[Cu(C204)2(H20)(NH3)] a.) What is the coordination number for the complex? b.) What is the charge on the central metal? Show your work. c.) Draw the isomers of the complex. Use the terms mer, fac, cis or trans if needed. Include any optical isomers

[Cu(C204)2(H20)(NH3)] a.) What is the coordination number for the complex? b.) What is the charge on the central metal? Show your work. c.) Draw the isomers of the complex. Use the terms mer, fac, cis or trans if needed. Include any optical isomers

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 6QAP: What is the coordination number of the central metal atom in the following complexes? (a)...

See similar textbooks

Related questions

Q: So I am working with an octahedral complex that has two weak field ligands (Cl) and 4 strong field…

Q: (b) What are the effects of r-donor and t-acceptor ligands on the splitting of metal d orbitals in…

A: Answer- When the ligands approach the central metal ion, d- or f-subshell degeneracy is broken due…

Q: a) The terms low spin and high spin apply only to complexes of d-metal ions having certain numbers…

A: Dueto strong field ligand pairing of electron occurs so it forms low spin complex. And weak field…

Q: For the two complex ions [Mn(CN)6]4− and [Mn(H2O)6]2+ (a) Are all metal ligand bonds equal to…

A: We are given two complex, [Mn(CN)6]4−having CN as the pi acceptor an a strong field ligand.…

Q: (a) A complex containing three pyridine and three ammonia ligands bound to a Ni(II) ion was found to…

Q: 11. Consider the complex: [Co (H2O)4 (CN)2] Br3 a) What is the coordination number of the metal atom…

A: We will draw structure of the complex and then answer the questions.

Q: 2. Why can an organometallic complex perform the reactions such as insertion where normal…

A: 1) organometallic complexes which involves the bond formation between carbon and hydrogen atom…

Q: Consider the following coordination compound: [CoCl(NH3)4(H2O)]SO4- What is its formula and…

A: A question based on coordination complex, which is to be accomplished.

Q: (a) Draw all the possible isomers of [Fe(NH3);Br3] and for each isomer clearly indicate the…

A: a) There are two possible isomers of the given compound, fac and mer. These are shown as below:…

Q: What would you expect the coordination sphere for the complex ion formed from Ni^2+ and…

A: In coordination chemistry, the first coordination sphere refers to the array of molecules and ions…

Q: Find a crystal structure for any metal complexes, define the oxidation state of metal, define the…

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3 Name => Triamminetrichloridochromate(III)

Q: The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectre infrared shows two bands…

A: The complex synthesized is: [Co(CO)2(CN)2Br2]

Q: 2. Ferrocyanide and ferricyanide are a particular kind of transition metal complex. State what that…

Q: Consider the coordination compouná ammonium hexacyanoferrate(III a What is the charge on the complex…

A: We have to find the charge on the complex ion for the following given compound as follows in step 2:

Q: <p>List all the different formulas for an octahedral complex made from a metal (M) and three…

A: A trans and B and C cis, C trans and A and B cis and B trans and Aand C cis.Then all the below are…

Q: Consider the coordination complex [Cr(OH2)3CI3]Br3 Identify the ligands by name (include the word…

A: Given complex--- [Cr(OH2)3Cl3]Br3

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

Q: 1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain…

A: Back donation:The carbonyl ligand that coordinated with the metal has electron rich sp orbital. The…

Q: There are two isomerism in coordination complexes which are structural isomerism and…

Q: Consider [Co(CI)6]* and [Co(NH3)6]3* ions. i. Illustrate the energy level splitting diagram for both…

Q: Determine the LFSE in terms of Δ and P for the following complex ions. Be sure to draw the…

Q: Crystals of anhydrous chromium(I) chloride are violet and insoluble in aqueous solution. The…

A: The Cr3+ ion has a high tendency to form an octahedral complex thus, Cr3+ binds with 6 Cl- ions to…

Q: [CoCl2(NH3)4] Cl is a Coordination compound, Counter ion, Ligand, or Complex ion? In the compound…

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: Explain the following :(i) Low spin octahedral complexes of nickel are not known.(ii) The…

A: Low spin octahedral complexes are formed when the central metal atom undergo d2sp3 hybridisation by…

Q: the coordination compound Rb2[Cr(O)Cls] (one oxide ligand and five chloride ligands). a. Determine…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: a. Compounds 1 and 2 are complex ions of cobalt. 2+ 2+ NH2 H2 PME2 Me2 H,N. H,N NH, H2 Me,P. Me,P…

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

Q: Many trace metal ions exist in the blood complexed with amino acids or small peptides. The anion of…

A: (a)

Q: Werner first published his thoughts concerning the possibiolity of chiral coordination compounds in…

A: Geometrical isomer Geometrical isomer having the same molecular formula and same structure but it…

Q: Provide the name of the coordination complex Na[CoCl4(NH3)2] b) Calculate the orbital multiplicity…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: 1. Consider the coordination compound Na4[Fe(ONO)2(Ox)2]. A. Write the systematic name of the…

Q: a) (i) Draw the structure of [Co(CO)2(NO)(cot)] where cot is cyclooctatriene. (ii) What is the…

Q: Below are five pairs of transition metal complexes. For each pair, select the complex that is more…

A: Since you have posted multiple subparts , we are doing first 3 for you. To do the rest repost the…

Q: Alfred Werner, found the key to understanding coordination compounds by synthesizing the series of…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: What is the formula for the complex ion made by iron(IIl) with 4 aqua and two thiosulfato (S,0022)…

A: Known Metal ion - Fe3+ ; ligands are 4 aqua - 4 H2O S2O32- Complex should be written in square…

Q: Consider the coordination complex with the formula: [Fe(NH3)4(NO2)2]Br a. Can this complex have…

A: Isomers are molecules that have the same molecular formula , but have a different arrangement of the…

Q: (a) There are essentially three bonding concepts used to describe the bonding in coordination…

A: Solution: For a given complex we can find type of hybridization and magnetic property of the complex…

Q: A) Using a cobalt (III) ion as the central metal atom, and with chloride ions (Cl-) and ammonia…

Q: ) trans-[Co(en)2Cl2]Cl is a chiral compound ) The coordination number for the anionic complex in…

A: If any molecule has sigma plane of symmetry or inversion centre , then we can say the molecule is…

Q: Using crystal field theory, draw an electron box energy level diagram for the valence d orbitals on…

Q: The complex [Fe(CO)6]+2 exhibits π-acceptor behavior. Using ligand field theory, draw the molecular…

A: Ligand field theory is the theory which includes both the ionic and covalent bonding of the…

Q: The following neutral molecules or ionic species are considered: CIo, CNO, NH3, O2, CH4,…

A: Coordinate complex is form by the coordinate covalent bond. In coordinate covalent bond the central…

Q: Question attached?

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: [Co(NH3),]*2

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: What was the test that could used to determine the oxalate concentration in this complex?

A: A coordination complex is the result of a Lewis acid-base reaction in which neutral molecules or…

Q: Crystal field splitting can impact the properties of coordination complexes. In particular, whether…

Q: Write the formula for a complex formed between Ag+ and NH, with a coordination number of 2. formula:…

Question

[Cu(C204)2(H20)(NH3)]
a.) What is the coordination number
for the complex?
b.) What is the charge on the central
metal? Show your work.
c.) Draw the isomers of the complex.
Use the terms mer, fac, cis or trans if
needed. Include any optical isomers

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]