Answered: Balance the following equation by…

Science

Chemistry

Balance the following equation by algebraic method. Al + O2 Al,O3

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.7E

See similar textbooks

Related questions

Q: 4. H2SO4 + Al(OH)3 -----> Al2(SO4)3. + H2O

A: When sulfuric acid reacts with aluminium hydroxide products are aluminium sulfate and water. H2SO4…

Q: Balance the following equation by algebraic method. K + H2O → KOH…

A: Given To balance the following equation by algebraic method. K + H2O → KOH + H2

Q: Balance the following equation by filling the gaps with appropriate numbers. Ca + HCI CaCl2 H2

Q: Balance the following reactions and name what type of reaction it is: NH3 + H2SO4---- (NH4)2SO4

A: The given reaction is balanced as follows,

Q: balance the equation and indicate the type of reaction H2 (g) + Cu(NO3)2 (aq) → HNO3 (aq) + Cu (s)

A: Please find your solution below : Balanced reaction is a reaction in which the number of atoms of…

Q: Balance the equation As,O3(s) + Ca(OH)2(ag) →C33(AsO4)2(s) + H,O(1)

A: The given reaction is not a redox reaction, therefore the reaction will be balanced by simply…

Q: How do you balance this chemical equation? Fe(OH)2 + O2 + H2O ---> Fe(OH)3

Q: Complete and balance the following chemical reaction: Ag + HCl -->

A: Given;

Q: KCI H2 + F2 HF 9. Fe + O2→ Fe:O4 10. Mg + HCI → MgCl2 8. +. + H2

A: 4 reactions are given . We have to balance them and identify the type of reaction . When two species…

Q: Balance the following equation by algebraic method. Fe +1 Fe,O;

Q: Balance the following chemical equation (if necessary): H2SO«(aq) + Pb(OH)a(s) → Pb(SO4)2(s) +…

Q: Balance the following chemical equation (if necessary): NaOH(aq)+H₂SO₄(aq)→H₂O(l)+Na₂SO₄(aq)

A: The given reaction is, NaOH(aq)+H₂SO₄(aq)→H₂O(l)+Na₂SO₄(aq) The above reaction is a…

Q: Balance the following chemical equation (if necessary): HgO(s) → Hg(1) + O2(g)

A: The reaction given is NH3 (aq) + H2O (l) ------> NH4+ (aq) + OH- (aq) Since all the atoms in both…

Q: Balance the following chemical equation (if necessary): AGNO:(aq) + MgCl2(aq) → AgCl(s) +…

A: A "balanced molecular equation" comprises identical number of existing atoms in all engaged…

Q: Balance the following chemical equation (if necessary): Sn(CIO,)4(s) SnCl.(s) + O2(g)

A: A balanced chemical reaction occurs when the number of the atoms involved in the reactants side is…

Q: B, Al, TI, In, Ga, Sc, Y, Fe, Co, Ni, group I, group II No1 Complete and balance (by electronic…

A: As per our guidelines I can answer only first three sub-parts of the question. Because you have…

Q: Balance the following reactions: ___ Zn (s) + ___ HCl (aq) à ___ ZnCl2 (aq) +…

A: According to the law of conservation of mass, the quantity of each element does not change in a…

Q: Identify the chemical formulas physical and chemical states of the products reaction:…

A: For balancing a chemical equation, the number of each atom must be same on either side of the…

Q: Write the balanced equation, the ionic, and net ionic equation for the reaction of Iron ll Nitrate…

A: A chemical equation in which the electrolytes of aqueous solution are represented as dissociated…

Q: Balance the following chemical equation (if necessary): Ca(OH):(s) + H:PO:(aq) → H2O(1) +…

A: The reaction given is Ba2+ (aq) + SO42- (aq) --------> BaSO4 (s) Since the number of all the…

Q: Balance the following chemical equation (if necessary): H2SO«(aq) + Pb(OH)4(s) Pb(So.)2(s) + H2O(1)

A: The reaction given is => H2SO4 (aq) + Pb(OH)4 (s) --------> Pb(SO4)2 (s) + H2O (l)

Q: Balance the following equation. C8H16O + O2 ------> CO2 + H2O Provide a net ionic…

A: The answer to the following question is-

Q: What type of reaction it is and balance the equation: K.LiOH I.Mg+O2

A: Balanced chemical reaction are those in which number of atoms on left hand side and right hand side…

Q: Balance the equation for the following precipitation reaction, and then write the net ionic…

A: Ni(NO3)2(aq) + Na2CO3(aq) -------> NiCO3 (s)+ 2NaNO3(aq) Required Balanced equation

Q: Balance the following equation in acidic solution. When balanced with the smallest set of whole…

A: Given unbalanced reaction ; MnO4− + Br− ----> Mn2+ + Br2

Q: copper (II) oxide + sulfuric acid ----------> Reaction Type: Observations: Balanced Equation:

A: Acid is a substance that can donate hydrogen ions in an aqueous solution.

Q: Balance the following chemical equation (if necessary): C,H,O,(9) + O,(9) → H¸O(g) + CO,(g)

A: The equation need to be balanced in order to follow the law of conservation of mass i.e mass a…

Q: d. H2C,O4 + CaCI, → CaC,0. + HCI e. HCI + Al > AICI, + H2

Q: NH.NO:(s) → N2(g) + H2O(1)

A: The equation can be balanced using hit and trail method.

Q: Decomposition Reactions: Complete and balance: КОН AICI; Na,CO,

A: In decomposition reactions, one compound decomposes into two or more compounds or atoms.

Q: What type of reaction is present and balance the equation : m.Na+HCl

A: Sodium metal react with HCl and produce salt and hydrogen gas

Q: Balance the following chemical equation (if necessary): Sn(CIO.)«(s) –→ SnCl«(s) + O2(g)

A: A chemical reaction should always be balanced so as to know the real stoichiometry of the reaction.…

Q: Balance the following equation by filling the gaps with appropriate numbers. HCI HgCl, H2 Hg

A: Balanced chemical equation In the balanced chemical equation , number of different atoms on both…

Q: Sn(CIO:)«(s) → SnCl:(s) + O:(g)

A: We need to balance the given equation. Balanced chemical equation contain equal number of atoms on…

Q: Balance the following chemical equation (if necessary): Sn(CIO,)4(s) → SnCl.(s) + O2(g)

Q: 4. K+ Br2→ KBr 5. Sb + 2→ Sbla 6. Sr+ O2→ SrO

A: While balancing the reaction number of atom in reactant should be equal to number of that atom in…

Q: Balance the following chemical equation (if necessary): ZnS(s) + AIP(s) –→ Al,S,(s) + Zn,P,(s)

A: The reaction taking place is given as, => ZnS (s) + AlP (s) → Al2S3 (s) + Zn3P2 (s)

Q: Balance the following equation by filling the gaps with appropriate numbers. Zn + HCI ZnCl2 + H2

A: The question is based on the concept of chemical reactions . we have to balance the given reaction.

Q: balanced chemical

Q: - Balance the following chemical equation. Show your complete solution. NH3) + O2®) → NO@)+ H2O®)

A: Balance the following chemical reaction & show complete solution : NH3(g) + O2(g) ---->…

Q: How to balance this equation: Al (s) + Cu+ (aq) --> Al3+ (aq) + Cu (s)

A: In order to write the balanced equation for a redox reaction, we need to write the two half reaction…

Q: 2. Balance the following equations: a) K(s) + H2O(1) K*(aq) + OH(aq) + H2(aq)

Q: type of reaction

Q: Complete and balance the following reaction, then give the product side of the balanced equation.…

A: Cu + ZnSO4 → Zn + CuSO4

Q: Balance the following equation by filling the gaps with appropriate numbers. OHgCl2 Hg + ICI → + H2

Q: Complete and balance gas-evolution equation. HC2H3O2(aq) + NaHSO3(aq) ------>

A: The balanced equation is as given below:

Q: Write a balanced equation for the given chemical reaction. CO, + H;0 → C,H1½O6 + O;

A: A chemical equation which contains same number of atoms on both reactant and product side is called…

Q: What numbers belong in the blank spaces to fully balance the following reaction? __Fe (s) + __Cl₂…

A: Since the sum of individual atoms on the left side of the equation matches the sum of the same atoms…

Concept explainers

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.

Question

Balance the following equation by algebraic method.
Al
O2
Al,03
+.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c. Zn(s)+HNO3(aq)Zn(NO3)2(aq)+H2(g) d. K2SO4(aq)+BaCl2(aq)BaSO4(s)+KCl(aq) e. dinitrogenmonoxidenitrogen+oxygen f. dinitrogenpentoxidenitrogendioxide+oxygen g. P4O10(s)+H2O(l)H4P2O7(aq) h. CaCO3(s)+HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
What is Hrxn for reaction of iron(III) oxide and carbon monoxide to give iron metal and carbon dioxide gas? Use the following reactions: 4Fe(s)+3O2(g)2Fe2O3(s)H=1648.4kJ4CO(g)+O2(g)2CO3(g)H=565.98kJ
Balance the following equations: (a) for the reaction to produce "superphosphate" fertilizer Ca3(PO4)2(s) + H2SO4(aq) Ca(H2PO4)2(aq) + CaSO4(s) (b) for the reaction to produce diborane, B2H6 NaBH4(s) + H2SO4(aq) B2H6(g) + H2(g) + Na2SO4(aq) (c) for the reaction to produce tungsten metal from tungsten(VI) oxide WO3(s) + H2(g) W(s) + H2O() (d) for the decomposition of ammonium dichromate (NH4)2Cr2O7(s) N2(g) + H2O() + Cr2O3(s)
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
Carbon dioxide from the atmosphere weathers, or dissolves, limestone (CaCO3) by the reaction CaCO3(s)+CO2(g)+H2O(l)Ca2(aq)+2HCO3(aq) Obtain H for this reaction. See Table 6.2 for the data.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Balance the following equations representing combustion reactions: a. b. c. C12H22O11 (s) + O2(g) CO2 (g) + H2O (g) d. Fe(s) + O2(g) Fe2O3(s) e. FeO(s) + O2(g) Fe2O3(s)
For this reaction, fill in the table with the indicated quantities for the balanced equation. 4 NH3(g) + 5 O2(g) → 4 NO(g) + 6 H2O(g)
A rebreathing gas mask contains potassium superoxide, KO2, which reacts with moisture in the breath to give oxygen. 4KO2(s)+2H2O(l)4KOH(s)+3O2(g) Estimate the grams of potassium superoxide required to supply a persons oxygen needs for one hour. Assume a person requires 1.00 102 kcal of energy for this time period. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 1.00 102 kcal of heat, calculate the amount of oxygen consumed and hence the amount of KO2 required. The ff0 for glucose(s) is 1273 kJ/mol.
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.