THE QUESTIONConsider electrode potential data given in Question 4 (c). Predict whichtwo electrodes combination will give maximum potential. Providejustification.THE DATA GIVEN IN QUESTION 4 IS HERE(c) Arrange the following electrodes in ascending order of reducing capacity.And provide suitable explanation.Zn2* (aq) + 2eZn(s): E° = -0.76 V%3DAg*(aq) + e –→Ag(s): E° = 0.8 VCa2+ (aq) + 2eCa(s): E° = -2.87 VCu2* (aq) + 2e→ Cu(s): E° = 0.34 V

Standard EMF of an electrochemical cell is given by the equation: Eocell = Eocathode - Eoanode…

Answered: Consider electrode potential data given…

Consider electrode potential data given in Question 4 (c). Predict which two electrodes combination will give maximum potential. Provide justification.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Related questions

Q: The chemistry of corrosion of iron is essentially an electrochemical phenomenon. Explain the…

Q: what is Faraday's first law of electrolysis ?

A: Electrolysis is the technique that involves the use of direct current for driving the chemical…

Q: If the given statement is true, write T. Otherwise, write F and explain why it is false. 1) The…

A: Given the statement: The electrons in a galvanic cell can be transferred through a wire, making it…

Q: 1. When you change the position of the electrode the potential differences give an opposite but the…

A: A question based on electrochemical cell that is to be accomplished.

Q: The table below gives the standard electrode potential values of some electrode. What standard…

A: The potential of all electrodes are measured by comparing their potential to that of standard…

Q: A galvanic (voltaic) cell consists of an electrode composed of chromium in 1.0 M chromium (III) ion…

Q: Perchlorate is a serious problem in drinking water as it interfere with the functioning of thyroid…

A: Given information: Concentration of NaClO4 = 1.0*10-4 M Cell potential = -0.146 V After transferring…

Q: state and explain Faraday’s laws of electrolysis. What is Electrochemicalequivalent?

A: Faraday’s first law of electrolysis states that the mass of the substance accumulated or released at…

Q: What is the calculated value of the cell potential at 2

Q: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

A: Inert metal electrodes are electrodes of inert metal, which doesn't take part in the electrochemical…

Q: What unit is used to measure the magnitude of electrical current? What unit is used to measure the…

A: The unit used to measure the magnitude of electrical current is Amperes.The unit used to measure the…

Q: the terms cell potential and electromotive force mean the same thing in electrochemical cells?

Q: Use information from Table 17.1 (pp. 907-909 of your textbook) to answer this question. What is the…

A: In the given cell we can see that the oxidation of Al is taking place and reduction of Cr3+ Hence…

Q: We will be using the following metals as electrodes for our Batteries: Mg, Al, Cu, Zn Based on their…

A: Given 1) Order of atomic size 2) order of electronegativity Mg , Al , Cu , Zn

Q: Which of the following factors does not affect the electrode potential of an electrode? Size of the…

A: Temperature ,metal and molarity of solution affect the electrode potential .

Q: Why is zero potential possible in electrolysis but not in galvanic cell?

A: In an electrolytic cell, the external electric source is applied for the chemical reaction to occur.…

Q: Sketch the cell, labeling the anode and cathode and indicating the corresponding electrode…

A: In the voltaic cell, the electrical energy is produced by the redox reactions that occur…

Q: A galvanic (voltaic) cell consists of an electrode composed of chromium in a 1.0 Mchromium(III) ion…

A: Here we are required to find the standard cell potential of the given electrochemical reaction

Q: A student was asked to set-up a galvanic cell in the laboratory. He used two copper electrodes, one…

Q: What is a cell diagram? Write the cell diagram for a galvanic cell consisting of an Al electrode…

A: For cell diagram representation, there is the need of cathode , anode and salt bridge.

Q: The electrode potential is an intensive property such that when the coefficients of the species in…

A: Given: The electrode potential is an intensive property. And the coefficients of the species in the…

Q: Calculate the standard cell potential for each of the following electrochemical cells. Standard…

Q: What is the significance of using inert material electrodes?

A: Write the significance of using inert material electrodes.

Q: A constant current of 90 mA is passed for 22 minutes into an electrolysis cell. How much electrical…

A: Charge passing per unit time is known as electric current.

Q: Describe how to predict the spontaneity of redox reactions, based on overall cell potential as…

A: A question to describe about determining spontaneity, which is to be accomplished.

Q: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

A: Electrodes :- Electrodes are the good conductor of electricity and these are mainly two type…

Q: A concentration cell similar to the one shown is composed of two Mg electrodes and solutions of…

A: A electrochemical cell is used is used convert chemical energy to electrical energy it involves a…

Q: Write cell schematics for the following cell reactions, using platinum as an inert electrode as…

A: This question is from chapter Electrochemistry where we are given redox reactions and we have to…

Q: A battery can provide a current of 2.20 A at 1.40 V for 10.0 hr. How much energy (in kJ) is…

A: GIVEN: Current = 2.20 A Voltage = 1.40 V Time= 10.0 hr To CALCULATE: Energy (kJ)

Q: An aqueous solution contains a mixture of cations at the following concentrations.…

A: An aqueous solution containing a mixture of three cations, for which the order of reduction is to be…

Q: What does a large positive standard cell potential imply about the spontaneity of the redox reaction…

A: The potential of an electrode to get reduced at standard conditions of temperature and…

Q: what is Faraday's second law of electrolysis ?

A: Electrolysis:Separation of a liquid into its chemical parts by passing direct electric current…

Q: What is the voltage of a galvanic cell that does 788 J of work when 255 Coulomb of charge is…

Q: Which of the following cell reactions would require the use of an inert electrode?

A: We have to tell which option is correct

Q: Using the Standard Reduction Potential Table, use half-reaction potentials to identify whether the…

Q: Which electrode functions as the cathode?

A: Electrode having less value of standard reduction potential ( standard electrode potential)…

Q: make a clear distintion between an electrolytic cell and a galvanic cell,providing a schematical…

A: In the above question we have to differentiate between a galvanic cell and electrolytic cell,

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M iron(II) ion solution…

A: Answer: the standard potential for this cell at 25°C is 1.96 V.

Q: a) A proposed battery involves the reaction of Zn(s) and Cl2(g) to give ZnCl2. If you want such a…

A: Hii there, since there are multiple questions posted. We are answering first question. If you need…

Q: Explain how a salt bridge can maintain electrical neutrality within the internal circuit of the…

A: Salt bridge is inverted U shaped glass tube filled with strong electrolyte (like NH4NO3) dissolved…

Q: What do you mean by ( i) negative standard electrode potential and(ii) positive standard electrode…

A: Standard electrode potential is defined as the potential of the electrode at the standard conditions…

Q: Draw a galvanic cell consisting of a chromium and cobalt electrode and calculate the standard cell…

Q: For the electrolysis of an aqueous solution of SnSO, with aluminum electrodes at standard state co…

A: Given data: Redox reaction with SnSO4 with aluminium electrode. Net redox reaction: ? voltage…

Q: Using the provided standard reduction potentials, which of the following cells is an example of a…

A: One with smaller or negative value will be anode and one with positive will be cathode .

Q: In an electroplating operation, the cell potential is sometimes 0 V. Why is zero potential possible…

A: In this question we need to illustrate the fact that cell potential for an electroplating cell can…

Q: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

A: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

Q: (c) For the electrochemical cell: Cd (s) / Cd Cl2 (aq, 0.0538 M) // Ag NO, (aq, 0.0320M) / Ag (s) i)…

Q: Mention the reactions occurring at (i) anode, (ii) cathode, during working of a mercury cell. Why…

A: A voltaic cell is an example of electrochemical cell. It uses a chemical reaction to produce…

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
A solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?