Answered: CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(…

CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq)CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq) Express your answer as a chemical equation. Identify all of the phases in your answer.

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 20E: The density of liquid NH3 is 0.64 g/mL; the density of gaseous NH3 at STP is 0.0007 g/mL. Explain...

See similar textbooks

Related questions

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 75.81 g/mol and…

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :- ZnO(s) + ∆ → Zn(l) + O2(g) To balance :- Given equation

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: The normal boiling point of water is Group of answer choices none of these 32°F 0°F 373 K 273 K

Q: H[(aд) + LiOH (ag)-> Express your answer as a chemical equation. Identify all of the phases in your…

A: Given a chemical reaction as following,HI(aq)+LiOH(aq)→we are asked to complete the above reaction.

Q: Sublimation, Extraction, Decantation, Filtration, Evaporation 1.Of the 5 methods listed for the…

A: The combination of soil, clay, or silt and water provides the suspension termed as mud. If the…

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: You are about to work some magic with matter. You have a rectangular cube of matter in its solid…

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s)K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s) Express your answer as a…

A: Given equation K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s)

Q: Qs2. You are given two similar looking white, organic crystalline solids and determine their melting…

A: Given information:The two organic compounds are similar in nature and melting points of first and…

Q: In this experiment both water and ethanol must be heated to a temperature above room temperature but…

A: A question based on properties of liquid that is to be accomplished.

Q: Write a balanced chemical equation for the fermentation of sucrose (C12H22O11) by yeasts in which…

A: Balanced chemical equation of a reaction is written according to law of conservation of…

Q: Ca(OH)2 (aq) + HNO3 (aq) → H2O(1) + Ca(NO3)2 (aq) Express your answer as a chemical equation.…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: A student obtained a solid product in a laboratory synthesis. To verify the identity of the solid,…

A: Melting point can be used to determine the purity of a compound. Pure substances have a sharp…

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

Q: The following defined relationships describe an antiquated set of British liquid units: 1 hogshead =…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 77.15 g/mol and…

A: A crystal lattice comprises of several init cells. The number of atoms in simple cubic unit cell is…

Q: Question attached

A: Acid react with a base to form salt and water.

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 61.8 g/mol and…

A: Atomic radius (a) = 0.163 nm =1.63 x 10-8 cm Atomic Weight = 61.8 g/mol

Q: с / в A C D F Temperature Drag the correct answer into the correct blank. You will not use all the…

A: Answer:- These questions are answered by using the simple phase diagram in which all three phase…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 69.13 g/mol and…

Q: A 463.4 mL sample of carbon dioxide was heated to 303 K. If the volume of the carbon dioxide sample…

A: Given Initial Volume ( V1 ) = 463.4 mL Final Volume ( V2 ) = 712.7 mL Final Temperature ( T2…

Q: HCl(aq)+Ba(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

Q: Non-fluid is a classification of matter, where its molecules are rigid or fixed and they don't move.…

A: Non-fluid :- It is a matter, where its molecules are rigid or fixed and they don't move. Find out…

Q: P4(s)+O2(g)⟶P4O10(s)P4(s)+O2(g)⟶P4O10(s) Express your answer as a chemical equation. Identify all…

Q: Write a balanced chemical equation for each of the following. Express your answer as a chemical…

A: Hi there, thank you for the question. We can answer only one question at a go! So please re-post us…

Q: Which answer best describes the redistribution of matter or energy when melting takes place? more…

A: The question can be answered by considering one of the important thermodynamic concept such as…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 77.15 gimol and…

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 77.78 g/mol and…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Write a balanced equation for the complete combustion of table sugar (sucrose, C12 H22O11). Use…

Q: 1. Write the chemical equation for the reaction of washing soda, Na2CO3, with HCl. 2. Write the…

A: A chemical equation refers to the symbolic representation of a given chemical reaction in the form…

Q: help

A: Moon phases or Lunar phases changes over a period of time in approximately one month. The shape of…

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: 3. A.) Aldrich chemical company reports the melting point of a substance to be 82.0 "C. When you…

A: Melting point is the temperature at which solid form of the liquid starts converting into the liquid…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 68.21 g/mol and…

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: 1. a man who is 5ft 10in. talll weighs 160lb. What is his heightbin centimeter and his mass in…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: Ca(s)+Br2(l)⟶CaBr2(s) Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: M Gmail O german class book Grossmont Health... Medical Assistant e My Evolve - Evolve A soc 130 E…

Q: Write balanced net ionic equation for Na3PO4 (aq) + CaCl2 (aq) → Ca3(PO4)2(s) + NaCl(aq Express your…

Q: C3H6(g)+O2(g)→CO2(g)+H2O(g)C3H6(g)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: A combustion reaction is a reaction in which a substance reacts with oxygen to give carbon dioxide…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

Question

CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq)CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq)

Express your answer as a chemical equation. Identify all of the phases in your answer.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A representation of liquid water is shown below. Which of the three representations that follow best describes the water after it has boiled into steam?
HNO3(aq)+Mg(OH)2(s)→HNO3(aq)+Mg(OH)2(s)→ Express your answer as a chemical equation. Identify all of the phases in your answer.
Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation for cellular respiration. C6H12O6(aq)+ O2(g)= CO2(g) +H2O(I) express your answer as a chemical equation. Identify all of the phases in your
H3PO4 (aq) + NaOH(aq) → Express your answer as a chemical equation. Identify all of the phases in your answer.
Cu₂O(s) + O2(g) → CuO(s) Express your answer as a chemical equation. Identify all of the phases in your answer.
Fe(s)+S(l)→Fe2S3(s)Fe(s)+S(l)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Balance each chemical equation.
a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer. b)For C5H5NH+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer.
K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s)K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Keep the order of compounds as in the original equation.
A stopper is removed from a partially filled bottle containing liquid acetic acid. A vinegar-like odor is detected. How many phases are present in the bottle? a) 0 b) 1 c) 2 d) 3
N2H4(l)→NH3(g)+N2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. (Please type answer no wright by hend)
Write the net ionic equation for 3HNO3(aq)+Al(OH)3(S) = Al(NO3)3(aq)+3H2O(l) Express your answer as a balanced net ionic equation. Identify all of the phases in your answer.
Mercury ions (Hg2 2+) can be removed from solution by precipitation with Cl-. Suppose that a solution contains aqueous Hg2(NO3)2. Enter a complete ionic equation to show the reaction of aqueous Hg2(NO3)2 with aqueous sodium chloride to form solid Hg2Cl2 and aqueous sodium nitrate. (Express answer as a complete ionic equation. Identify all of the phases in the answer)