CrO3, H2SO4 acetone

Q: 1. Mg Br 2. 3. H3o*

A: Grignard reagent: A grignard reagent is an organomagnesium halide having a formula of RMgX. Where X…

Q: (d). 1. MgBr 1. O3 (2 equivalents) 2. Me,s 2. H20

A: Organic compounds in which two carbon atoms of a hydrocarbon chain are bonded to each other by a…

Q: Give the mechanism of the following reaction: CH;Br + CH;OH → CH,OCH3 HBr

A: the mechanism is as follows:

Q: Show Steps for Mechanism and Box Final Product D HBr, ROOR La) 2 PP hg 3) Buli 4) (CHg)z C =0 ) Mg,…

A:

Q: CI I) KCN 1) HBr = 11) C12 OK Br CI

A:

Q: Meo PHSO,H -SO-Ph OMe TSOH

A: An elimination reaction is an organic reaction where a group is removed from the molecule in a…

Q: H. NH2

A: The reaction taking place is given as,

Q: Choose the correct mechanism for the following Syl reaction. + H,O + I- OH2

A:

Q: 1) 9-BBN 2) H2O2, NaOH

A:

Q: CH;CH,NH,

A: The cyclic molecule is an epoxide. Due to the presence of electronegative oxygen atom, the two…

Q: HO. Ho So,H OEt

A: We have to predict the mechanism for given reaction.

Q: + Naz BOz NABHY (CH3)2CHOH

A: NaBH4 is a reducing agent that can reduce aldehydes and ketones.

Q: ОН ОН н, аcetone CH3 H3C- H3C `CH3 НО ОН ОН НО glucose

A: Acetone/H+ reagent is generally used in sugar chemistry to protect diol. This reagent reacts with…

Q: Provide the mechanism for the 2nd reaction in this synthesis: H2O CI

A: Step 1: Acid chloride reaction with Grignard will give the ketone. Step 2: keto compound react with…

Q: OMe cm Clz mCP BA MeO `OH

A: Given reaction is example of Baeyer-Villiger oxidation. The Baeyer–Villiger oxidation is an organic…

Q: UV + Br2

A:

Q: H,O, H,SO,(cat)

A: Hydration of alkynes gives ketone. If the alkyne is terminal, markovnikov's rule follow. If the…

Q: Show the complete mechanism for the reaction of t-butyl bromide with water to produce…

A: Given :-  t-butyl bromide + water →  2-methyl-2-propanol  To draw :-  Complete mechanism of reaction

Q: on the right. You do NOT need to show the mechanisms for the rea но он 18.

A: Answer

Q: Question is attached

A: A species with a larger size can easily accommodate negative charge. In other words, in a large size…

Q: cwhat is the inner sphere mechanism of this reaction:- 2+ [COCNH3)sd]

A: A chemical reaction that takes place between two coordination compounds in which transfer of…

Q: 3. Show the reasonable curved mechanism for the reaction and make sure lone pairs Y Ocuk + Conc HBr…

A: (a) Lone pair of oxygen is acting as a HOMO and antibonding orbital of H-Br bond is acting as a…

Q: III. Give a detailed mechanism for the following reaction: HO, CI

A: Given reaction: We have to write the mechanism of the reaction.

Q: 3. Show the complete mechanism for the reaction below. H2N-NH2 NH2 • cat. HCI

A:

Q: TSOH MeOH

A: Product for the given reaction is,

Q: HiCan you help me with this question?

A: Secondary or tertiary alcohols reacts with Lucas reagent (HCl and ZnCl2) by SN1 mechanism and forms…

Q: SOC2, py HO:

A: Alcohol reacts with thionyl chloride in the pyridine solvent to give alkyl chloride.

Q: show me and explain the mechanism for this reaction please

A: In the above reaction, since the alcohol is 2 degree, hence the reaction is happening  The above…

Q: 2. Complete the following reactions and provide the reaction mechanism: Br2, FeBr3 H*

A: The hydrogen atom which is present in the aromatic ring is replaced by the electrophile is known as…

Q: Catelyst Rucly CPPh37, me

A:

Q: с-НCI (1 drop) H. OCH2CH3 H2N NH2 O2N ethanol, reflux 1. major product 2. the most plausible…

A:

Q: Hi/hegt HO.

A:

Q: EtO, Eto OMe OMe NH 6 py: ба Ph Ph

A: In this mechanism, lone pair electrons on the N atom is attacked to the carbonyl carbon. Finally HCl…

Q: 2. How to do the following reactions. Please propose mechanism. 2) NH₂ 0-0 0-10 Br CO₂

A: These are multistage conversion  which requires many steps and Reagent .

Q: SHOW THE MECHANISM AND STEPS: Benzene---> Propiophenone(C9H10O)----> Methanol

A: The first step of conversion from the benzene to propiophenone take place by acylation reaction

Q: H3CO, NaOH H,CO H3CO OCH3

A:

Q: .CI AICI, 'CI 'CI

A: Ans  Electrophilic substitution reaction takes place

Q: CH2Br 1. NaNH2 → A CH3CH2C=CH В

A: We have to draw the products and give the mechanism for the formation of A and B as follows in step…

Q: Determine the product and give the complete mechanism for the reaction. 1. excess NaOEt 2. odin…

A:

Q: Suggest a reasonable mechanism for the reaction shown Br here. HO CH;CH,OH

A: The given reaction is shown below:

Q: NGOH/H,O 4

A: Since you have asked multiple question, we will solve the first question for you as per our…

Q: KCN, HCN H* heat

A: In nucleophilic substitution reaction nucleophile attacks on substrate (electrophilic center) to…

Q: CH3 CH3 from OH and isopropyl alcohol

A:

Q: QII: Give plausible mechanism for the following reaction: HCI Н ииии Он Н ииии CI + H mmCI ZnCl,

A: The solution of anhydrous ZnCl2 in concentrated HCl is known as Lucas’ reagent. It actually used as…

Q: D. Provide a reasonable mechanism for the following reaction. ·CCL 3 1. NaOH, H₂O 2.H₂O* он

A:

Q: O,N CAty Br febrs

A: The reaction given is,

Q: Propose a plausible mechanism for the followng reaction INa, NH3 (liq) 2 NH CI

A: Reduction is the reaction of addition of 2H atom across carbon-carbon double bond or triple bond…

Polymerization Kinetics

Polymerization is a chemical process in which one or more monomers combine to produce a very large chain-like molecule called a polymer. The functional groups present on the monomers and their steric effects are responsible for polymerization through a sequence of reactions that diverge in complexity. There exists a stable covalent chemical bond between monomers that sets apart polymerization from other processes. Polymerization is generally classified into step-growth and chain polymerization. Polymers are categorized into linear polymer and cross-linked polymers that are produced either by condensation or additional polymerization.