Answered: Explain why the curve has two segments…

Science

Chemistry

Explain why the curve has two segments in which heat is added to the water but the temperature does not rise?

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU5: Fire: Energy , Thermodynamics, And Oxidation-reduction

SectionU5.3: Point Of View: First And Second Laws

Problem 10E

See similar textbooks

Related questions

Q: An increase in water temperature is observed when 1.97 g of NaOH is added. The enthalpy change for…

A: Mass of NaOH = 1.97 g Enthalpy change for reaction (dH°) = -2.19KJ dH° is negative . Molar mass of…

Q: Convert the heat of neutralization of acetic acid from -52.2 kj/mmol to calories per %3D millimole…

A: The heat of neutralization of acetic acid = - 52.2 KJ /mmol We know ; 1 Kilo Joules = 1000 Joules…

Q: Calculate

A: Water is not heated upto 100°C so it is not boiled. So that, specific heat capacity of water is…

Q: Calculate how much heat 32.0 g of water absorbs when it is heated from 25.0°C to 80.0°C. Specific…

Q: How much heat, in joules and in calories, must be removed from 1.75 mol of water to lower its…

Q: A calorimeter is pictured below. When substances are dissolved in water, they can absorb or release…

Q: A 8.17 g sample of an unknown salt (MM = 116.82 g/mol) is dissolved in 150.00 g water in a coffee…

A: Guideline message: In case of multiple subparts, ideally the first 3 subparts should be answered, if…

Q: If a student wants to make 225.0 mL of a 17.65M stock solution of ZnCl 2, how many grams of solid,…

Q: How much heat is needed to warm 250 g of water from 22°C to near its boiling point, 98°C? The…

Q: Knowing that its specific heat capacity is 1 calorie/(g•°C), how much would the temperature of 16.0…

A: Solution : Specific heat capacity is defined as the amount of heat required to raise the…

Q: If 14.5 kJ of heat were added to 485 g of liquid water, what would be the increase in temperature?…

A: Concept introduction- Specific heat- It is the amount of heat required to raise the temperature of…

Q: If substance X has a higher specific heat value, how will the temperature of substance X compare to…

A: Given, The substance X has higher specific heat than…

Q: Using the molar heat of solution provided in the question above: determine how many g solid sodium…

A: The molar heat of the solution of sodium hydroxide is = -445.1 kJ/mol The volume of the water is =…

Q: What is the final temperature (in °C) of 150.1 g of water (specific heat = 4.18 J/g･°C) at 24.2°C…

A: Interpretation: The final temperature of 150.1 g of water at 24.2°C that absorbed 950.0 J of heat is…

Q: NaOH, ethanol heat

A: Organic reactions are those in which organic reactant react to form organic products.

Q: What is the final temperature (in °C) of 100.1 g of water (specific heat = 4.18 J/g･°C) at 24.2°C…

A: Heat is the form for energy and is defined in joule. Heat flow from high temperature to low…

Q: Which change occurs to cause water to boil into steam? O The addition of thermal energy causes the…

A: Water molecule are held together by a electrostatic force called hydrogen bonding . Due to hydrogen…

Q: Which change occurs to cause water to boil into steam? O The addition of thermal energy causes the…

A: Option first is the correct answer. The addition of thermal energy causes the motion of water…

Q: When we heat the cheetos was all the heat released actually captured by the water?

A: In cheetos experiment, a chip is burnt and heat released by it is used to raise the temperature of…

Q: What is it called when the final temperature of your Solid (Tin) and the water are equal?

Q: How much heat is released when 60.5 grams of water at 60.0 degrees C changes to water at 12.5…

A: The question is about calculating the amount of heat released when 60.5 grams of Water at 60oC…

Q: 100 g of a solution (specific heat of 0.32 J/g C) undergoes a reaction in which 74.84 J of heat is…

A: Mass of solution = 100 g Specific heat = 0.32 J/g oC Heat released = 74.84 J

Q: 1. The high specific heat of water is responsible for the following, except: A. helps moderate…

A: A multiple choice question based on intermolecular forces that is to be accomplished.

Q: Calculate the change in temperature of water that is initially at room temperature if 3.0 kJ of heat…

Q: which substance has the highest specific heat?

A: The specific heat is the amount of heat required to raise the temperature of unit mass substance by…

Q: The high specific heat of water explains why climates on land near bodies of water are moderate.…

A: Please find your solution below : Specific heat of a substance is defined as the amount of heat…

Q: How does the ocean affect coastal climate? A. The specific heat capacity makes the coast colder in…

A: Specific heat capacity of a substance is the amount of heat required to raise the temperature of the…

Q: Given that a 10.0 g sample of ice melts and then the resultant water proceeds to warm to 20.0 C,…

A: Given mass of ice = 10g Process 1: conversion of ice at 0 degree tp water at 0 degree The total heat…

Q: Examine the heating curve for water? Explain why the curve has two segments in which heat is added?

A: Water has hydrogens that are directly bonded to the oxygen atom. Water is capable of forming…

Q: How much heat, in joules and in calories, must be removed from 1.75 mol of water to lower its…

A: Formula used: Q=mcΔT C = 1.00cal/g∘C or 4.186J/g∘C moles of water to grams…

Q: Calculate the heat lost by the liquid water (in kJ).

A: The equation of heat is as follows : q = m × c × ∆T…

Q: How many kilojoules of heat are absorbed when 2.00 L of water is heated from 12.5°C to 93.5°C?

A: Mass= density×volume Mass= 1×0.002=0.002gm Now Q=mc∆T Q= 0.002×4.18×(93.5-12.5) Q= 0.067×10-6kj

Q: If 40.0 kJ of energy is absorbed by 500.0 g of water at 10.0 oC, then what is final temperature of…

A: Q = m . s . (T2-T1)

Q: 300mL of a 2.500 M solution X was mixed with 300.0 mL of a 2.500 M solution Y in a calorimeter. Both…

A: Given that, Volume of 0.2500 M X solution = 300 mL Volume of 0.2500 M Y solution = 300 mL Total…

Q: A student mistakenly uses 0.31g Mg. Will the temperature change of the solution be affected/ If so,…

A: Given that - Mass of magnesium mistakenly used = 0.31 g Mass of magnesium actually used = 0.15 g…

Q: What Are the Properties of Water?

A: The chemical formula of water is H2O. In the structure of water, hydrogen atoms are bonded to oxygen…

Q: A hot pot of water is set on the counter to cool. After a few minutes it has lost 335 J of heat…

A: In this question, we will determine the heat energy gained by the surrounding. You can see the…

Q: Imagine a container placed in a tub of water, as depicted inthe accompanying diagram. (a) If the…

A: a) Heat generally flows from high temperature to low temperature. here temperature of the system is…

Q: What are the Property’s of water?

Q: What is the final temperature of 450.1 g of water (specific heat = 4.18 J/g･°C) at 24.2°C that…

A: a Specific heat is heat is required to increase the temperature of of 1 gram of substance by…

Q: What is the final temperature of 420.1 g of water (specific heat = 4.18 J/g･°C) at 24.2°C that…

A: The final temperature of water is to be calculated. 14.00 Normal 0…

Q: Relate the heat gained by the calorimeter and water with the heat lost by the metal. EXPLAIN

A: The heat gained by the calorimeter or water is always equal to the heat lost by the metal.This the…

Q: How much heat is gained by the water? B. How much heat heat is lost by the zinc metal? C. From the…

A: To solve this problem we will use the formula q = m • C •∆T Where , q = heat released or absorbed…

Q: How much heat would be required to raise 499 g of water from 111 °C to 251 °C? (You need to know…

Q: > What type of system and process does the Water Heater that takes-in cold water and releases-out…

A: Solution Heat pump water heaters use electricity to maneuver heat from one place to a different…

Q: Why is liquid water more dense than solid water? In simple terms, so that I can understand. Thank…

A: Liquid water is more dense than solid water i.e ice. Reason:- Due to intermolecular hydrogen…

Q: When substances are dissolved in water, they can absorb or release heat. Describe how you would use…

A: A calorimetry is a technique/apparatus used in laboratories which helps us in determining whether…

Q: Calculate the heat change in kilojoules for freezing 30.0 g of water at 0 ∘C.

A: Heat change in freezing is equal and opposite of heat change in melting or heat of fusion (dHfus).…

Q: enthalpy

Question

Explain why the curve has two segments in which heat is added to the water but the temperature does not rise?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

If 14.5 kJ of heat were added to 485 g of liquid water, how much would its temperature increase?
Are changes in state physical or chemical changes? Explain. What type of forces must be overcome to melt or vaporize a substance (are these forces intramolecular or intermolecular)? Define the molar heat of fusion and molar heat of vaporization. Why is the molar heat of vaporization of water so much larger than its molar heat of fusion? Why does the boiling point of a liquid vary with altitude?
Sodium chloride is added in cooking to enhance the flavor of food. When 10.00 g of NaCl are dissolved in 200.0 mL of water at 25.0C in a coffee-cup calorimeter, 669 J of heat are absorbed. (You can make the following assumptions about the solution: volume =200.0 mL, density =1.00 g/mL, specific heat =4.18J/gC) (a) Is the solution process exothermic? (b) What is qH2O? (c) What is the final temperature of the solution?
A calorimeter contains 72.0g of water at 19.2C. A 141-g piece of tin is heated to 89.0C and dropped into the water. The entire system eventually reaches 25.5C. Assuming all of the energy gained by the water comes from the cooling of the tin-no energy loss to the calorimeter or the surroundings-calculate the specific heat of the tin.
Define the joule in terms of SI base units.
Dissolving 3.0 g of CaCl2(s) in 150.0 g of water in a calorimeter (Figure 5.12) at 22.4 °C causes the temperature to rise to 25.8 °C. What is the approximate amount of heat involved in the dissolution, assuming the specific heat of the resulting solution is 4.18 J/g °C? Is the reaction exothermic or endothermic?
Differentiate between the enthalpy of formation of H2O(l)andH2O(g) . Why is it necessary to specify thephysical state of water in the following thermochemicalequation CH4(g)+2O2(g)CO2(g)+2H2O(lorg)H=?
Copper is used in building the integrated circuits, chips, and printed circuit boards for computers. When 228 J of heat are absorbed by 125 g of copper at 22.38C, the temperature rises to 27.12C. What is the specific heat of copper?
ou place hot metal into a beaker of cold water. ol type='a'> Eventually what is true about the temperature of the metal compared to that of the water? Explain why this is true. i>Label this process as endothermic or exothermic if we consider the system to be the metal. Explain. the water. Explain.
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
A 0.500-g sample of KCl is added to 50.0 g of water in a calorimeter (Figure 5.12). If the temperature decreases by 1.05 °C, what is the approximate amount of heat involved in the dissolution of the KCl, assuming the specific heat of the resulting solution is 4.18 J/g °C? Is the reaction exothermic or endothermic?
How much heat, in joules and in calories, must be added to a 75.0g iron block with a specific heat of 0.449 Jig C to increase its temperature from 25 C to its melting temperature of 1535 C?