QUESTION 142+Calculate E (cell) for the reaction, 2 I03 (aq) + 10 Fe (aq) <-> 10 Fe"(aq) + 12(aq) given the reduction potentials:2+Fe*(aq) + e <=> Fe<*(aq) . E° = 0.87 V2 103 (aq) + 10 e <=> I2(aq), E = 1.10 VA. -7.60 VO B. -1.97 VC. 0.23 VOD. -0.23 VE. 1.97 V

In the given half-cell reaction, IO3- is a oxidizing agent and Fe2+ is a reducing agent, hence IO3-…

Calculate E (cell) for the reaction, 2 103 (aq) + 10 Fe2*(aq) <=> 10 Fe3 (aq) + 12(aq) given the reduction potentials: Fe3+(aq) + e <=> Fe2*(aq), E° = 0.87 V 2 103 (aq) + 10 e <=> 12(aq), E° = 1.10 V A. -7.60 V O B. -1.97 V O C. 0.23 V D. -0.23 V E. 1.97 V

Calculate E (cell) for the reaction, 2 103 (aq) + 10 Fe2(aq) <=> 10 Fe3 (aq) + 12(aq) given the reduction potentials: Fe3+(aq) + e <=> Fe2(aq), E° = 0.87 V 2 103 (aq) + 10 e <=> 12(aq), E° = 1.10 V A. -7.60 V O B. -1.97 V O C. 0.23 V D. -0.23 V E. 1.97 V

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 24Q: What is wrong with the following statement: The best concentration cell will consist of the...

See similar textbooks

Related questions

Q: Consider the following electrochemical cell in, for which E - 0.18 V at 80°C: cell Pt | H2(g) |…

A: We have to predict the partial pressure of hydrogen gas necessary.

Q: Given the standard reduction potentials for an element A, at 25 °C: А2"(аg) + е > A (ag) E1° = 1.09…

A: Standard cell potential is an intensive property which does not depend on amount or mass of the…

Q: An aqueous FeF₂ solution is electrolyzed under 1 bar pressure using platinum electrodes. (a) Write…

A: Disclaimer Since we do not provide the handwritten solutions but we are sending a complete solution…

Q: Calculate the equilibrium constant for the following reaction carried out in 1 M perchloric acid:…

Q: Consider the following electrochemical cell: B2+(aq) + A(s) → A2+(aq) + B(s) The species B has…

Q: Which of the following descriptions is true for the cell below? Cu (s) | Cu²+ (o.1 M) || Fe3+ (o.5…

Q: A galvanic cell is constructed that has a zinc anode immersed in a Zn(NO3)2 solution and a platinum…

A: Hello. Since the question contains multiple subparts the first three subparts are solved. In case…

Q: Calculate the cell potential for the reaction as written at 25.00 °C25.00 °C, given that…

A: Given-> [Cr2+] = 0.790 M [Fe2+] = 0.0190 M T = 25°C

Q: A galvanic cell is constructed as follows. One half cell consists of a platinum wire immersed in a…

A: The two half-cell reactions and overall reaction are as follows:

Q: What are the products at the cathode and anode when an aqueous solution of KI is electrolyzed…

Q: An electrolytic cell consists of a pair of inert metallic electrodes in a solution buffered to pH =…

A: Part a: The electrolytic cell consists of two electrodes, anode and cathode. Oxidation occurs at…

Q: a current of 5.79 A is passed over 500 seconds in 300 ml of aqueous solution of copper sulphate…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: 2. Consider a concentration cell which used the following half-reaction at 273 K. Co2*(aq) + 2e- →…

A: According to bartleby answering guidelines I can provide solutions of 1st three subparts of question…

Q: а. Write the balanced electrochemical reaction. Use the reduction potentials to determine E°: i.…

A: An electrolytic cell is a cell which requires an outside electrical source to initiate the redox…

Q: Calculate the cell potential for the galvanic cell in which the reaction Ti(s)+Co2+(aq)↽−−⇀…

Q: A galvanic cell consist of a metallic zinc plate immersed in 0.1 M Zn(NO3)2 solution and metallic…

Q: How long would it take to deposit 9.38 g of copper (molar mass 63.55 g/mol) at the cathode of an…

A: Faraday's law states that the amount of chemical change that is produced by passing a current to an…

Q: When an aqueous solution of potassium iodide is electrolyzed using platinum electrodes, the…

A: 8.15mA current flows which is equal to 0.00815A time is 12.6min = 756s The molar mass of I2 =…

Q: Purification of nickel can be achieved by electrorefining nickel from an impure nickel anode onto a…

A: This is a problem of electrochemistry.It is basically a study of the chemical processes that cause…

Q: Calculate the cell potential, ε for this galvanic cell and ΔG for the cell reaction these…

A: The cell reaction is Overall reaction is given by,

Q: The corrosion of iron is an electrochemical process that involves the standard reduction potentials…

A: given data are- Fe(s) ⟶ Fe2+(aq) + 2e-Eo = -0.44 V O2(g) + 4H+(aq) + 4e- ⟶ 2H2O(l) Eo = 1.23 V…

Q: 5. The following galvanic cell has a potential (E) of 0.98 V at 298 K. Zn(s) | ZnX,2* (0.010 M), X…

A: Given the potential of the cell, E = 0.98 V T = 298 K Here Zn(s) is oxidized to ZnX42+(aq) at the…

Q: Pt|H; (1.6 atm)|H (0.80 M) || C,Hs O2 (0.20 M), AgC,HO2 (s)|Ag The cathode is essentially a silver…

A: The standard reduction potentials of half- cell reactions are, The most positive standard reduction…

Q: Consider the following galvanic cell at 25°C Pt|Br (aq) (0.25 M), H* (aq) (0.1 M) |Br2 () || O2 (g)…

Q: Chlorine dioxide (ClO2), which is produced by the reaction below, has been tested as a disinfectant…

A: The standard potential of an electrochemical process is evaluated by Nernst equation. The…

Q: Calculate the cell potential for the galvanic cell in which the reaction Al(s) + Au+(aq) = Al³*(aq)…

A: In this question firs determine standard cell potential then apply Nerst equation.

Q: (a) How many minutes does it take to form 10.0 L of O₂ measured at 99.8 kPa and 28°C from water if a…

A: Given- the volume of Oxygen(V) = 10 L = 0.01 m3 (Since 1 m3 = 1000 L) Temeperature(T)= 28 C…

Q: Like any piece of apparatus, an electrolytic cell operates at less than 100% efficiency. A cell…

Q: A student constructs an electrochemical cell with a half-cell composed of a nickel anode in a 0.10 M…

A: Given that : A student constructs an electrochemical cell with a half-cell composed of a nickel…

Q: Consider the following electrochemical cell reaction: Pb2+(aq) + 2 Cr2+(aq) → Pb(s) + 2…

A: We will calculate cell potential using nernst equation.

Q: What are the products at the cathode and anode when an aqueous solution of KI is electrolyzed…

Q: Enter your answer in the provided box. Consider the following electrochemical cell in, for which E"…

Q: A voltaic cell utilizes the following reaction and operates at 298 K. 3 Ce4+(aq) + Cr(s) 3…

Q: 2. Tin-plated steel is used for tin cans. If the production of sheets of tin-plated steel requires…

A: Formulas used : I = q/t where I is the current in amperes q is the…

Q: A galvanic cell is constructed that carries out the reaction 2 Ag(s) + Cl, (g) 2 Ag* (aq) + 2 CI…

Q: During electrorefining of Cu from CUSO4, how much time (in hours) is needed to produce 250 g Cu on…

A: When a charge Q passes through a circuit the current through that circuit can be calculated by the…

Q: Consider the following reaction and its AG" at 25.00 °C. Mg(s) + Ni" (aq) – Mg²* (aq) + Ni(s) AG =…

Q: An electrical engineer is analyzing an electroplating run and wants to calculate the charge that has…

Q: Given the cell notation Pt /Cl2(g)/Cl¯(aq) // Zn+2(aq)/Zn. How long, in seconds, will it take for…

A: Given-> Weight of Zn =1.000 gm Atomic mass of Zn = 65.38 gm Current (i) = 2.000 ampere

Q: (a) Write the half-reactions at the zinc-air electrodes and calculate the standard emf of the…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Copper metal (63.546 g/mol) is purified by electrolysis. How much copper metal (in grams) could be…

Q: Electroplating is rarely 100% efficient-some of the current usually is consumed by reactions other…

A: Amount of current passed = 6A Time for the flow of current = 15 minutes =15×60 s = 900 s Mass of…

Q: Chlorine dioxide (CIO,), which is produced by the reaction below, has been tested as a disinfectant…

Q: A galvanic cell is constructed as follows. One half-cell consists of a platinum wire immersed in a…

A: Given that, One half-cell is: Ti+ + e- → Ti, E0Ti+/Ti = -0.34 V. And another half-cell is: Sn4+ +…

Q: Given the following half-reactions and their standard reduction potentials, 2CIO;- + 12H* + 10e Cl,+…

A: E0ClO32- =1.47 V E0S2O82- = 2.01 V E0 cell = E0S2O82- -E0ClO32- = 2.01 - 1.47 = 0.54 V

Q: How long would it take to deposit 9.38 g of copper (molar mass 63.55 g/mol) at the cathode of an…

A: Given, m = 9.38g I= 23.2A

Q: A voltaic cell utilizes the following reaction and operates at 298 K. 3 Ce4+(aq) + Cr(s) 3…

A: The expression of Nernst equation is shown below: Ecell = E0cell - 0.0591nlog Q Where; Ecell= cell…

Q: Question 2 on the photo

A: To calculate concentration of Ag+ at anode: The reaction occur at cathode, The reaction occur at…

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
In the electrolysis of a solution containing Ag+(aq), metallic Ag(s) deposits on the cathode. Using a current of 1.12 A for 2.40 hours, what mass of silver forms?