At 25 °C, a titration of 15.00 mL of a 0.0200 M AGNO, solution with a 0.0100 M NaI solution is conducted within the cell SCE || titration solution | Ag(s) For the cell as written, what is the potential after the addition of each volume of Nal solution? The reduction potential for the saturated calomel electrode is E = 0.241 V. The standard reduction potential for the reaction Ag+ + e → Ag(s) is E° = 0.79993 V. The solubility constant of AgI is Kp = 8.3 x 10-17. 0.500 mL E = V

At 25 °C, a titration of 15.00 mL of a 0.0200 M AGNO, solution with a 0.0100 M NaI solution is conducted within the cell SCE || titration solution | Ag(s) For the cell as written, what is the potential after the addition of each volume of Nal solution? The reduction potential for the saturated calomel electrode is E = 0.241 V. The standard reduction potential for the reaction Ag+ + e → Ag(s) is E° = 0.79993 V. The solubility constant of AgI is Kp = 8.3 x 10-17. 0.500 mL E = V

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 115AE: The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making...

See similar textbooks

Related questions

Q: Given the hypothetical metal samples a, B, and y were placed in an electrochemical cell as…

A: The standard reduction potential of alpha can be calculated by the general electrochemical formula…

Q: The following galvanic cell is constructed at 273 K. Each aqueous phase reactant and product has a…

A: graphite(s) | X2 (g) | XO4- , H+ || YO3-, YO2- , H+ | graphite(s)

Q: A galvanic cell was prepared by immersing an anode and a cathode of the same material (of A type) in…

A: The question is about a concentration cell based on A+

Q: two grams of copper (A.W. = 63.54g g/mol, density = 8.93g/cm^3) dissolves in 500g of water to…

A: Reaction: Cu→Cu2+ + 2e- Using Nernst equation: ECell=Ecell∘-0.05912logCu2+

Q: A concentration cell was set up at 300 K using two hydrogen electrodes. If the cell is generating a…

A: a) To determine the concentration of H+ in the cathode half-cell reaction, For a concentration…

Q: A galvanic cell was prepared by immersing an anode and a cathode of the same material (of A type) in…

Q: A galvanic cell using Cut/Cu and Zn2+/Zn was set up at 329 K and the non-standard cell potential was…

Q: A galvanic cell is based on the following half-reactions. Fe2+ (aq) +…

A: The standard reduction potentials of half- cell reactions are, The most positive standard reduction…

Q: A Cr(s) | Cr(aq)|| Fe*(aq) | Fe(s) galvanic cell has a standard cell potential of 0.700 V. Calculate…

A: We have find out the ∆G and maximum amount of work done by the cell on the surrounding.

Q: Calculate the cell potential for the galvanic cell in which the reaction Cd(s) + Cu²* (aq) =…

Q: A student does an experiment to determine the molar solubility of lead(II) chloride. She constructs…

A: Since lead has been used in both anode and cathode compartments in the same electrolytic solution,…

Q: Consider the reaction, 2Ag+ + Cd → 2Ag + Cd2+ The standard electrode potentials for Ag+…

A: Given electrochemical reaction: 2Ag+ + Cd → 2Ag + Cd2+ And, the standard electrode potential as…

Q: The standard cell potential for the reaction provided below is-2.431V, calculate the cell potential…

Q: 5. (a) A galvanic cell consisting of a Cd electrode dipping into a 1.0 M CdCl2 solution and a Pt…

A: Here, we have to determine the standard cell potential of the following cell in which Cd metal…

Q: At 25ºC, you conduct a titration of 20.00 mL of a 0.0400 M AgNo3 solution with a 0.050 M NaI soution…

Q: A galvanic cell was constructed with a nickel electrode that was dipped into 1.4 M NiSO4 solution…

A: Given-> Ecell = 0.502 V E°cell = 0.487 V [Ni2+] = 1.4 M [Cr3+] = ?

Q: A Zn²+ Zn half-cell is connected to a Cu²+ Cu half-cell to make a galvanic cell, in which [Zn²+] =…

Q: Given that the standard electrode potentials (E°) of metals are :K+/K = -2.93 V, Ag+/Ag = 0.80 V,…

A: Lower the value of reduction potential, stronger the reducing agent and higher the value of…

Q: Write the balanced reaction occurring in the voltaic cell. Compute the standard cell potential,…

A: Given : Concentration of Ni(NO3)2 = 0.25 M Concentration of Pb(NO3)2 = 0.50 M E°Ni+2/Ni = -0.25 V…

Q: An electrochemical cell utilizes the following redox process at 25oC: Sn2+(aq) + X(s) → Sn(s) +…

A: Given E°cell = 0.14 V Sn2+ (aq) + X(s) → Sn(s) + X2+ (aq) E°Sn2+/Sn = -0.14

Q: Calculate the equilibrium constant K for the following reaction at 25°C from standard electrode…

Q: Given that the standard electrode potentials (E°) of metals are:K+/K = -2.93 V, Ag+/Ag = 0.80…

A: standard electrode potentials (E°) is inversely proportional to reducing power Higher standard…

Q: 11.)

A: We have given that From representation of the cell reaction Oxidation half reaction : Zn(s)…

Q: Calculate the cell potential of a cell operating with the following reaction at 25°C in which…

A: The electrochemical cell consists of two half-cell reactions where there is oxidation and reductions…

Q: Use the Nernst equation to determine the cell potential, Ecell, of the galvanic cell consisting of…

Q: For the following galvanic cell: Zn(s) + Ni+2(aq) → Zn+2(aq) + Ni(s) A. Of the two half reactions…

A: Since you have posted question with multiple subparts as per guidelines we can answer only three per…

Q: The standard reaction Gibbs energy for the reaction: K2CrO4 (aq) + 2 Ag (s) + 2 FeCl3 (s) → Ag2CrO4…

Q: A galvanic cell was constructed with a nickel electrode that was dipped into 1.8 M NISO4 solution…

Q: Consider the following reaction: MnO4 (ag) + 5FE2+ + 8H (aq) - Mn2+ (aq) + 5FE3+ (aq) + 4H2O) (aq)…

Q: Calculate the potential of the following half-cell take ionic strength effect into consideration:…

A: The half cell reaction taking place is: Standard potential (E0) = 0.77 V Number of ions displaced…

Q: Given: NO3 -> NO(g) ɛ° = 0.96 V %3D Sn4+ -> Sn2+ ɛ° = 0.13 V The two half cells were coupled to…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Calculate the cell potential for the galvanic cell in which the reaction Fe(s) + Au³+(aq) =…

Q: If the following half-cells are the right-hand electrode in a galvanic cell with a standard hydrogen…

A: Given information: a) Ag |AgI(sat’d), KI(0.0898 M) b) Pt |Sn2+(0.0893 M), Sn4+(0.215 M) c)…

Q: 2Sc(s) + Cr203 (aq) + 14H*(aq) → 2Sc3+ (aq) + 2Cr3+ (aq) + 7H20 (1) Cr20 (aq) + 14H* (aq) + 6e- →…

Q: For the reagents below: - Write the redox half-reactions involved for each compound - Write the…

Q: * :For Electrode Potentials The potential difference between the electrodes of the cell cannot be…

Q: For an electrochemical cell 25oC with the following over-all reaction: Ag+(aq) + Br-(aq) → AgBr i.…

A: electrolysis is a redox process process where an electrolyte undergo decomposition into ions when…

Q: An

A: We will calculate nfactor

Q: Half-Reaction Standard Reduction Potential , E°(V) Ag+(aq)+e−→Ag(s)…

A: Given that E°(V) Ag+(aq)+e−→Ag(s) +0.80…

Q: A galvanic cell is made using a Cu/Cu2 (1.0 M) electrode and an Fe/Fe2 (1.O M) electrode. What is…

A: Standard electrode potential is defined as " The value of the standard emf of a cell in which…

Q: Half-Reaction Standard Reduction Potential, E°(V) Ag+(aq)+e−→Ag(s) +0.80 Pb2+(aq)+2e−→Pb(s) −0.13…

Q: Calculate AG° for the following cell reaction: TI(s) | TI* (aq) || Ni²+ (ag) | Ni(s) From AG°,…

Q: At 25C and pH 7, a solution containing compound A and its reduced form AH2 has standard electrode…

A: (i) The standard potentials are given for A and B which can be represented as; A+2H++2e-→AH2…

Q: Calculate the cell potential of a cell operating with the following reaction at 25°C in which [Cry…

Q: Given the hypothetical metal samples a, B, and y were placed in an electrochemical cell as…

A: The solution is as follows:

Q: Calculate AGº for the following cell reaction: TI(s) | TI* (aq) || Pb3* (aq) | Pb(s) From AG°,…

A: Cell Reaction : 2 Tl (s) + Pb2+ (aq) -----> 2 Tl+ (aq) + Pb (s) Since for any reaction, the…

Q: In a galvanic cell the cathode is an Ag+(1.00 M)/Ag(s)half-cell. The anode is a standard hydrogen…

A: The given data contains, Molarity of benzoic acid = 0.10 M Molarity of Sodium benzoate = 0.050 M The…

Q: e other half-cell is composed of an inert electrode in a solution containing a mixture of Fe 1 Fe*…

A: Since your question has multiple sub-parts, we will answer the first three sub-parts for you. If you…

Q: A galvanic cell was constructed with a nickel electrode that was dipped into 1.1 M NiSO4 solution…

Q: The Nernst Equation A nonstandard cell or half-cell potential can be calculated using the Nernst…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

At 25 °C, a titration of 15.00 mL of a 0.0200 M AGNO, solution with a 0.0100 M Nal solution is conducted within the cell
SCE || titration solution | Ag(s)
For the cell as written, what is the potential after the addition of each volume of Nal solution? The reduction potential for
the saturated calomel electrode is E = 0.241 V. The standard reduction potential for the reaction Ag+ + e-
E° = 0.79993 V. The solubility constant of AgI is Kgp = 8.3 × 10-1".
Ag(s) is
>
0.500 mL E =
V
18.90 mL
E =
V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Step 7

Step 8

Step 9

Trending now

This is a popular solution!

Step by step

Solved in 9 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.