Cryolite, Na AIF, (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide.Balance the equation for the synthesis of cryolite.equation: Al,0,(s) + NaOH(1) + HF(g)Na, AIF, + H,O(g)If 15.5 kg of AI,0,(s), 52.4 kg of NaOH(1), and 52.4 kg of HF(g) react completely, how many kilograms of cryolitewill be produced?mass of cryolite produced:kg Na, AIF,Which reactants will be in excess?HFAl,O,NaOHWhat is the total mass of the excess reactants left over after the reaction is complete?

Al2O3 (s)+NaOH (l) +HF(g)--> Na3AlF6+ H2O(g) To balance the reaction, first balance number of Al…

Cryolite, Na, AIF, (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NaOH(1) + HF(g) → Na, AIF, + H,O(g)

Cryolite, Na, AIF, (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NaOH(1) + HF(g) → Na, AIF, + H,O(g)

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Related questions

Q: Determine if the following statements are true or false. _____ 1. Water decomposes when an electric…

A: 1. Passing of Electric current results in dissociation of water into Hydrogen and oxygen. So, it is…

Q: Give the product of the given reactants, balance the equation, and identify the type of chemical…

A: Give the product of the given reactants, balance the equation, and identify the type of chemical…

Q: Balance the following chemical equation (if necessary): Si,H,(s) + O,(g) → SiO,(g) + H,O(g)

A: We have to predict the balanced chemical reaction.

Q: Balance the following chemical equation (if necessary): Ca(s) + O,(9) → CaO(s)

A: The given equation is, Ca(s) + O2(g) → CaO(s)

Q: Balance the following equation by algebraic method. Fe O2 Fe,O LL.

Q: If you blow carbon dioxide gas into a solution of calcium hydroxide, a milky-white precipitate of…

A: When we blow carbon dioxide gas into a solution of calcium hydroxide, a milky-white precipitate of…

Q: Write a balanced chemical equation based on the following description: butanoic acid, C,H;COOH(I)…

A: completely

Q: Balance the following equations. Classify the type of chemical reaction. (NH),Cr,0, > N + Cr,0, +…

A: As you have posted multipart question. We will solve first three parts. Solution: For balancing the…

Q: the give and sodium chloride, and then write the net ionic equation. Show states for all reactants…

A: 5. Hess's law is constant heat of summation and this law states that total enthalpy change during…

Q: Balance the following chemical equation (if necessary) for the combustion reaction of propane:…

A: In multiple questions we solve only first question according to Bartleby guidelines. Balance the…

Q: Balance the chemical equation for the reaction of BaCl, and Na, SO.. chemical equation: BaCl, (aq) +…

A: First question you have answered is correct. The given reaction is a double replacement reaction.

Q: Balance the following chemical equation and indicate the state of the reactants and products:…

A: Given reaction is Ba(OH)2 (aq) + H3PO4 (aq) --------> Ba3(PO4)2 (s) + H2O (l) Since the…

Q: Write a balanced chemical equation based on the following description: solid potassium oxide reacts…

Q: Balance the following chemical equation (if necessary): Ca(OH),(s) + H,PO,(aq)→ H,O(1) +…

Q: Write the balanced chemical equation for the reaction shown. = NO NO, balanced equation: 4NO, + 8NO…

A: A chemical equation is said to be balanced if atoms of different elements are equal in number on…

Q: Balance the following chemical reaction and determine the coefficients of H2O and AlK(OH)4,…

A: A balanced chemical equation states that the number of elements in the reactant side is equal to the…

Q: O CHEMICAL REACTIONS Writing the net equation for a sequence of reactions Manganese commonly occurs…

A: To write the net chemical equation of the given two steps involved, we have to identify the common…

Q: Balance the reactions and indicate which type of chemical reaction (synthesis [S), decomposition…

A: Since you have posted multiple questions, the answer for first three questions are given below.…

Q: Balance the following chemical equation (if necessary): Sn (ClO₄)₄(s)→SnCl₄(s)+O₂(g)

Q: Balance the following chemical equation (if necessary): (NH,),SO,(aq) + BaCl,(aq) → BaSO,(s) +…

A: The reactions must be balanced in order to follows the law of conservation if mass i.e mass can…

Q: In the article, the equation Fe²(aq) + 2OH (aq) → Fe(OH),(s) is shown as an intermediate step in the…

A: In an oxidation-reduction reaction, one reactant undergoes oxidation and another reactant undergoes…

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

A: Given: The percent yield of first step and second step is 84% and 65%, respectively. The amount of…

Q: Balance the following equations and indicate whether they are combination, decomposition, or…

A: 3.21 Given Unbalanced chemical equations, (a) C3H6 (g) + O2 (g) → CO2 (g) + H2O (g) (b) NH4NO3 (s)…

Q: The equation for the reaction between phosphorus and oxygen is shown. xP4 + yO2 → ZP2O5 Which values…

A: xP4 + yO2 → ZP2O5 ........[1] 1. Let, x=1 The number of P in the left-hand side of the…

Q: razine, a fuel used to power rocket engines, is a product of the reaction between ammonia and…

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

A: Given- First step- 2Cu2S+3O2->2Cu2O+2SO2 Second step- Cu2O+C->2Cu+CO

Q: HC0a2H,0+ NaOH H>0+ NazCO4

A: Balance the reaction. Use the lowest possible positive integers as coefficients ---

Q: Balance the following chemical reaction and determine the coefficients of H2O and AIK(OH)4,…

A: A question based on stoichiometry that is to be accomplished.

Q: Balance the following chemical equation (if necessary): C,H,O,(9) + O,(9) → H¸O(g) + CO,(g)

A: The equation need to be balanced in order to follow the law of conservation of mass i.e mass a…

Q: Balance the following chemical equations: Fe + O2 à Fe2O3

A: Process for balance the reaction 1. Determine n facor of reactant . 2. Cross multiply 3. Balance…

Q: The unbalanced equation for the reaction of gold with aqua regia is given. Add the stoichiometric…

A: Gold react with hydrogen chloride and nitric acid to produce hydrogen tetrachloridoaurate, nitrogen…

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

A: Given : Two step reaction is given . Yield of step 1 = 84 % Yield of step 2 = 95 % Mass of Copper…

Q: What is the balance chemical equation of Na + S8 --> Na2S

Q: Balance the following chemical equation (if necessary): H,SO,(aq) + Pb(OH),(s) → Pb(SO,),(s) +…

A: To balance the chemical equation no. of atoms on the reactant side must be equal to no. of atoms on…

Q: Write a balanced chemical equation based on the following description: solid C,H100 is burned with…

A: In a chemical reaction; the substance which involves in conversion is said to be reactant whereas…

Q: Balance the following reaction equation (place integer coefficients in the underlined spaces in…

A: The balanced equation is the one in which the number of atoms on reactant side should be equal to…

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

A: Given that : Mass of copper = 1.0 kg = 1000 g Mass of oxygen required = ?

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

A: A net chemical reaction, represents all the chemical species that are present in a chemical…

Q: Types of Reactions (identify the reaction type and balance the chemical equation) CaCO, + HCI >…

A: A chemical reaction occurs when reactants undergo a chemical change and get converted into products.…

Q: Balance the following chemical reaction and determine the coefficients of H2O and AIK(OH)4,…

A: Balanced chemical equation is the equation in which number of atoms on left hand side and right hand…

Q: Balance the following chemical equation (if necessary): Ca(C,H,O,),(aq) + Na,co,(aq) → CaCO,(s) +…

A: This is a precipitation reaction: CaCO3 is the formed precipitate

Q: B. Balance the following equations and indicate the type of reaction: 1) H,S so, H,0 2) C;H,0 co,…

A: 1. Balanced equation: 2H2S + 3O2 → 2SO2 + 2H2O Type of reaction => combustion reaction.

Q: Use the References to access important values if needed for this question. When the following…

A: The given reaction is, Fe2O3(s) + Al(s) → Al2O3(s) + Fe(s) Multiply Fe(s) with 2 in order to balance…

Q: The useful metal manganese can be extracted from the mineral rhodochrosite by a two-step process. In…

Q: 1. Balance each chemical reaction: H, + 2 HI а. b. Al + 02 Al,0, '23 + Cl, NaCl С. Na -> d. Al + HBr…

A: Heat capacity or thermal capacity is a physical property of matter, defined as the amount of heat to…

Q: Balance the following chemical equation (if necessary): Si,H (s) + O,(g) → SiO (9) + H_O(g)

A: Balanced chemical equation:

Q: There are two steps in the extraction of copper metal from chalcocite, a copper ore. In the first…

Q: (Balance the equation) FeCl+NaOHàFe(OH)3+NaCl

A: Note: The compound FeCl does not exist. Hence, the compound FeCl3 is taken as the one of the…

Q: Balance the equation for the formation of magnesium hydroxide [Mg(OH)2], one of the active…

A: A balanced reaction is the one where the number of atoms of each element is same on both reactant…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Cryolite, Na AIF, (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide.
Balance the equation for the synthesis of cryolite.
equation: Al,0,(s) + NaOH(1) + HF(g)
Na, AIF, + H,O(g)
If 15.5 kg of AI,0,(s), 52.4 kg of NaOH(1), and 52.4 kg of HF(g) react completely, how many kilograms of cryolite
will be produced?
mass of cryolite produced:
kg Na, AIF,
Which reactants will be in excess?
HF
Al,O,
NaOH
What is the total mass of the excess reactants left over after the reaction is complete?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
Write a balanced equation for the reaction between (a) dihydrogen sulfide and sulfur dioxide gases to form sulfur solid and steam. (b) methane, ammonia, and oxygen gases to form hydrogen cyanide gas and steam. (c) iron(lll) oxide and hydrogen gas to form molten iron and steam. (d) uranium(IV) oxide and hydrogen fluoride gas to form uranium(IV) fluoride and steam. (e) the combustion of ethyl alcohol (C2H5OH) to give carbon dioxide and water.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.