(CH,(CH,),CH;) Liquid hexane will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,). and gaseous water (H,O). Suppose 6.03 g of hexane is mixed with 40. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 3 significant digits.

(CH,(CH,),CH;) Liquid hexane will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,). and gaseous water (H,O). Suppose 6.03 g of hexane is mixed with 40. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 3 significant digits.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 114E: a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and...

See similar textbooks

Similar questions

Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
4.32 Hydrogen and oxygen are reacted and the water formed is collected at 25°C, where it has a density of 0.997 g/mL. If 36.8 g of H2 and 168 g of O2 are reacted, how many mL of water will be collected?
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
When small quantities of elemental hydrogen gas are needed for laboratory work, the hydrogen is often generated by chemical reaction of a metal with acid. For example, tine reacts with hydrochloric acid, releasing gaseous elemental hydrogen: :math>Zn(s)+2HCI(aq)ZnCl2(aq)+H2(g) at mass of hydrogen gas is produced when 2.50 g of zinc is reacted with excess aqueous hydrochloride acid?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
3.68 Magnesium is lighter than other structural metals, so it is increasingly important in the design of more efficient vehicles. Mg2+ ions are present in seawater, and the metal is often prepared by "harvesting" these ions and converting them to Mg metal. The average magnesium content of the oceans is about 1270 g Mg2+ per ton of seawater, and the density of seawater is about 1.03 g/mL. What is the molarity of Mg2+ ions in seawater? The design for a concept car calls for 103 kg of magnesium per vehicle. How many gallons of seawater would be required to supply enough magnesium to build one of these ears?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.