IUPAC name of the following molecule? Н a. 2-carbonylpropane b. 2-pentanal c.…

A:

Q: 3. What is the correct IUPAC name of the following compound? A)…

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: 14.9 Assign an IUPAC name to each of the following alcohols. а. b. ОН ОН с. ОН d. ОН

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: 5. What is the IUPAC name for the structure below? ОН A. 3-ethyl-4-methyl-2-hexanol B.…

A: To give IUPAC name to a molecule, at first we have to choose the longest carbon skeletal. The suffix…

Q: IUPAC name for each compound. a. e. CH: b. f.

A:

Q: 1. NH2 3.

A:

Q: IUPAC name of the following compound is: CHO HO A 4-Hydroxycyclopentanecarbaldehyde…

A: Given that : We have to identify the IUPAC name of the following compound : A.…

Q: Draw the following: 1. a. 3-methyl-1-butanethiol (skunk scent) b. triphenylmethanol c.…

A: (a) The structure of 3-methyl-1-butanethiol is given below.

Q: What is the IUPAC name of the following compound? CH;CH=CCH,CH,OH A 5-Hydroxy-3-phenylpent-2-ene B…

A:

Q: 3) What is the IUPAC name of the following alcohol? A) trans-4-methylcyclohexanol B)…

A: In the question , a diagram of an organic compound is given and it is asked in the question to give…

Q: Write the IUPAC name and any common name for each of the following ethers: a. CH;-CH,-CH2-0-CH,-CH3…

A: These compounds are ethers. They are named by the IUPAC or common systems. The IUPAC name is…

Q: What is the correct IUPAC name of an Aldehyde below? CH, H;C 4-methyl pentanal 2-methyl pentanal…

A: The answer is as follows:

Q: 10. What is the IUPAC name for the compound shown below? CH3 CH3-Ö-CH-CH-CH3 A. 2-methyl-4-pentanone…

A: We have an organic compound , we have to predict the IUPAC nomenclature of the compound.

Q: 12.2 Give the IUPAC name for each of the following: a. OH b. CH, CH,-CH; -CH-CH;-OH c. OH d.

A: "Since you have asked multiple Questions with multiple subparts, therefore I am solving one for you.…

Q: 1. Give the IUPAC name for each of the following: a. CH3-CH2-CH2-C-OH | b. CH3-CH2-C-0-CH2-CH3 c.…

A: give Numbering to the longest carbon chain then Write name.

Q: CI A D F G H

A:

Q: он он 8. a 9. 10. ÓCH,CH,CH, 11.

A:

Q: Give the IUPAC name for the following compound. Be sure to answer all parts. O cis 12…

A: Here we have to write the complete IUPAC name of the following given compound.  The writing IUPAC…

Q: CH3 HO. CH CH CH3

A: The compound given is,

Q: Give the IUPAC name for each compound. он LOH но он он OH d.

A: d) The compound given is having alcohol i.e -OH as major functional group. The longest carbon chain…

Q: What is the IUPAC name of the aldehyde or ketone starting material needed to make each of the…

A: Oxidation is a process which loss electron or there is gain in oxygen Reduction is a process which…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: Write the IUPAC names for these alcohols. a. но но ČH3 b. OH ČH3 C. H3C. HO Br d. H. Br HO

A: Given compounds are : Write the IUPAC names of the given compounds = ?

Q: 7. JOjea 8. 10 11.1 12 13 I 14 16 1 17 18 II. B- Assign IUPAC name to each of the following…

A: For naming of alcohol select the longest possible chain of carbon and for alcohol suffix 'ol' is…

Q: Juestion Write the IUPAC name for each compound: сно CHO (a) (e) Question 2

A: Since you have asked multiple question, we will solve the first question for you.If you want any…