Answered: Find moles H2SO4 and moles of NaOH…

Science

Chemistry

Find moles H2SO4 and moles of NaOH using the balanced eqaution H2SO4 + 2NaOH = Na2SO4 + 2H2O

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 6QAP: or each of the following reactions, give the balanced chemical equation for the reaction and state...

See similar textbooks

Related questions

Q: Al(s)+O2(g) —— Al2O3(s) What is the mole ratio of aluminum and aluminum oxide?

A: Given:- Al(s) + O2(g)→Al2O3(s) (unbalanced equation) To find: Mole ratio of Al and Al2O3

Q: How many moles of aluminum are needed to make 6 moles of molecular hydrogen ? Given the reaction : 2…

Q: How many grams of NO can be formed from 4.96 moles of NO₂ in the reaction below? 3 NO₂ (g) + H₂O (g)…

A: Stoichiometry is mainly based on the calculation of moles and volumes. These two values are used to…

Q: Consider the reaction of zinc oxide with sulfuric acid: ZnO (s) + H2SO4 (aq) → ZnSO4 (aq)…

A: The given reaction is, ZnO (s) + H2SO4 (aq) --> ZnSO4 (aq) + H2O(l) Element L.H.S…

Q: What is the correct coefficient for H2 in the balanced version of the following equation? Fe203 + H2…

Q: For the chemical reaction Na, CO, + Ca(NO,)2 - CACO, + 2 NaNO3 > how many moles of calcium carbonate…

A: According to the balanced chemical reaction one mole of calcium carbonate is produced from one mole…

Q: starting with the equation, KOH(s)+CO2(g)=K2CO3(S)+H2O(L) Calculate the mas in grams of KOH that…

A: Given, KOH(s) + CO2(g) ➝ K2CO3(s) + H2O(l) mass of K2CO3 produced = 285 g mass of KOH required = ?…

Q: Mg + 2H2O -> Mg(OH)2 + H2 How many moles of H2 will be produced from 12 moles of H2O?

A: Given reaction is, Mg + 2H2O -> Mg(OH)2 + H2

Q: Given 100 g-mol of molybdotellurate: 3(NH4)22TeO3.6MoO3.10H2O, calculate: a) kg molybdotellurate b)…

A: The given molybdotellurate is 3(NH4)2.2TeO3.6MoO3.10H2O The molecular weight of this substance =…

Q: Phosphorus pentachloride reacts with water to form hydrochloric acid and phosphoric acid. How many…

A: As water is in excess so PCl5 is limiting reagent.

Q: 1.) 10g of an imaginary molecule X is dissolved to form a 500 mL solution. Calculate the…

A: (1) Molarity or concentration can be defined as the moles of solute that can be dissolved per litre…

Q: 2KCl2 ? 2KCl + 3O2 How many moles of oxygen gas could be produced from 5.0 moles of KClO3 using the…

A: The reaction of decomposition of KClO3 can be written as follows: 2KClO3 →2KCl + 3O2 From the…

Q: Fe) + H20)→ Fez04(8) + H 29) | b. How many moles of Fez04 can be produced from 6.0 mol of Fe?

A: The chemical reaction is the representation of the conversion of reactants to products. The two or…

Q: Calculate moles of NaC2H3O2 3H20 (s), then use greaction to calculate AH,reaction for sodium acetat…

Q: Phosphorus pentachloride reacts with water to form hydrochloric acid and phosphoric acid. How many…

A: Given that, phosphorus pentachloride reacts with water to form hydrochloric acid and phosphoric…

Q: In the equation - 2 HgOs) --> 2 Hg + O2le) How many moles of HgO are needed to produce 2 moles of…

Q: Reaction: 2NaOH(s)+CO2(g)→Na2CO3(s)+H2O(l) Which reagent is the limiting reactant when 2.62 mol…

A: Balanced chemical reaction: 2NaOH(s)+CO2(g) → Na2CO3(s)+H2O(l)Given:Number moles of NaOH =…

Q: P4O10 + KOH → K3PO4 + H2O is balanced, how much KOH is required to react with 3 moles of P4O10?

Q: 10.0 g H2O reacts with 4.5 g Na to produce NaOH and H2. What is its balanced equation

A: Given, Given mass of one reactant, H2O = 10.0 g Mass of second reactant, Na = 4.5 g Products…

Q: X

A: Here we are calculating mole by using stoichiometry

Q: When aluminum is placed in concentrated hydrochloric acid, hydrogen gas is produced. 2A1(s) +…

A: Ans is b

Q: 3. Balance the equation below then use it to answer the following questions. a. Balance the…

A: a) In the Balance chemical equation, the no of elements of each type on reactant and product side…

Q: 1. Given the equation for the combustion of isopropyl alcohol 2 C3H7OH +9 02 6 CO2 +8 H2O Set up the…

Q: S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2 H₂O In the above equation how many moles of water can be made when…

A: The given balanced chemical equation is S + 6 HNO3 → H2SO4 + 6 NO2 + 2 H2O The number of moles water…

Q: 1. Na + H2O → NaOH + H2 a). Balance the equation. b). How many moles of sodium are required to…

A: The balanced equation can be defined as the chemical equation where the number of each atom is the…

Q: Given the following equation: 2 NaClO3 ---> 2 NaCl + 3 O2 12.00 moles of NaClO3 will produce how…

Q: ccording to the following reaction, how many moles of hydrofluoric acid will be formed upon the…

A: Interpretation: According to the following reaction, the amount of moles of hydrofluoric acid formed…

Q: How many moles of N2O4 can be formed from 8.50 g NO2? 2NO2 -----> N2O4

Q: _HCI + Ma(OH)2 →_MgCl2 + _H2O a. What is the balance chemical equation of the reaction? b. How many…

Q: S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2H₂O In the above equation how many moles of H₂SO4 can be made when…

A: given, moles of HNO3 = 46 moles

Q: If 5.0 mol of both hydrochloric acid and sodium sulfide are mixed and reacted according to the…

A: The balanced chemical equation for the reaction between HCl and Na2S is shown below.

Q: What are the coefficients when the following equation is properly balanced? 2H6S + O2 --> CO2 + SO2…

A: What are the coefficients of the given reaction--

Q: 2. Fe(OH)3-Fe;0g + H,O Balanced Equation: Reaction Type: Molar Masses Fe(OH) Fe,O, H20 In this…

Q: For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O how many moles of sodium sulfate (Na2SO4) are…

A: The balanced reaction taking place is given as, => 2 NaOH + H2SO4 ------> Na2SO4 + 2 H2O

Q: Given the reaction: Fe^3+ + SCN^- --> FeSCN^2+. How many moles of SCN are there?

Q: how many moles of Ca3(PO4)2will be formed if 8.0 mole of each reactant is present?…

Q: Magnesium Oxide reacts with Sodium Chloride to produce Sodium Oxide and Magnesium Chloride. Balance…

A: Balance equation MgO + 2 Nacl = Na2O + MgCl2

Q: Balance the reaction shown below: H2CO3+NaOH→Na2CO3+H2OH2CO3+NaOH→Na2CO3+H2O Once balanced,…

A: The given reaction is: H2CO3+NaOH→Na2CO3+H2O Balancing the atoms on both sides:…

Q: moles of sodium sulfate

Q: DEET, C12H17NO, is the active ingredient in many insect repellents. If you want to produce 50.0 mg…

Q: - Hydrogen chloride can be made in the laboratory by the reaction of sodium chloride and sulfuric…

A: Since you have posted multiple questions, we are entitled to answer the first only. 4) The reaction…

Q: When the following equation is balanced, the coefficient of Na is __________. Na(s) + H2O(l) →…

A: A balanced equation is that which possesses the same number of substances on either side of the…

Q: Fe + H20)→ Fez04(s) + H ²(ø) a. How many moles of Fe would be required to react with 2.0 mol of H20?

A: The species that react in a reaction undergo effective collisions to bring out a chemical reaction.…

Q: If 62.3 g of aspirin (CsHsO4) are produced from 79.8 g of C÷HO3, what is the percent yield from the…

Q: using the balanced equation in #1,covert the moles of NaOH into moles of H2SO4, that were in you…

A: Neutralization reaction is the reaction between acid and base to produce salt and water. Hence the…

Q: Consider the reaction below. Calculate how much H2O (l), in grams, can be produced if 2.5 moles of…

A: The balanced reaction taking place is given as, => 2 H2 (g) + O2 (g) --------> 2 H2O (l)…

Q: a) 2 C₂H₆ + 7 O₂ --> 4 CO₂ + 6 H₂O Using the balanced chemical equation above, what mass of…

A: Avogadro's number states that the number of atoms, molecules or particles present in one mole of a…

Q: The first step in the reaction of Alka–Seltzer with stomach acid consists of one mole of sodium…

A: Chemical reaction between NaHCO3 and HCl is given by:

Q: How many grams of KBr, 119.0 g/mol, are required to prepare 0.552 moles of Br2 according to the…

A: The balanced reaction is given as, KBrO3 + 5 KBr + 6 HNO3 → 6 KNO3 + 3 Br2 + 3 H2O

Q: According to the following balanced reaction, how many moles of nitric acid are formed from 8.44…

A: GIVEN REACTION: 3 NO2 (g) + H2O (l) -------------->2 HNO3 (aq) + NO (g) To Determine: Moles of…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Find moles H2SO4 and moles of NaOH using the balanced eqaution

H2SO4 + 2NaOH = Na2SO4 + 2H2O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Conclusion

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
For the chemical reaction Sb2S3+6HCl2SbCl3+3H2S write the conversion factor that would be needed to do each of the following one-step conversions. a. Moles of SbCl3 to moles of H2S b. Moles of Sb2S3 to moles of HCl c. Moles of H2S to moles of HCl d. Moles of Sb2S3 to moles of SbCl3
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Using the equation below, find how many moles of AlF3 can be produced from 1.78 moles of HF. Round to the nearest 0.01 and include units and substance in your answer. 3 HF + Al(OH)3 --> AlF3 + 3 H2O
MgCl2 (aq) + K2SO4 (aq) --> 2KCl (aq) + MgSO4 (s) How many moles of potassium chloride are produced from 7.9 moles of magnesium chloride?
Consider the reaction: 2S+3O2=2SO3 1. How many moles of S is needed to form 2 moles of SO3? 2. How many moles of O2 are needed to give 4 moles of SO3?
The balanced equation for the reaction of HBr and NaOH is given: H2SO4 + 2NaOH = Na2SO4 + 2H2O Based on this equation, how many moles of NaOH react with 1 mole of H2SO4?
starting with the equation, KOH(s)+CO2(g)=K2CO3(S)+H2O(L) Calculate the mas in grams of KOH that will be required to produce 285 grams of K2CO3
How many moles of H2O are needed to produce 55.7 g of H2?Round to the nearest hundredth
2KCl2 ? 2KCl + 3O2 How many moles of oxygen gas could be produced from 5.0 moles of KClO3 using the reaction above?
A chemist requires 0.471 mol Na2CO30.471 mol Na2CO3 for a reaction. How many grams does this correspond to?
3. For the unbalanced equation: Mg3N2 + H2O----------->Mg(OH)2 + NH3How many moles of Mg(OH)2 are formed from 125g of H2O? A) 2.5 moles of Mg(OH)2 B) 1.25 moles of Mg(OH)2 C) 6.94 moles of Mg(OH)2 D) 3.47 moles of Mg(OH)2 E) None of the above.