Concept explainers
What is ΔHrxn for reaction of iron(III) oxide and carbon monoxide to give iron metal and carbon dioxide gas? Use the following reactions:
Trending nowThis is a popular solution!
Chapter 5 Solutions
Chemistry: Principles and Practice
- The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forwardYou did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.arrow_forward2. In which of the following reactions is there a significant transfer of energy as work from the system to the surroundings? This occurs if there is a change in the number of moles of gases. C(s) + O2(g) → CO2(g) CH4(g) + 2 O2(g) → CO2g) + 2 H2O(g) 2 C(s) + O2(g) → 2 CO(g) 2 Mg(s) + O2(g) → 2 MgO(s)arrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardThree gas-phase reactions were run in a constant-pressure piston apparatus as shown in the following illustration. For each reaction, give the balanced reaction and predict the sign of w (the work done) for the reaction. . If just the balanced reactions were given, how could you predict the sign of w for a reaction?arrow_forward
- The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forward
- When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.arrow_forwardA sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?arrow_forwardNitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning