For a certain chemical reaction, the standard Gibbs free energy of reaction at 25.0 °C is 95.6 kJ. Calculate the equilibrium constant K for this reaction. Round your answer to 2 significant digits. K = ||

For a certain chemical reaction, the standard Gibbs free energy of reaction at 25.0 °C is 95.6 kJ. Calculate the equilibrium constant K for this reaction. Round your answer to 2 significant digits. K = ||

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 16P

See similar textbooks

Related questions

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is - 89.9 kJ. Calculate…

A: Given- ΔG=-89.9KJ=-89.9×103J=-89900J K=2.0×1016

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 5.00 °C is 109. kJ.…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is 139. kJ. Calculate…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 3 B(g) = C(g) + 3 D(g) were…

A: Given-> 3A(g) + 3B(g) ----> C(g) + 3D(g) PA= 5.75atm PB= 4.26 atm PC= 5.63 atm PD= 4.88 atm T=…

Q: Use data from Appendix IIB to calculate the equilibrium constants at 25 °C for each reaction. ΔG°f…

A: Since appendix II B is not provided, so considering the standard data: ∆G˚(NO2) = 51.3 kJ/mol…

Q: What is the change in 'molar' gibbs free energy? Could you give me an example of the calculation…

A: The change in Gibbs free energy of the system can be expressed in the term of change in enthalpy and…

Q: State the relationship between the equilibrium constant, Kp , and the standard Gibbs free energy.

A: Interpretation - To state the relationship between the equilibrium constant, Kp , and the standard…

Q: Consider the oxidation of a generic metal M into a metal oxide as shown in the reaction. 3 M(s) +…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 3 B(g) = C(g) + 3 D(g) were…

A: We will. Calculate∆G°

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 2 B(g) = C(g) + 2 D(g) were…

A: In order to solve this question, we will use law of mass action to find the equilibrium constant at…

Q: Which one of the following is not equal to zero? A. Standard molar entropy of a perfect crystal…

A: Standard enthalpy of formation of elements and the compounds in their standard state is zero.

Q: For a certain chemical reaction, the equilibrium constant K = ×1.410−6 at 10.0 °C .…

A: Given :- equilibrium constant (K) = 1.4 × 10-6 temperature (T) = 10.0 °C To be calculated :-…

Q: At 25 'C, the equilibrium partial pressures for the reaction 3 A(g) +4 B(g) 2 C(g) +2 D(g) were…

A: Equilibrium constant : K = PC2×PD2PA3×PB4 K = 5.672×5.6525.433×4.224 K = 0.0202 Standard Gibb's…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 2 B(g) = C(g) + 2 D(g) were…

Q: For the chemical reaction O3(g) + OH(g) → 2 O2(g) + H(g), DrGq = 5.8 kJ/mol at 298 K, 0 J/mol at…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 15.0°C is −143. kJ.…

A: The relationship between standard Gibbs free energy change and equilibrium constant is given by…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -83.0 kJ. Calculate…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 5.00 °C is −132. kJ.…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -104. kJ. Calculate…

Q: For a certain chemical reaction, the equilibrium constant K = 2.8 × 10° at 25.0 °C. Calculate the…

A: Answer:- This question is answered by using the simple concept of calculation od standard Gibbs free…

Q: Consider the (endothermic) thermal decomposition of calcium carbonate: CaCO3(?) → CaO(?) + CO2(?).…

A: Given, Thermal decomposition of calcium carbonate. CaCO3(s)⇌CaO(s)+CO2 (g) It is an example of…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 10.0 °C is 137. kJ.…

Q: For a certain chemical reaction, the equilibrium constant K = 2.2 x 10" at 5.00 °C. Calculate the…

A: The answer is given as follows -23 kJ is answer

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -148. kJ. Calculate…

A: Given that, the standard Gibb's free energy (∆Go) of the reaction - 148 kJ and the equilibrium…

Q: At 25 °C, the equilibrium partial pressures for the reaction A(g) + 2 B(g) = C(g)+D(g) were found to…

A: Given, A(g) + 2B(g) ⇌ C(g) + D(g) Equilibrium partial pressure for all the above species: PA = 4.22…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is 83.7 kJ. Calculate…

Q: At 25 °C, the equilibrium partial pressures for the reaction 2 A(g) + 4 B(g) =2C(g)+D(g) were found…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 5.00 °C is -63.8 kJ.…

Q: For a certain chemical reaction, the equilibrium constant K = 1.6× 10 at 25.0 °C. Calculate the…

Q: What is the application of standard Gibbs free-energy to processes and reactions What is its…

A: Thermodynamics is the branch of chemistry which deals with the study of heat and other forms of…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 15.0 °C is 128. kJ.…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 4 B(g)=2C(g) + 3 D(g) were…

A: Equilibrium constant in terms of pressure is defined as the product of partial pressures of products…

Q: What is the standard enthalpy (in kJ/mol) of a reaction for which the equilibrium constant increased…

A: The relationship between equilibrium constant ( K ) , temperature ( T ) and standard enthalpy ( ∆H…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 4 B(g)=2C(g) + 3 D(g) were…

A: The question is based on the concept chemical thermodynamics. We have been given partial pressure…

Q: Calculate the equilibrium constant for the following reaction at 25o C, given that change in…

A: Given:The free energy change is 163.4 kJ/mol.Temperature = 250C = 25 + 273 K = 298 K.

Q: Place the following in order of increasing molar entropy at 298 K. CO2 C3H8 SO

A: A thermodynamic state property which measures the degree of disorderness or randomness of the…

Q: Consider the following reaction at 25 °C: 3 NiO(s) + 2 NH (g) →3 Ni(s) + N,(g) + 3 H,O(g) K If AH° =…

Q: Why is a reaction with a negative Gibbs free energy, AG, spontaneous? Explain.

Q: For a certain chemical reaction, the equilibrium constant K = 2.2 × 10 °at 25.0 °C. Calculate the…

A: Please have a look on the solution:

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 5.00 °C is 142. kJ.…

A: The free energy change of the reaction is = 142 kJ/mol The temperature of the reaction is = 5.00oC =…

Q: What is the chemical significance of a positive Gibbs free energy change and what is the chemical…

A: The amount of energy available for doing some useful work is termed as free energy or Gibbs free…

Q: Question attached

A: Gibbs Free Energy: It is a property of thermodynamics which can be used to determining the direction…

Q: For a certain chemical reaction, the equilibrium constant K = 2.7 x 10¹0 at 5.00 °C. Calculate the…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 30.0°C is 73.3 kJ.…

A: To solve this problem we will use the given formula to calculate the equilibrium constant as given…

Q: The standard Gibbs free energy (∆G°rxn) for the formation of sulfur trioxide from sulfur dioxide and…

A: Given reaction: SO2 (g) + ½ O2 (g) → SO3 (g) The standard Gibbs free energy (∆G°rxn) for the…

Q: Given the values of AH, ASa, and T, determine ASuniy and predict whether or not each reaction is…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 3 B(g) = C(g) + 3 D(g) were…

Q: In order to be a spontaneous reaction, what has to be true about Gibbs Free Energy?

A: Gibbs free energy of any reaction is defined as the maximum amount of reversible work that may be…

Q: Calculate the standard change in Gibbs free energy, AG;an , for the given reaction at 25.0 °C.…

A: a) Given: The reaction, NH4Cl(s)⇌NH4+(aq)+Cl-(aq) Temperature, T=25°C=298 K

Q: a certain chemical reaction, the standard Gibbs free energy of reaction is -133. kJ. Calculate the…

A: Gibbs Free Energy : For a general reaction given below : A + B ⇌ C + D Let;s say the equilibrium…

Question

For a certain chemical reaction, the standard Gibbs free energy of reaction at 25.0 °C is 95.6 kJ. Calculate the equilibrium
constant K for this reaction.
Round your answer to 2 significant digits.
K = ||
国
Explanation
Check
O 2021 McGraw Hill Education. All Rights Reserved Terms of Use Privacy Accenibility
APR
30
MacBook Air

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The free energy change, G, for a process at constant temperature and pressure is related to Suniv and reflects the spontaneity of the process. How is G related to Suniv? When is a process spontaneous? Nonspontaneous? At equilibrium? G is a composite term composed of H, T, and S. What is the G equation? Give the four possible sign combinations for H and S. What temperatures are required for each sign combination to yield a spontaneous process? If G is positive, what does it say about the reverse process? How does the G = H TS equation reduce when at the melting-point temperature of a solid-to-liquid phase change or at the boiling-point temperature of a liquid-to-gas phase change? What is the sign of G for the solid-to-liquid phase change at temperatures above the freezing point? What is the sign of G for the liquid-to-gas phase change at temperatures below the boiling point?
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
Quartz, SiO2(s), does not spontaneously decompose to siliconand oxygen at 25°C, 1.0 atm in the reaction SiO2(s)Si(s)+O2(g) even though the standard entropy change of the reactionis large and positive (S=+182.02JK1). Explain.
Given that H f for HF(aq) is -320.1 kJ/mol and S for HF(aq) is 88.7 J/mol K, find Ka for HF at 25C.
In a spontaneous process, S(universe) is (a) 0 (b) = 0 (c) 0
Explain why absolute entropies can be measured.
The decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Calculate S for the dissolution of magnesium chloride: MgCl2(s)Mg2+(aq)+2Cl(aq) . Use your understanding of the solvation of ions at the molecular level to explain the sign of S .
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
Hydrogen sulfide can be removed from natural gas by the reaction 2H2S(g)+SO2(g)3S(s)+2H2O(g) Calculate G and K (at 298 K) for this reaction. Would this reaction be favored at a high or low temperature?