Consider the equilibrium system described by the chemical reaction below, whichhas a value of Kp equal to 60.6 at a certain temperature. If an initial mixture of0.20 atm of every species is allowed to react, what will the equilibrium partialpressure of NO be?.2 NOBr(g) =2 NO(g) + Br2(g)123NEXTSet up the expression for Qp and then evaluate it to determine the direction of the reaction. Donot combine or simplify terms.5 RESET(0)(0.20)(0.40)(0.20)?(0.40)?(x)(x)?(2x)(2x)?0.200.400.0400.020II Question 9 of 50Consider the equilibrium system described by the chemical reaction below, whichhas a value of Kp equal to 60.6 at a certain temperature. If an initial mixture of0.20 atm of every species is allowed to react, what will the equilibrium partialpressure of NO be?.2 NOBr(g) = 2 NO(g) + Br2(g)PREV1NEXT>Based on the given values and your value for Qp, set up ICE table in order to determine theunknown.2 NOBr(g)2 NO(g)Br (g)+Initial (atm)Change (atm)Equilibrium (atm)5 RESET0.200.40-X+x-2x+2x0.20 - x0.20 + x0.20 - 2x0.20 + 2x0.40 - x0.40 + x0.40 - 2x0.40 + 2x1L

This question is from chapter Chemical Equilibrium. We are given a chemical reaction whose Kp is…

Consider the equilibrium system described by the chemical reaction below, which has a value of Kp equal to 60.6 at a certain temperature. If an initial mixture of 0.20 atm of every species is allowed to react, what will the equilibrium partial pressure of NO be?. 2 NOBr(g) = 2 NO(g) + Br2(g)

Consider the equilibrium system described by the chemical reaction below, which has a value of Kp equal to 60.6 at a certain temperature. If an initial mixture of 0.20 atm of every species is allowed to react, what will the equilibrium partial pressure of NO be?. 2 NOBr(g) = 2 NO(g) + Br2(g)

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 78E: Consider the following reaction at 298 K: 2SO2(g)+O2(g)2SO3(g) An equilibrium mixture contains O2(g)...

See similar textbooks

Related questions

Q: Consider the following reaction at equilibrium. What effect will reducing the volume have on the sys...

A: Given reaction: C3H8 (g) + 5O2 (g) ↔ 3CO2 (g) + 4H2O (l) We have to find the effect of reducing the ...

Q: Predict the order of increasing boiling point for the compounds below based on your knowledge of int...

A: Boiling point is directly proportional to inter or intramolecular force . Highest Boling point of Li...

Q: Deconstruct the given Diels–Alder adduct. Draw the reactants, in any order, that would be needed to ...

Q: Describe the preparation of the following reagents: 1. 300 mL of a solution that is 0.0376 N MgI2 fr...

Q: .coH coM What kind of reaction is occurring?

A: Radical reactions that involes the symmetrical bond clevages and bond formation reaction. In this re...

Q: 4 Al (S) + 302(g) 2AI2O3(s) How many grams of Al203 can be formed from 81.34 g of Al and 22.49 g of ...

A: Given :- 4Al(s) + 3O2(g) → 2Al2O3 mass of Al = 81.34 g mass of O2 = 22.49 g To calculate :- mas...

Q: Lewis Structure

Q: e molarity of t

Q: If 25 grams of methane, CH 4, and 30 g of ammonia, NH 3, are combined w/ excess oxygen, how much met...

A: This question uses the concept of limiting reactant. We will calculate the amount of each reactant f...

Q: NiCl2 + 6 NH3 + 2 KClO4 ® Ni(NH3)6(ClO4)2 + 2 KCl if you mix 1.0406 g of NiCl2, 6.0092 g NH3 and 2.0...

A: The given chemical equation is: NiCl2 + 6 NH3 + 2 KClO4 → Ni(NH3)6(ClO4)2 + 2 KCl Given mass of NiCl...

Q: xample 8 Calculate the corrosion rate in mpy of Al specimen (5 cm?) immersion in aqueou days, given ...

A: Area = 5 cm2 Time = 2 days 1 day = 24 hour 2 days = 48 hour

Q: Draw the expanded structural formula of an organic compound with sixteen carbons using the following...

A: A question based on nomenclature that is to be accomplished.

Q: ne molality of the

A: Since you have asked multiple questions, we will solve the first question for you. If you want any s...

Q: What is the pOH of a 5.6 x 10-4 M solution of CsOH?

Q: In the preparation of a standard stock solution for protein analysis, 50 mg of bovine serum albumin ...

A: Mass of BSA in 10mL solution = 50mg

Q: e mole fraction of C2H

Q: e mass in kC

Q: 18. Provide the major product or products in the boxes below. Be clear about the stereo- and regioch...

A: Let us solve them one by one.

Q: 11. The net reaction for formation of HI from H2 and I2 is H, +I, 2 2HI The following mechanism was ...

Q: This method is to be used when measuring the volume of a solution containing sufficient reagent to r...

A: In volumetric method, to determine the concentration of analyte it is reacted with a suitable reage...

Q: Starting with the following equation, P,(s) + F,(g) → PF,(9) calculate the moles of F, that will be ...

Q: Balance the given molecular equation using redox (electron-transfer method). Identify the element ox...

Q: the formation of or row is used to rep

Q: Compute for the volume (in mL) of 2 M acetic acid and mass (in g) of sodium acetate needed to prepar...

A: Let us suppose we prepare 100 ml of acetate buffer with concentration 10mM. Hence moles of acetate p...

Q: Indicate whether or not each of the structures is considered to be aromatic. NH A Which is true? A i...

A: We have to find whether these compounds are aromatic or not.

Q: Consider the equilibrium system described by the chemical reaction below. A 2.00 L reaction vessel w...

A: Equilibrium is a condition in which both the reactants and products are present in equal concentrati...

Q: Questions: 1) Explain the molecular basis of the reaction of bromine water with phenol. 2) What is/a...

A: These given reactions are the preliminary tests of functional group’s detection in organic chemistry...

Q: Describe main features of the evidence of M-CºC characterization and corresponding techniques of thi...

A: answer :

Q: 1. How many MOLES of dinitrogen monoxide are present in 1.90 grams of this compound ? moles. 2. How ...

A: Mole concept: The number of molecules or atoms present in the one mole of the substance is equal to ...

Q: What is An for the following equation in relating Ko to Kp ? C3H3 (9) + 502(g) = 3CO2 (g) + 4H2O() 3...

Q: „coH COH

A: ANSWER > This is a radical reaction .In radical reaction the weaker the C-H bond, more readily th...

Q: Explain why any or all of the following solvent pairs cannot be used for mixed-solvent recrystalliza...

A: This type of crystallization is one of the methods for obtaining high quality, pure, single crystals...

Q: What is the difference between an orbit (such as in the Bohr model) and electron orbital?

A: Orbit is the Path for elcetrons to revolve around the nucleus. While electron orbital is the 3-D mot...

Q: F. `N' `N' HN, Amoxicillin NH2 H H CH3 CH3 HO CO2H Identify the functional groups present in each dr...

Q: which aqueous solution will have the lowest freezing point

A: Ionic aqueous electrolyte solutions have the lowest freezing point. The freezing point is a colligat...

Q: 5. Explain the trend in binding constants (in CH,Cl2) for the complexation of phenol derivatives by ...

A: Solution -

Q: Determine the molar mass of an unknown nonvolatile solute of nonelectrolyte compound raising the boi...

Q: Determine the heat of reaction ( in k) for the following reaction. Mg(s) + 2HCI(aq)- MgCl2(aq) + H2l...

A: We have to find heat of reaction.

Q: 31. How many percentage of the radical cation peak of (M +1) will be observed approximately when the...

A: The relative natural abundance of M+1 that is 13C is 1.1% required the relative natural abundance of...

Q: Draw the expanded structural formula of an organic compound with sixteen carbons using the following...

Q: Classify HClO4 strong acid weak acid strong base weak base

Q: Calculate the approximate boiling point (in °C) of a solution of 285 g of magnesium chloride in 2.0 ...

A: Given, Mass of magnesium chloride (MgCl2) = 285 g Mass of water solvent = 2.0 Kg Boiling point eleva...

Q: Identify the molecular orbital indicated by the arrow. Answer in this format: sigma sp3-sp3 In case ...

Q: How many grams of Mg are there in a sample of Mg that contains 6.21x1023 atoms? grams

A: The amount of Mg present can be calculated as

Q: Write the ionization constant expression for a 50 mM aniline solution (pKb=9.40 @ 25 C).

Q: Decomposition reactions like carbonate decomposition is a common organic chemistry reaction. True Fa...

A: Orgaanic compounds can be defined as the compounds containing carbon bonded with hydrogen.These are ...

Q: Supposing compound A is 2-methylbutane-2,3-diol and compound B is n-pentane. Compound A is more solu...

A: Water is a polar solvent and it can dissolve an ionic or polar covalent compound. The solubility of ...

Q: Specify if the following molecules/ions are polar or nonpolar. Justify your reasoning. Molecule Pola...

Q: "Vhich of the following compounds will have the highest dens A 2-aminopropane B 2-methylbutane Obuta...

A: Density = Mass /Volume

Q: For each addition route of the reaction, draw the structure(s) of the major product(s), including st...

A: Answer of the question given below,

Question

Consider the equilibrium system described by the chemical reaction below, which
has a value of Kp equal to 60.6 at a certain temperature. If an initial mixture of
0.20 atm of every species is allowed to react, what will the equilibrium partial
pressure of NO be?.
2 NOBr(g) =2 NO(g) + Br2(g)
1
2
3
NEXT
Set up the expression for Qp and then evaluate it to determine the direction of the reaction. Do
not combine or simplify terms.
5 RESET
(0)
(0.20)
(0.40)
(0.20)?
(0.40)?
(x)
(x)?
(2x)
(2x)?
0.20
0.40
0.040
0.020
II

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Hf for iodine gas is 62.4 kJ/mol, and S° is 260.7 J/mol K. Calculate the equilibrium partial pressures of I2(g), H2(g), and HI(g) for the system 2HI(g)H2(g)+I2(g) at 500°C if the initial partial pressures are all 0.200 atm.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 1000C for the reaction C(graphite)+CO2(g)2CO(g) Carbon monoxide is known to form during combustion of carbon at high temperatures. Do the data agree with this? Explain.
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 2000C for the reaction N2(g)+O2(g)2NO(g) Nitric oxide is known to form in hot flames in air, which is a mixture of N2 and O2. It is present in auto exhaust from this reaction. Are the data in agreement with this result? Explain.
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Hydrogen gas and iodine gas react to form hydrogen iodide. If 0.500 mol H2 and 1.00 mol I2 are placed in a closed 10.0-L vessel, what is the mole fraction of HI in the mixture when equilibrium is reached at 205C? Use data from Appendix C and any reasonable approximations to obtain K.
Calculate K for the formation of methyl alcohol at 100C: CO(g)+2H2(g)CH3OH(g) given that at equilibrium, the partial pressures of the gases are PCO=0.814 atm, PH2=0.274 atm, and PCH3OH=0.0512 atm.
Given the following data at 25C 2NO(g)N2(g)+O2(g)K=1 10 30 2NO(g)+Br2(g)2NOBr(g)K=8 101 Calculate K for the formation of one mole of NOBr from its elements in the gaseous state.
Sulfur oxychloride, SO2Cl2, decomposes to sulfur dioxide and chlorine gases. SO2Cl2(g)SO2(g)+Cl2(g) At a certain temperature, the equilibrium partial pressures of SO2, Cl2, and SO2Cl2 are 1.88 atm, 0.84 atm, and 0.27 atm, respectively. (a) What is K at that temperature? (b) Enough Cl2 condenses to reduce its partial pressure to 0.68 atm. What are the partial pressures of all gases when equilibrium is reestablished?
Consider the reaction 2HI(g)H2(g)+I2(g)At 500C a flask initially has all three gases, each at a partial pressure of 0.200 atm. When equilibrium is established, the partial pressure of HI is determined to be 0.48 atm. What is G for the reaction at 500C?
Consider the formation of HI(g) from H2(g) and I2(g). H2(g)+I2(g)2HI(g) For this reaction, K at 333C is 98, while K at 527C is 62.5. Find S for I2(g) at 527C.