Consider the following system at equilibrium at 25°C. PCI3(9) + Cl,(9) = PCI_(9) AG° = –92.50 k) What will happen to the ratio of partial pressure of PCI, to partial pressure of PCI, if the temperature is raised? decrease increase no change Explain completely. (Select all that apply.) O The reaction is exothermic. The equilibrium will shift to the left when the temperature is raised. The reaction is endothermic. The equilibrium will shift to the right when the temperature is raised. AS is negative. Not enough information to determine if the reaction is endothermic or exothermic. Not enough information to determine the sign of AH. O AH is negative. Not enough information to determine the sign of AS. AS is positive. AH is positive.

Consider the following system at equilibrium at 25°C. PCI3(9) + Cl,(9) = PCI_(9) AG° = –92.50 k) What will happen to the ratio of partial pressure of PCI, to partial pressure of PCI, if the temperature is raised? decrease increase no change Explain completely. (Select all that apply.) O The reaction is exothermic. The equilibrium will shift to the left when the temperature is raised. The reaction is endothermic. The equilibrium will shift to the right when the temperature is raised. AS is negative. Not enough information to determine if the reaction is endothermic or exothermic. Not enough information to determine the sign of AH. O AH is negative. Not enough information to determine the sign of AS. AS is positive. AH is positive.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 3RQ

See similar textbooks

Similar questions

5.22. True or false: If for a gas-phase reaction, then all equilibrium partial pressures of reactants and products must equal . Explain your choice.
Consider the decomposition of CaCO3(s) into CaO(s) and Co2(g). What is the equilibrium partial pressure of CO2 at room temperature?
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
Consider the equilibrium H2(g)+S(s)H2S(g)When this system is at equilibrium at 25C in a 2.00-L container, 0.120 mol of H2, 0.034 mol of H2S, and 0.4000 mol of S are present. When the temperature is increased to 35C, the partial pressure of H2 increases to 1.56 atm. (a) What is K for the reaction at 25C? (b) What is K for the reaction at 35C?
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
For the system 2SO3(g)2SO2(g)+O2(g) K=1.32 at 627. What is the equilibrium constant at 555C?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?
Isopropyl alcohol is the main ingredient in rubbing alcohol. It can decompose into acetone (the main ingredient in nail polish remover) and hydrogen gas according to the following reaction: C3H7OH(g)C2H6CO(g)+H2(g)At 180C, the equilibrium constant for the decomposition is 0.45. If 20.0 mL (d=0.785g/mL) of isopropyl alcohol is placed in a 5.00-L vessel and heated to 180C, what percent- age remains undissociated at equilibrium?