Help me with the one that got marked wrong Draw and describe how you would construct a voltaic cell to study thisreaction. Label all parts of your drawing. Hint: read the Electrochemistrychapter in your text.4 Curentsvoaic alIcurrentarid ation:->Ni aet 2eNies)Reduction:AnodeSaHbridge24where Hgle)?21NiztAM NISOY)Reduction Half CellO xid ationhalf cell(1M 4. Write the half-cell reactions associated with the following oxidation-reductionreaction: (be sure to include ion charges and phases associated with each species)Ni(s) + Hgz²"(aq)→ 2Hg(l) + Ni2* (aq)Anode half-cell reaction : Ni(s) Na) + 2e-24Cathode half-cell reaction : Hq (ag) + 2e¯>2 Hg ce) v

Answered: Image /qna-images/answer/02c9c13b-daf8-47a5-8880-393d6ba591e5.jpg

Draw and describe how you would construct a voltaic cell to study this reaction. Label all parts of your drawing. Hint: read the Electrochemistry chapter in your text. 4 Currents volaic calI E current aridation: Nies)> Anode Reduction: SalH bridge 24 where Hgle)? NI La Reduction Half cell O xidation half cell

Draw and describe how you would construct a voltaic cell to study this reaction. Label all parts of your drawing. Hint: read the Electrochemistry chapter in your text. 4 Currents volaic calI E current aridation: Nies)> Anode Reduction: SalH bridge 24 where Hgle)? NI La Reduction Half cell O xidation half cell

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 59P

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+