Cryolite, Na, AIF,(s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NaOH(1) + HF(g) → Na,AlF, + H,0(g) If 15.6 kg of Al,0,(s), 57.4 kg of NaOH(1), and 57.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? kg Naz AIF6 mass of cryolite produced: Which reactants will be in excess? HF NaOH O Al,O3 What is the total mass of the excess reactants left over after the reaction is complete? total mass of excess reactants: kg

Cryolite, Na, AIF,(s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NaOH(1) + HF(g) → Na,AlF, + H,0(g) If 15.6 kg of Al,0,(s), 57.4 kg of NaOH(1), and 57.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? kg Naz AIF6 mass of cryolite produced: Which reactants will be in excess? HF NaOH O Al,O3 What is the total mass of the excess reactants left over after the reaction is complete? total mass of excess reactants: kg

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Similar questions

The balanced equation for the reduction of iron ore to the metal using CO is Fe2O3(s) + 3 CO(g) 2 Fe(s) + 3 CO2(g) (a) What is the maximum mass of iron, in grams, that can be obtained from 454 g (1.00 lb) of iron(III) oxide? (b) What mass of CO is required to react with 454 g cot Fe2O3?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Cisplatin, Pt(NH3)2Cl2, a drug used in the treatment of cancer, can be made by the reaction of K2PtCl4 with ammonia, NH3. Besides cisplatin, the other product is KCl. (a) Write a balanced equation for this reaction. (b) To obtain 2.50 g cisplatin, calculate what masses (in grams) of K2PtCl4 and ammonia you need.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
4.28 One of the steps in the manufacture of nitric acid is the oxidation of ammonia shown in this equation: 4NH3(g)+5O2(g)4NO(g)+6H2O(g) If 43.0 kg of NH3 reacts with 35.4 kg of O2, what mass of NO forms?
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)arefurnaceElectricSi(s)+CO(g) b. Liquid silicon tetrachloride is reacted with very pure solid magnesium, producing solid silicon and solid magnesium chloride. c. Na2SiF6(s) + Na(s) Si(s) + NaF(s)