Consider the reaction: C,H4(g) + H,0(g)→CH3CH,OH(g) Using standard absolute entropies at 298K, calculate the entropy change for the system when 1.71 moles of C2H¼(g) react at standard conditions. AS° system J/K

Consider the reaction: C,H4(g) + H,0(g)→CH3CH,OH(g) Using standard absolute entropies at 298K, calculate the entropy change for the system when 1.71 moles of C2H¼(g) react at standard conditions. AS° system J/K

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.70QE: What is the sign of the standard Gibbs free-energy change at low temperatures and at high...

See similar textbooks

Related questions

Q: Consider the reaction 2NH3(g) + 2O2(g)N2O(g) + 3H2O(l) Using standard thermodynamic data at 298K,…

Q: A reaction has ΔH∘rxn= -134 kJ and ΔS∘rxn= 320 J/K. At what temperature is the change in entropy…

A: Given: -ΔH°rxn = -134 KJΔS°rxn = 320 J/KIf everything is carried out at a constant temperature and…

Q: Consider the reaction: C(s,graphite) + O2(g) (6)*00 Using standard absolute entropies at 298K,…

Q: Using standard absolute entropies at 298K, calculate the entropy change for the system when 2.29…

A: We have to find S°system when 2.29 moles of NO(g) react at standard conditions.

Q: Calculate the entropy change for the vaporization of one mole of ethanol, CH3CH₂OH, at its normal…

Q: What is the total entropy change at 25°C for the reaction below, if the standard entropies of…

A: Given :- The given reaction is 5C(gr) + 5H2(g) → C5H10(g) ...........(A) Sº (C(gr)) = 5.74…

Q: What is ΔS for the boiling of C2H5OH? Use the data given below. Assume that enthalpy and entropy…

A: A molecule or an atom is in constant motion at normal temperature, the motion also includes…

Q: Consider the reaction: C2H4(g) + H2O(g)----------CH3CH2OH(g) Using standard absolute entropies at…

A: The given reaction is C2H4(g)+H2O(g)→CH3CH2OH(g) we know entropy change for any system =∑Entropy of…

Q: Consider the reaction: H2(g) + C2H4(g)---> C2H6(g) Using standard absolute entropies at…

A: Entropy is defined as the property which measures the randomness of the system. It is generally…

Q: In the first stage of the industrial production of nitric acid, ammonia reacts at high temperature…

Q: Consider the reactionCO(g) + 3H2(g)CH4(g) + H2O(g)Using standard thermodynamic data at 298K,…

A: The given reaction may be written as: The standard thermodynamic data for the given reactants is:

Q: Consider the reaction2H2S(g) + 3O2(g)2H2O(l) + 2SO2(g)Using standard thermodynamic data at 298K,…

A: The entropy measures disorderness of reactants-products' molecules in closed systems. On reaction…

Q: 2A. ( i) Carbon dioxide sublimes ii) Hydroiodic acid and Sodium Hydroxide are neutralized iii) Neon…

A: If the randomness of the system increases then the entropy of the system will increase while if the…

Q: Consider the reaction: N₂(g) +202 (g) → 2NO₂(g) Using standard absolute entropies at 298 K,…

Q: What is the total entropy change at 25oC for the reaction below, if the standard entropies of…

Q: Consider the reactionN2(g) + 3H2(g)2NH3(g)Using standard thermodynamic data at 298K, calculate the…

A: Answer :- The equation is N2 (g) + 3H2 (g) = 2NH3 (g) The entropy of the surroundings changes…

Q: B. Given the following equations: Solve for the standard state entropy. 1. NaCl(s) → Na+ (aq) + Cl-…

A: To calculate standard state entropy of the following reactions : Now, from table of thermodynamic…

Q: A reaction has ΔH °rxn = -112 kJ and ΔS °rxn = 354 J/K. At what temperature is the change in entropy…

A: The quantity of energy that is absorbed inside the system at a given temperature during a particular…

Q: What is the total entropy change at 25oC for the reaction below, if the standard entropies of…

A: The Standard Entropy change of the Reaction is the difference between the entropies of Products and…

Q: Consider the reaction H2(g) + C2H4(g)- →C2H6(g) Using standard thermodynamic data at 298K, calculate…

Q: Consider the reaction: 2BrF3(g)Br2(g) + 3F2(g)…

Q: The normal boiling point of ethanol, C2H5OH, is 78.3 °C,and its molar enthalpy of vaporization is…

A: Record the given data, The given boiling point Tb = 78.3oC = 351.45 K ΔH = 38.56 kJ/mol = 38560…

Q: 4-entro Consider the reaction 2NO(g) + O2(g) 2NO2(g) Using standard thermodynamic data at 298K,…

A: given Moles of No reacted = 1.77 moles

Q: FezO4(s) + 4H2(g)3Fe(s) + 4H,0(g) Using standard thermodynanmic data at 298K, calculate the entropy…

Q: Consider the reaction 4HCI(g) + O2(g) 2H20(g) + 2C12(g) Using standard thermodynamic data at 298K,…

A: The standard enthalpy of formation of HCl(g) at 298 K is −92.3 kJ/mol. The standard enthalpy of…

Q: Consider the general reaction at 26 degrees C: 2 A + 1 B → 3 C + 2 D ΔH reaction = -1,899 kJ…

A: Entropy is the measure of disorder or randomness of a system. The free energy change is given by,…

Q: Consider the reaction: 2HBr(g)H2(g) + Br2(l) Using standard absolute entropies at 298K, calculate…

Q: 9. The standard enthalpy of vaporization of methanol is 35.2 kJ/mol at its normal boiling point,…

A: When a liquid changes to a vapor state the entropy of the system increases. The entropy of…

Q: Consider the reaction: NO(9) _H2(g) → N2(g) +. H2O) for which AS'= -551.7 J/K at 25°C. Using the…

Q: Consider the reaction: I2(g) + Cl2(g)2ICl(g) Using standard absolute entropies at 298K, calculate…

Q: Consider the reaction: CO(g) + H₂O(l) → CO₂(g) + H₂(9) - Using standard thermodynamic data at 298 K,…

Q: Consider the reaction: 2H2O(l)2H2(g) + O2(g) Using standard thermodynamic data at 298K, calculate…

Q: Consider: CO(g, 198, 29.4) + 2 H2(g, 29, 28.8) → CH3OH(g, 240, 44) What is its reaction entropy at…

A: Reaction entropy is calculated by the formula : dSrxn = Sf(Products) - Sf(Reactants) The standard…

Q: Consider the reaction: 2CO(g) + 2NO(g)2CO2(g) + N2(g) Using standard absolute entropies at 298K,…

A: Given reaction is 2CO(g) + 2NO(g) → 2CO2(g) + N2(g) Standard entropy of CO = 197.7 JK-1mol-1…

Q: Calculate the standard entropy change for the combustion of methanol, CH3OH:…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: Consider the reaction: C2H4(g) + H2O(g)CH3CH2OH(g) Using standard absolute entropies at 298K,…

A: The Balanced Chemical equation given in the question is - C2H4(g) + H2O(g) ------> CH3CH2OH(g)…

Q: Calculate the entropy of the universe in J/K mol for the reaction: 2C;H6(g) + 702(g) → 4CO2(g) +…

Q: Which of the following statements concerning entropy change is/are true? 1. For a spontaneous…

Q: Consider the reaction: NH4Cl(aq) → NH3(g) + HCl(aq) Using standard absolute entropies at 298 K,…

Q: Calculate the entropy change (J/K) of the reaction. The molar entropies [So] are given in brackets…

A: Entropy is defined as the randomness or the disorderliness of the system. It is the extensive…

Q: Consider the reaction: 2H202)2H20(1) + O2(g) Using standard thermodynamic data at 298K, calculate…

A: Introduction: Entropy is the measurement of a system's thermal energy per unit temperature that is…

Q: The normal boiling point of ethanol is 78.3˚C, and its molar enthalpy of vaporization is 39.3…

A: Boiling point is defined as the temperature at which the vapor pressure of a substance becomes equal…

Q: Consider the reaction: 4HCl(g) + O₂(g) → 2H₂O(g) + 2Cl2 (9) Using standard absolute entropies at 298…

Q: If the entropy change for the reaction is ∆Ssys = −308.6 J mol-1 K-1 at 298,15 K, what value…

A: Enthalpy as well as entropy are interrelated concepts that are linked together with Gibbs energy…

Q: Using the standard molar entropies in Appendix C, calculate the standard entropy change, ∆S°, for…

Q: Consider the reaction:3Fe2O3(s) + H2(g)2Fe3O4(s) + H2O(g)Using standard absolute entropies at 298K,…

Q: Consider the reaction N2(g) + 3H2(g)- →2NH3(g) Using standard thermodynamic data at 298K, calculate…

A: Please have a look on the solution:

Q: A reaction has AH =-131 kJ and ASm = 325 J/K. Part A At what temperature is the change in entropy…

A: see the picture solution.

Q: Part D Calculate the standard-state entropy for the following reaction: 1 CH4(g) + 2 O2(g) → 1…

A: Given, Sm° (H2O) = 189 J/K.mol Sm°(O2) = 205 J/K.mol Sm°(CH4) = 186 J/K.mol Sm° (CO2) = 214…

Question

Consider the reaction:
C,H4(g) + H,0(g)→CH3CH,OH(g)
Using standard absolute entropies at 298K, calculate the entropy change for the system when 1.71 moles of C2H¼(g) react at standard conditions.
AS°
system
J/K

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
Explain why absolute entropies can be measured.
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Liquid water at 25C is introduced into an evacuated, insulated vessel. Identify the signs of the following thermodynamic functions for the process that occurs: H, S, Twater, Ssurr,, Suniv.
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
Calculate the entropy change for the vaporization of liquid methane and liquid hexane using the following data. Boilling point (1atm) Hvap Methane 112K 8.20 KJ/mol Hexane 342K 28.9 KJ/mol Compare the molar volume of gaseous methane at 112 K with that of gaseous hexane at 342 K. How do the differences in molar volume affect the values of Svap for these liquids?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the decomposition of phosgene? COCl2(g)CO(g)+Cl2(g)
Limestone is predominantly CaCO3, which can undergo the reaction CaCO3(s)CaO(s)+CO2(g). We know from experience that this reaction is not spontaneous, yet S for the reaction is positive. How can the second law of thermodynamics explain that this reaction is not spontaneous?
The third law of thermodynamics says that a perfect crystal at 0 K has zero entropy. The standard entropy of a substance, S can be determined by evaluating the energy required to carry out conversion from 0 K to standard conditions. What information would be needed to calculate S for liquid water at 298 K and 1 bar?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)