Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s) E° = -1.87V Y3+ + 3 e Y(s) E° = -0.26 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? V 'cell

Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s) E° = -1.87V Y3+ + 3 e Y(s) E° = -0.26 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? V 'cell

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.18QAP

See similar textbooks

Related questions

Q: For the cell reaction, Zn(s) | Zn2+(aq, 1 M) || Cu2+(aq, 1 M) | Cu(s), the electrode potential of…

A: In the given question we have to calculate the cell potential. cell Reaction, Zn(s) + Cu2+(aq)…

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: Oxidation takes place at anode and reduction takes place at cathode. Loss of electrons is oxidation…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: We have two half cell reaction: X3+ + 3e- ----> X(s) E°= -1.61 V Y3+ + 3e- ---->…

Q: 7. For each of the following reactions Write the oxidation and reduction half reactions Determine…

A: Oxidation involves loss of electrons whereas reduction involves gain of electrons.

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ (ag) 2+…

A: Given: Cell reaction: Sn2+(aq) + Ba (s)---> Ba2+(aq) + Sn (s)

Q: Using the following standard reduction potentials, Fe3+(aq) + e- → Fe2+(aq) E° = +0.77 V Cd2+(aq)…

Q: A voltaic cell is based on the reaction Sn1s2 + I21s2 ¡ Sn2+1aq2 + 2 I -1aq2 Under standard…

A: The overall cell reaction given and the half reactions are

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ +3e- X(s) E°…

Q: 7. For each of the following reactions Write the oxidation and reduction half reactions Determine…

Q: What will be the overall balanced reaction if you want to make a galvanic cell? What is the…

Q: [References] A particular voltaic cell operates on the reaction Zn(s) + Cl2 (g) → Zn²+ (ag) + 2CI…

A: The solution is as follows :

Q: 9. For the galvanic cell the standard potential is as follow: Cr3+ + 3e --> Cr(s) Br2 (aq) + 2e- ->…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- »…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E°…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E =…

Q: Use information from Table 17.1 (pp. 907-909 of your textbook) to answer this question. What is the…

A: In the given cell we can see that the oxidation of Al is taking place and reduction of Cr3+ Hence…

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq) +…

A: The given values are of reduction potentials of the half cells.

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: To calculate standard potential of a galvanic cell:

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 3 Cu²+…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: Given potentials are reduction potentials. X E°= -1.65 V Y E° = 0.38 V Standard cell…

Q: (c) The magnitudes but not the signs of the standard electrode potentials of two metals, X and Y…

A: In this given question we have to find out standard emf of a cell made up of X and Y metal.

Q: A galvanic cell is constructed using two half-cells in standard state: Al|Al3* and Ni|Ni 2 Al (aq) +…

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: Concepts The question is based on calculating the overall standard cell potential, for the given…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e X(s) E°…

A: Given, The equation of standard reduction potential; X3+ + 3e- → Xs ....(1) E0 = -1.75 V Y3+ +…

Q: Using the provided standard reduction potentials, which of the following cells is an example of a…

A: For a galvanic cell to function reduction potential of cathode must be greater than anode to be…

Q: For the voltaic cell indicated by: Sn (s)|Sn²+ (aq)||Fe3+ (aq), Fe2* (aq)|Pt (8) Sketch the cell,…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: Which of the following statements is true concerning the electrochemical cell depicted below? Ba |…

A: Given, Ba | Ba2+(aq) || Zn2+(aq) | Zn Ba2+(aq) + 2e– --> Ba(s); E° = –2.91 V Zn2+(aq) + 2e–…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: Electrode reactions and electrode potentials of two electrodes that can be made into a galvanic…

Q: Consider these two entries from a fictional table of standard reduction potentials. X³+ + 3e → X(s)…

Q: 4. Write the overall balanced equation for the spontaneous process occurring in the following cell.…

A: For cell Zn|Zn2+||Cu2+|Cu We know the standard potentials - E°Zn2+|Zn= -0.76 V => E°Zn|Zn2+…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e- X(s)…

A: The solution is as follows :

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ +3e X(s) E° =…

A: To calculate E°Cell identify cathode and anode.

Q: A certain half-reaction has a standard reduction potential E=+0.45 V. An engineer proposes using…

A: Here we have to determine E°red minimum or any E°red maximum at cathode of galvanic cell. Given…

Q: The following spontaneous reaction occurs when metallic zinc is dipped into a solution of copper…

A: The given reaction is: Zn (s) + Cu2+ (aq) → Zn2+ (aq) + Cu (s) When a zinc rod is inserted into a…

Q: A voltaic electrochemical cell is constructed using the following reaction. The half-cell components…

A: In electrochemical cell Oxidation, increase in oxidation number,occur at anode . Reduction,…

Q: 1 M Zn(NO3)2 1 M AGNO3 2 Ag (aq) + Zn(s) → 2 Ag(s) + Zn2+ (aq) Under standard conditions, the…

A: A multiple choice question based on electrochemistry, which is to be accomplished.

Q: Standard reduction potentials for tin(II) and copper(Il) The standard reduction potential for a…

A: Generally, the reaction with higher reduction potential value will undergo reduction and one with…

Q: A certain half-reaction has a standard reduction potential E=+0.41 V. An engineer proposes using…

A: The standard left reduction potential at anode of half-reaction is given…

Q: 9. For the galvanic cell the standard potential is as follow: Cr3+ + 3e --> Cr(s) Зе Br2 (aq) + 2e¯…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: Fe2+ (aq) + Zn(s) Fe(s) + Zn²+(09) E +0.32 V A galvanic cell generates a cell potential of +0.32 V…

A: Answer- Cell potential- The cell potential, Ecell, is the measure of the potential difference…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: X3+ +3e- ⟶ X(s) , Eo =−1.63 V (anode) Y3+ +3e−⟶Y(s), Eo =−0.41 V (cathode)

Q: 5)A galvanic cell is based on Ag+(aq)/Ag(s) and Fe3+(aq) /Fe2+(aq) half-cells. a)What is the…

A: We are given a cell with two half cell as- Ag+(aq)/Ag(s) and Fe3+(aq) /Fe2+(aq)

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq)- +…

A: A galvanic cell is an electrochemical cell that converts chemical energy into electrical energy. A…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3++3e−⟶X(s)…

Q: Cr3+(aq) → Cr(s) Zn2+(aq) → Zn(s) a. What will be the overall balanced reaction if you want to…

A: The two half reactions are as follows: The oxidation half reaction is, Zn(s)------>Zn2+(aq) +2 e-…

Q: (E°cell)

Q: Alkaline dry-cell batteries have a voltage of 1.50 V under standard conditions. Given this standard…

A: Common flashlight batteries are called dry-cell batteries since they do not contain large amounts of…

Q: Here is a drawing of an electrochemical cell: the reactions that occur in both halves of the cell…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Tarnish on iron is the compound FeOFeO. A tarnished iron plate is placed in an aluminum pan of…

Question

Consider these two entries from a fictional table of standard reduction potentials.
X3+ + 3 e-
→ X(s)
E° = -1.87 V
Y3+ + 3 e
→ Y(s)
E°
= -0.26 V
What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode?
Eo
V
'cell

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
You want to set up a series of voltaic cells with specific cell potentials. A Zn2+(aq, 1.0 M)| Zn(s) half-cell is in one compartment. Identify several half-cells that you could use so that the cell potential will be close to (a) 1.1 V and (b) 0.50 V. Consider cells in which the zinc cell can be either the cathode or the anode.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Identify each statement as true or false. Rewrite each false statement to make it true. (a) Oxidation always occurs at the anode of an electrochemical cell. (b) The anode of a discharging voltaic cell is the site ofreduction and is negative. (c) Standard-state conditions for electrochemical cells are aconcentration of 1.0 M for dissolved species and a pressure of 1 bar for gases. (d) The potential of a voltaic cell does not change withtemperature. (e) All product-favored oxidation-reduction reactions have astandard cell potential Ecell, with a negative sign.
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.