Fe(s) + H20)Fe;04(5) + H ² 9)b. How many moles of Fez04 can be produced from 6.0 mol of Fe?

The chemical reaction is the representation of the conversion of reactants to products. The two or…

Answered: Fe) + H20)→ Fez04(8) + H 29) | b. How…

Science

Chemistry

Fe) + H20)→ Fez04(8) + H 29) | b. How many moles of Fez04 can be produced from 6.0 mol of Fe?

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter3: Chemical Reactions

Section3.9: Classifying Reactions In Aqueous Solution

Problem 1.2ACP

See similar textbooks

Related questions

Q: A 13.2010g sample of hydrated zinc sulfate, ZnSO4 • xH2O), was strongly heated until no further…

A: Given that, Mass of hydrated zinc sulfate, ZnSO4 • xH2O = 13.2010 g The final mass of solid…

Q: 8 Calculate the number of moles, and molecules in: a) 10 g water b) 10 g ethanol C,H,0 c) 10 g of…

A: Molar mass of water : 18gmol-1 (I) number of moles = ( mass / molar mass of water ) number of…

Q: iving the mole to mole ratio for converting from moles of nickel (II) nitrate hexahydrate to moles…

A: 3 Ni(NO3)2•6H2O (s) + 2 Na3PO4 (aq) --> Ni3(PO4)2 (s) + 6 NaNO3 (aq)

Q: Consider the following balanced reaction: 2C4H10+ 1302 If 0.237 mol C4H10 and 1.65 mol O2 are…

Q: Most of the commercial HCI is prepared by heating Nacl with concentrated H,SO.. How many pounds of…

A: Balanced equation of the reaction 2NaCl + H2SO4 ------> 2HCl + Na2SO4…

Q: Silver is often extracted from ores such as K[Ag(CN)2] and then recovered by the reaction 2K [Ag(CN)…

Q: 3) Consider the following reaction. How many moles of oxygen are required to produce 2.33 moles of…

Q: 24.Using the same balanced reaction FeO2 + 2H3O+ ---> FeO + 2H2O If I start with 30.g of H3O+ how…

Q: A student carries out the following reaction: 2 Fe (s) + 3 S (g) → Fe,S3 (s). The student determines…

A: yes you right my ans also same

Q: For the following reaction: N2(g) + H2(g) -------> NH3(g) Balanced = N2+ 3H2---->2NH3…

A: Given, Mass of N2 = 8.50g

Q: How many moles of ammonia can be made by reacting 5.0 mol of N2 with 4.0 mol of H2? N2(g) + 3 H2(g)…

Q: For the chemical reaction 2KI+Pb(NO3)2---->PbI2+2KNO3 how many moles of lead (ii) iodide (PbI2)…

A: Given, 2.0 mol of potassium iodide (KI)

Q: Determine the number of moles and the mass requested for each reaction in the image.

Q: A)What mass of ammonia gass can be produced from a reaction between 565.0g H2 and 880.0g of N2…

Q: How many moles of Al are necessary to form 83.2 g of AIBr3 from this reaction: 2 Al(s) + 3 Br2(1) →…

Q: (SHOW CALCULATIONS) What mass of Al(s) can be formed from 20.0 g of Al2O3(s) and 50.0 g of C(s) by…

Q: What is the weight of nitric acid in 12.5N HNO3 solution? Use the following atomic weights H - 1…

Q: The following reaction is known as the Haber Process. It is commonly used to make ammonia (NH3) for…

Q: How many moles of Al are necessary to form 86.0 g of AIBrs from this reaction: 2 Al(s) + 3 Br2(1) 2…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: How many g of 02 (32 g/mol) are needed to produce 40 g of water (18.02 g/mol) ? 2 C,H6 + 7 02 → 4…

Q: A reaction mixture is prepared containing 1.20g of Al and 0.80 g of MnO2. After the reaction is…

A: Answer: 1.5 g of Al2O3 is produced, according to law of conservation of mass.

Q: Mass of dibenzalacetone= 2.698g Mass of Benzaldehyde = 2.98g moles of dibenzalacetone…

Q: Determine the amount of carbon dioxide (MW = 44 g/mol) produced in grams when 1,000 g of heptane (MW…

A: Mass of Heptane = 1000g Mass of oxygen = 550 g

Q: Glucose (C6H12O6) reacts with excess oxygen to produce 150 g water. ?^?KE?^ + ?E → ??E + ?E? a)…

A: Glucose reacts with water to produce carbon dioxide and water as per the reaction C6H12O6 + O2…

Q: 19) 1 FeCl2(aq) + 2 KOH(aq) 1 Fe(OH)2(s) + 2 KCI(aq) How many moles of KOH will react with 86.2…

A: Since you posted multiple parts so I will be solving the 4 parts by unitary method.

Q: Sucrose (C12H»O11) is combusted in air according to the following reaction: C2H»O1(s) + O:(g) →…

Q: 4. Divide moles of NaCl by moles of starting material a. NaHCO3 X Mol NaCl = X mol ratio X mol…

Q: 1. In the reaction 4HF + Si → SİF4 + 2H2 a. What is the mole ratio of the reactants? b. What is the…

A: The reaction is as follows; 4HF + Si -----------> SiF4 + 2H2 According to the stoichiometry…

Q: How much NH3 can be made from 20.0 g of N2 and 5.0 g of H2?

A: Balanced equation is, N2(g) + 3H2-> 2NH3(g) Number of moles of N2 = Mass in gram / Molar mass…

Q: C6H12O6 + 6 O2 --> 6 CO2 + 6 H2O 180 g/mol 32 g/mol 44 g/mol 18 g/mol How…

A: Given: C6H12O6+6O2→ 6CO2+6H2O Molar mass⇒180g/mol 32 g/mol Mass⇒360g

Q: How many moles of water are made from complete reaction of 4.3 moles of oxygen gas with hydrogen gas…

A: Given reaction: 2H2 + O2 → 2H2O We have to calculate the number of moles of water that will be…

Q: How many g of H2O can be formed from 8.50 g CH4?

A: Given :- mass of CH4 = 8.50 g To calculate :- mass of H2O formed (in grams)

Q: A 13.2010g sample of hydrated zinc sulfate, ZnSO4 • xH2O), was strongly heated until no further…

Q: tion: CH4 + 4CI2 --> CCI4 + 4HCI How many moles of CCI4 is formed by the reaction of 4.5 moles of…

A: The question is based on the concept of reaction Stoichiometry. we have to calculate number of moles…

Q: 3 Ni(NO3)2•6H2O (s) + 2 Na3PO4 (aq) --> Ni3(PO4)2 (s) + 6 NaNO3 (aq) If 5.226 g…

Q: Using the balanced equation, 3 H 2( g) + N 2( g)-------> 2 NH 3( g), calculate the number of…

A: Given information: Moles of hydrogen = 5.0 moles Moles of nitrogen = 3.0 moles

Q: 3 Ni(NO3)2•6H2O (s) + 2 Na3PO4 (aq) --> Ni3(PO4)2 (s) + 6 NaNO3 (aq) If 5.226 g…

A: Answer :- 1) The mole to mole ratio for converting moles of nickel (II) nitrate hexahydrate to…

Q: 1. Consider this reaction: P4 + 6 Cl2 -→ 4 PCI3 (a) How many moles of PCI3 can be made from 16.5 mol…

A: The relation between the mass of the substance in gram and the molar mass of the substance in g/mol…

Q: Zn + CuCl2 ZnCl, + Cu How many moles of ZnCl, will be produced from 23.0g of Zn?

A: Ans

Q: 3. Answer the following questions based on the combustion of hexane: a. Write and balance the…

A: Combustion of hexane will produce CO2 and H2O

Q: Consider this reaction: 6Li(s) +N2(g) ---> 2Li3N(s) If the reaction is known to have an actual…

A: The given reaction is:

Q: Fe + H20)→ Fez04(s) + H ²(ø) a. How many moles of Fe would be required to react with 2.0 mol of H20?

A: The species that react in a reaction undergo effective collisions to bring out a chemical reaction.…

Q: Aspirin (C9H8O4) is produced commercially by reacting salicylic acid (C7H603) with acetic anhydride…

Q: How many moles of H2O can be formed from 3.74 x 10^23 molecules of NH3 from 4 NH3(g)+5 O2(g)—> 4…

Q: 4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) H = -1652 kJ How many moles of Fe2O3 are produced by 16.0 g of…

Q: A sample of sodium carbonate, Na2CO3. weighs 11.0 g. Calculate the following quantities. (a) moles…

A: The moles of the substance can be expressed as the ratio of the mass of the substance to the formula…

Q: 2 KMNO, + 16 HCI → 2 KCI + 2 MnCl, + 8 H,0 + 5 Cl, a. How many grams of KMNO, are needed to produce…

A: First of all, we will calculate the masses of reactants from their molar masses in the balanced…

Q: NaPb+CH 3 CH 2 Cl (CH 3 CH 2 ) 4 Pb+NaCl+Pb What mass of NaPb is required to make 500kg of (CH 3 CH…

A: NaPb reacts with ethyl chloride to form tetraethyl lead. The equation for the balanced chemical…

Q: For the following chemical reaction, how many moles of sodium sulfate (Na2SO4) will be produced from…

Q: Give the theoretical yield, in moles, of CO2 from the reaction of 4.00 moles of C8H18 with 4.00…

A: We have to calculate the theoretical yield of CO2 from the reaction of 4.00 moles of C8H18 with 4.00…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Fe(s) + H20)
Fe;04(5) + H ² 9)
b. How many moles of Fez04 can be produced from 6.0 mol of Fe?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A sample of an organic compound (a nonelectrolyte) weighing 1.35 g lowered the freezing point of 10.0 of benzene by 3.66 C. Calculate the molar mass of the compound.
Calculate the mass in grams of 3.839 moles of (a) hydrazine, a rocket propellant. (b) caffeine, C4H5N2O. (c) theobromine, C7H8N4O2, the alkaloid present in chocolate and cocoa.
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
What amount (moles) of compound is present in 1.00 g of each of the compounds in Exercise 51?
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If this reaction has a 37% yield under certain conditions, what mass of CH4 is required to produce 15 g of H2?
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
4.61 What is actually measured by the octane ratings of different grades of gasoline?
What is the limiting reactant in a reaction that produces sodium chloride from 8 g of sodium and 8 g of diatomic chlorine?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
What amount (moles) of compound is present in 1.00 g of each of the compounds in Exercise 52?