Answered: Balance the equation: Cu(s) + H2S(g) +…

Science

Chemistry

Balance the equation: Cu(s) + H2S(g) + O2(g) → Cu2S(s) + H2O(l)

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.7E: Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c....

See similar textbooks

Related questions

Q: Balance the following chemical equation (if necessary): FeCl:(aq) + Na2S(aq) → Fe:S:(s) + NaCI(aq)

A: The following Chemical Equation can be balanced as follows -

Q: Balance the following chemical equation and determine the mass in grams of FeO(s) needed to produce…

A: The reaction given is, => FeO (s) + C (s) → Fe (s) + CO2 (g) Given: Mass of Fe to be produced =…

Q: balance the equation and indicate the type of reaction H2 (g) + Cu(NO3)2 (aq) → HNO3 (aq) + Cu (s)

A: Please find your solution below : Balanced reaction is a reaction in which the number of atoms of…

Q: Balance the following chemical equation (if necessary): Si,H,(s) + O,(g) → SiO,(g) + H,O(g)

A: We have to predict the balanced chemical reaction.

Q: Balance the following chemical equation (if necessary): Ca(s) + O,(9) → CaO(s)

A: The given equation is, Ca(s) + O2(g) → CaO(s)

Q: Balance the following chemical equation (if necessary): Al(s) + Pb(NO:)>(aq) → Pb(s) + AI(NO3)3(aq)

A: The reaction given is Al (s) + Pb(NO3)2 (aq) --------> Pb (s) + Al(NO3)3 (aq) Since we have 3 N…

Q: Identify the type of reaction, and balance it: 6. Qn + Fv,P Fv + On,P a type of reaction

Q: Balance the following equation by algebraic method. Fe +1 Fe,O;

Q: Balance the following chemical equation (if necessary): NaOH(aq) + H,SO,(aq) → H̟O() + Na sO̟(aq)

Q: Balance the following chemical equation (if necessary): Ca(OH),(s) + H,PO,(aq)→ H,O(1) +…

Q: Which substance is oxidized in the balance equation below? 3HS+103+3H' I+35+ 3H20 OS OS2 in HS 1in…

A: Oxidation is the loss of electrons during a reaction by a molecule, atom, or ion. Oxidation occurs…

Q: Balance the following chemical equation (if necessary): HgO(s) → Hg(1) + O2(g)

A: The reaction given is NH3 (aq) + H2O (l) ------> NH4+ (aq) + OH- (aq) Since all the atoms in both…

Q: Balance the following chemical equation (if necessary): AGNO:(aq) + MgCl2(aq) → AgCl(s) +…

A: A "balanced molecular equation" comprises identical number of existing atoms in all engaged…

Q: Balance the following chemical equation (if necessary): Sn(CIO,)4(s) SnCl.(s) + O2(g)

A: A balanced chemical reaction occurs when the number of the atoms involved in the reactants side is…

Q: РЫ(ОН)д (аq) 2- + CIO (aq) > РЬО2 (s) + Cl* (aq)

Q: Balance the following double replacement reaction. Bi(OH)5 (aq) + Ti3(PO3)4 (s) →…

A: chemical reaction :- Bi(OH)5 (aq) + Ti3(PO3)4 (s) → Bi3(PO3)5 (s) + Ti(OH)4…

Q: Balance the following chemical equation (if necessary): Fe(NO:):(aq) + Sn(s) → Fe(s) + Sn(NO:)2(aq)

A: Chemical equations are symbolic representation of chemical reaction. The coefficient in the balanced…

Q: Balance the following chemical equation (if necessary): (NH,),SO,(aq) + BaCl,(aq) → BaSO,(s) +…

A: The reactions must be balanced in order to follows the law of conservation if mass i.e mass can…

Q: Balance the following chemical equation (if necessary): Mg(OH),(s) + HCI(aq) ¬H,O() + MgCI, (aq)

A: We needs to equate number of atoms on both the side i.e., reactants and product in accordance with…

Q: What is the coefficient of silver metal after balancing the following equation? _Cu(s) + _AgNO3(aq)…

A: A balanced chemical reaction occurs when the number of the atoms involved in the reactants side is…

Q: Balance the following chemical equation (if necessary): H2SO«(aq) + Pb(OH)4(s) Pb(So.)2(s) + H2O(1)

A: The reaction given is => H2SO4 (aq) + Pb(OH)4 (s) --------> Pb(SO4)2 (s) + H2O (l)

Q: Fe + Cuo-Fe2O3+ Cu

A: In this problem the provided equation has to be balanced: Fe + CuO → Fe2O3 + Cu Iron reacts with…

Q: The equation for the reaction between phosphorus and oxygen is shown. xP4 + yO2 → ZP2O5 Which values…

A: xP4 + yO2 → ZP2O5 ........[1] 1. Let, x=1 The number of P in the left-hand side of the…

Q: Balance the equation for the following precipitation reaction, and then write the net ionic…

A: Ni(NO3)2(aq) + Na2CO3(aq) -------> NiCO3 (s)+ 2NaNO3(aq) Required Balanced equation

Q: Balance the following chemical equation (if necessary): C.H«(g) + O:(g) – CO:(g) + H:O(g)

Q: Balance the following chemical equation (if necessary): MnO2(s)+HCI(aq)=MnCl2(aq)+H2O(i)+CL2(g)

A: Interpretation - To balance the following given chemical equation which is given as -…

Q: Balance the following chemical equation (if necessary): C,H,O,(9) + O,(9) → H¸O(g) + CO,(g)

A: The equation need to be balanced in order to follow the law of conservation of mass i.e mass a…

Q: NH.NO:(s) → N2(g) + H2O(1)

A: The equation can be balanced using hit and trail method.

Q: Balance the following chemical equation (if necessary): SICI.(s) + H2O(1) → H,S¡O«(aq) + HCI(aq)

A: The given unbalanced equation is as follows: SiCl4(s) + H2O(l) → H4SiO4(aq) + HCl(aq) All the atoms…

Q: Balance the following chemical equation (if necessary): Ag,CO,(s) Ag(aq) + CO, (aq)

Q: Balance the following reaction: Mg + He →→→ H+ ? O Si O 30 Si O2 Al 13 O 28 Si 29 O 23 Al 13

A: Since, Balanced nuclear reaction means number of proton in both side is equal and also mass number…

Q: Balance the following equation for the reaction that occurs when chlorine is dissolved in basic…

A: The given reaction has to balanced,

Q: Copper metal heated with sulfur produces solid copper(ii) sulfide. Write the balanced equation and…

A: The reactants given are copper metal and sulfur to produce copper (II) sulfide.

Q: Balance the following chemical equation (if necessary): Sn(CIO.)«(s) –→ SnCl«(s) + O2(g)

A: A chemical reaction should always be balanced so as to know the real stoichiometry of the reaction.…

Q: Balance the following equation: Fe;O, (s) * Mg(a) MgO (s) + Fe(s)

A: Introduction: The chemical equation shows the reaction between the two or chemical species and their…

Q: Balance the following equation: Fe(s) + O2(g)——-> Fe2O3(s)

A: When atoms and charges on both sides (reactants as well as products) of the reaction are equivalent,…

Q: Sn(CIO:)«(s) → SnCl:(s) + O:(g)

A: We need to balance the given equation. Balanced chemical equation contain equal number of atoms on…

Q: Balance the following chemical equation (if necessary): Sn(CIO,)4(s) → SnCl.(s) + O2(g)

Q: Balance the following chemical equation (if necessary): ZnS(s) + AIP(s) –→ Al,S,(s) + Zn,P,(s)

A: The reaction taking place is given as, => ZnS (s) + AlP (s) → Al2S3 (s) + Zn3P2 (s)

Q: Balance the following chemical equation (if necessary): BF (s) + Li:SOs(s) → LiF(s) + B:(SO.)»(s)

A: Chemical reactions are written equation form ,to balance a chemical equation following steps are…

Q: Balance the following equation for the reaction of arsenic(III) sulfide with aqueous chloric acid:…

A: Balancing a chemical reaction is a stepwise process that requires a hit and trial method. Here the…

Q: Balance the following equation by filling the gaps with appropriate numbers. Zn + HCI ZnCl2 + H2

A: The question is based on the concept of chemical reactions . we have to balance the given reaction.

Q: Balance the following chemical equation (if necessary): C,H,(9) + O,(9) → CO,(9) + H¸O(g)

Q: Balance the following chemical reaction equation: ___Fe2O3 + ___ CO → ___Fe + ___ CO2

A: A balanced equation has equal number of each atoms on either side.

Q: Balance the following chemical equation (if necessary): Sio,(s) + C(s) → Si(s) + CO(g) ->

Q: Balance the following chemical equation (if necessary): KOH(aq) + H,S(aq) →H̟O1) + K,S(aq)

Q: (Balance the equation) FeCl+NaOHàFe(OH)3+NaCl

A: Note: The compound FeCl does not exist. Hence, the compound FeCl3 is taken as the one of the…

Question

Balance the equation:

Cu(s) + H₂S(g) + O₂(g) → Cu₂S(s) + H₂O(l)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

The balanced equation for the reduction of iron ore to the metal using CO is Fe2O3(s) + 3 CO(g) 2 Fe(s) + 3 CO2(g) (a) What is the maximum mass of iron, in grams, that can be obtained from 454 g (1.00 lb) of iron(III) oxide? (b) What mass of CO is required to react with 454 g cot Fe2O3?
Balance the following equations: (a) for the reaction to produce "superphosphate" fertilizer Ca3(PO4)2(s) + H2SO4(aq) Ca(H2PO4)2(aq) + CaSO4(s) (b) for the reaction to produce diborane, B2H6 NaBH4(s) + H2SO4(aq) B2H6(g) + H2(g) + Na2SO4(aq) (c) for the reaction to produce tungsten metal from tungsten(VI) oxide WO3(s) + H2(g) W(s) + H2O() (d) for the decomposition of ammonium dichromate (NH4)2Cr2O7(s) N2(g) + H2O() + Cr2O3(s)
Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acid
Balance the following equations representing combustion reactions: a. b. c. C12H22O11 (s) + O2(g) CO2 (g) + H2O (g) d. Fe(s) + O2(g) Fe2O3(s) e. FeO(s) + O2(g) Fe2O3(s)
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
Write balanced net ionic equations for the following reactions in acid solution. (a) Liquid hydrazine reacts with an aqueous solution of sodium bromate. Nitrogen gas and bromide ions are formed. (b) Solid phosphorus (P4) reacts with an aqueous solution of nitrate to form nitrogen oxide gas and dihydrogen phosphate (H2PO4-) ions. (c) Aqueous solutions of potassium sulfite and potassium permanganate react. Sulfate and manganese(II) ions are formed.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c. Zn(s)+HNO3(aq)Zn(NO3)2(aq)+H2(g) d. K2SO4(aq)+BaCl2(aq)BaSO4(s)+KCl(aq) e. dinitrogenmonoxidenitrogen+oxygen f. dinitrogenpentoxidenitrogendioxide+oxygen g. P4O10(s)+H2O(l)H4P2O7(aq) h. CaCO3(s)+HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)