Answered: Assign a systematic name to the…

Science

Chemistry

Assign a systematic name to the following coordination compounds: (a) [Zn(H2O);OH]Br (b) Na[CuFal

Appl Of Ms Excel In Analytical Chemistry

2nd Edition

ISBN:9781285686691

Author:Crouch

Publisher:Crouch

Chapter11: Dynamic Electrochemistry

Section: Chapter Questions

Problem 8P

See similar textbooks

Related questions

Q: The coordination compound [Pt(NH₃)₂(SCN)₂] displays two types of isomerism. Name the types and give…

A: This compound exhibits geometric (cis-trans) and linkage isomerism. The SCN-ligand can bond to the…

Q: Describe the bonding situation in charge-transfer complexes

Q: What is the name of the coordination compound Na3[Co(CN)6] ?

A: Following rules are applied for naming: 1)Positive part of complex compound will be name…

Q: Give the systematic name for the following coordination compound: K₂[CrCO(CN)₅]

A: In the given coordination compound the cation is K+ and the anion is complex [CrCO(CN)₅]2-. The…

Q: Give the systematic name for the following coordination compound: [NiCl₄]²⁻

A: [NiCl₄]²⁻ The above coordination compound systematic name is, Tetrachloronickelate (II) ion A…

Q: Indicate the coordination number and the oxidation num- ber of the metal for each of the following…

A: The oxidation of central metal atoms of given coordination compounds are calculated as,

Q: Pota um cobaltinitrite, also known as Indian Yellow, is a salt with the formula K3[Co(NO2)6]. It is…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: (d) [Cr(OH)2]¿** ions are pale blue-green but chromate (Cr,0,) ion is an intense yellow in colour.…

Q: In [Cu(NH3)4]SO4.H2O, what is the type of the ligand, the coordination number, and the geometry?

Q: A complex is written as NiBr2 . 6 NH3. (a) What is the oxidationstate of the Ni atom in this…

A: (a) The given compound is [Ni(NH3)6]Br2 Oxidation number is the total number of electrons an atom…

Q: A complex is written as NiBr2 . 6 NH3. What is the likely coordination number for the complex?

A: The complex given is written as [Ni (NH3)6] Br2. The coordination number is given by the ligands…

Q: For the low spin coordination compound [Fe(en)2Cl]Cl, identify the Oxidation number of iron

A: Note : I think the complex should [Fe(en)2Cl2]Cl. So I'm giving answer for both the complex.

Q: What is the coordination number of the chromium ion in the complex ion [Cr(NH₃)₄Cl₂]⁺?

A: The compounds which contain a central metal atom or ion surrounded by oppositely charge ion or…

Q: Give the systematic name of this coordination compound. CO(NH,),Cl,]: Triamminetrichlorocolbalt(III)…

A: There are total 6 ligands three ammonia ligands and three Chlorine ligands.

Q: Write a complete and balanced redox equation for the synthesis of the coordination compound. Use…

A: here we are required to write the complete balanced redox reaction for the synthesis of iron(III)…

Q: Give the systematic name for the following coordination compound: Na[Ag(CN)₂

Q: Draw the structure of the complex, [Ni(NH3)6][BF4]2, including approximate bond angles (in °).…

A: The objective of the question is to draw the given complex and write the angle and geometry.

Q: structure of chelate when the polydentate ligand, ethylenediaminetetraacetate ion (EDTA 4 ) is…

Q: What is the coordination number of cobalt in [Co(en)2Br21Br? (ethylenediamine, en H2NCH2CH2NH2)

A: Topic-- Coordination no in the Co-ordination Complex

Q: 2. Red crystalline [NiCl,(PPh,CH,Ph)2] is diamagnetic. On heating to 387 K for 2 hours, a blue-…

A: In this complex, nickel is in +2 oxidation state and it has valence shell electronic configuration…

Q: Give the systematic name of this coordination compound. Na[Au(CN),] systematic name:

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Consider a coordination compound, [A]B where [A] forms the complex ion and B is the counter ion. The…

Q: Let us consider the following coordination complexes: [Fe(CN6)]3- Deduce from these electronic…

A: Crystal field splitting The splitting of degenerate d-orbitals in presence of ligands is called…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: 3.6. Draw all possible isomers, geometrical and optical of the coordination compound…

Q: coordination number of Co^3+ complex is a 3 b 4 c 5 d 6

A: Coordination number:The number of ligands that are directly bonded with central metal ion is said to…

Q: Give the systematic name of this coordination compound. Co(NH,),Cl,: triamminetrichlorocolbalt (III)…

A: The nomenclature of inorganic complexes is done according to the following rules: a) The name of the…

Q: Metal complex A appears blue (440 nm) and complex B appears red (670 nm). Which has a larger value…

A: When a metal complex appears blue, it absorbs the complementary color orange When a metal complex…

Q: Indicate the likely coordination number of the metal in each of the following complexes: (a)…

A: Coordination number is the sum of ligand atoms attached to the central atom. That means the ligands…

Q: A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO4 , and…

A: A co-ordination compound is a compound containing a central metal atom bound to ligands. The central…

Q: Give the systematic name for the following coordination compound: CI- .F Со

A: While naming any complex ion, the ligands are always named before the metal ion. If multiple ligands…

Q: Give the systematic name for the following coordination compound: [Pt(NH₃)₅Cl]Br₃

A: Pentaamminechloroplatinum (IV) bromide

Q: Palladium(II) tends to form complexes with coordination number 4. A compound has the composition…

A: The chemical compounds consisting of neutral molecules or anions attached to the central metal atom…

Q: Name the following coordination entities and describe their structures :(i) [Fe(CN)6]4-(ii)…

A: 1) FeCN64- IUPAC name - There are 6 cyanide groups present . The oxidation state of Fe here is +2.…

Q: The maximum absorption for the complex ion [Co(NH3 )6 ] 3+ is located at 470 nm. A) Predict the…

A: The wavelength absorbed by the complex is 470 nm Color of the coordination complex will be…

Q: Give the systematic name for the following coordination compound or complex ion: Cs,[CUCI,]

A: We have to give the name for given compound.

Q: ) trans-[Co(en)2Cl2]Cl is a chiral compound ) The coordination number for the anionic complex in…

A: If any molecule has sigma plane of symmetry or inversion centre , then we can say the molecule is…

Q: What is the formula for the coordination compound potassium tetrachlorocobaltate(II) ?

A: Coordination compounds are also known as complex compounds. These are special compounds as when they…

Q: Give the systematic name of this coordination compound. [(en), ]Cl, systematic name:

A: Rules for naming complex compounds :- In coordination sphere ligands are named fist in alphabetical…

Q: What is the oxidation number of the central metal atom in the coordination compound [Pt{NH3)3CI]CI?

Q: The complex (Fe(H,O)]* is paramagnetic. Is the H,0 ligand inducing a strong or weak field?

A: The coordination complex is the compound that does not lose its identity in the solution. The…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: Coordination number is defined as the number of ligands that are attached to a metal in a complex…

Q: Write the Werner's formula of a coordination compound called Sodium diaquatetrachlorocobaltate(Il).

A: Werner's theory tells us that metal have two valencies. They are primary and secondary valency. The…

Q: structure for the trans-diamminedichloridoplatinum(II) coordination complex. Al

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

Assign a systematic name to the following coordination
compounds:
(a) [Zn(H2O);OH]Br
(b) Nas[CuF6]

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
A coordination compound of cobalt(III) contains four ammonia molecules, one sulfate ion, and one chloride ion. Addition of aqueous BaCl2 solution to an aqueous solution of the compound gives no precipitate. Addition of aqueous AgNO3 to an aqueous solution of the compound produces a white precipitate. Propose a structure for this coordination compound.
What is the LFSE for the [Re(H2O)6]3+complex, knowing that ΔΔo = 33000 cm-1 and P= 15000 cm-1 ?
Consider the following complexes: [FeCl6]3- and [Fe(CN)6]3-, which possess very different magnetic moments. Give the calculated magnetic moment and CFSE for each. Would you expect either of the complexes to be distorted?
Its magnetic moment is 4.0 B.M. Are the Co-O bond lengths the same in the six-coordinated [Co(H2O)6]2+ complex? Let's explain why.
The magnetic moment of [Mn(NCS)6]4- is 6.06 μBM, is it high or low spin? why?
What are the coordination numbers of cobalt(III), plat-inum(II), and platinum(IV) in complexes?
How do we know the coordination number was 6? How do I find out the actual representation of the complex?
The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectreinfrared shows two bands that are attributed to C-O stretching, and only one for theC-N stretching Are bromides cis- or trans-? explain.
Heating 2.0 mol of a coordination compound gives 1.0mol NH3, 2.0 mol H2O, 1.0 mol HCl, and 1.0 mol(NH4)3[Ir2Cl9]. Write the formula of the original (sixcoordinate) coordination compound and name it.