Gaseous butane (CH,(CH,) CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H,0). What is the'2theoretical yield of carbon dioxide formed from the reaction of 1.2 g of butane and 1.1 g of oxygen gas?Round your answer to 2 significant figures.gx10

Answered: Image /qna-images/answer/4e375d8a-171d-4ed2-afc0-b133179ea983.jpg

Gaseous butane (CH3(CH2),CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). What is the theoretical yield of carbon dioxide formed from the reaction of 1.2 g of butane and 1.1 g of oxygen gas? Round your answer to 2 significant figures.

Gaseous butane (CH3(CH2),CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). What is the theoretical yield of carbon dioxide formed from the reaction of 1.2 g of butane and 1.1 g of oxygen gas? Round your answer to 2 significant figures.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 114E: a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and...

See similar textbooks

Related questions

Q: Gaseous butane (CH, (CH,),CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Butane given mass of butane = 54.6 g molar mass of butane = 58.12 g/mole number of moles of…

Q: Liquid hexane (CH;(CH,),CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Liquid hexane (CH, (CH,),CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2)…

A: Given, Mass of methane gas = 10.1 g Mass of oxygen gas = 68.9 g Required, Theoretical yield of…

Q: Gaseous butane (CH,(CH,),CH3) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH3(CH2),CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given, Liquid hexane (C6H14) react with gaseous oxygen (O2) to produce gaseous carbon dioxide (CO2)…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2)…

A: Methane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: Liquid octane (CH, (CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

A: We have to calculate the mass of water formed.

Q: Gaseous methane (CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dióxide (CO,) and…

A: The reaction can be completed as: CH4 + 2O2 → CO2 + 2H2O 1 mol 2…

Q: Liquid octane (CH;(CH,) CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Given: mass of octane=10.3 gmass of oxygen=69.8 g To find: Theoretical yield of water

Q: Methanol has tremendous potential to be used as an alternate fuel. Carbon monoxide gas reacted with…

Q: Gaseous butane (CH3(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: The molecular formula of butane is C4H10. Hence the combustion reaction for butane can be written as…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Gaseous ethane (CH;CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Given reaction is between ethane gas and oxygen gas. The products formed during this reaction are:…

Q: Gaseous ethane (CH,CH; ) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,…

A: The balanced chemical equation for the reaction of Ethane ( CH3CH3 ) and gaseous oxygen gas ( O2)…

Q: Liquid hexane (CH3(CH,) CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Mass of hexane = 3.45 g Molar mass of hexane = 86.18 g.mol - Mass of O2 = 10.6 g Molar mass of…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO, and…

Q: Gaseous ethane (CH,CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: In a chemical reaction, two or more reactants react with each other to form a new substances. This…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Limiting reagent is the reactant molecule that is consumed first in the reaction and therefore…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Liquid octane (CH,(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: CH3(CH2)6CH3 +(50/2) O2 ----------> 8CO2+9H2O Complete combustion of hydrocarbon leads to the…

Q: Gaseous methane (CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and…

A: Theoretical yield is a measure of the number of moles of a product formed in relation to the…

Q: 2/5 Liquid hexane (CH3(CH2)¸CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Given, Mass of HCl = 1.8 g Mass of NaOH = 3.0 g What is the theoretical yield of NaCl when NaOH…

Q: Liquid octane (CH;(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given, Chemical reaction equation is: CH3(CH2)6CH3 + O2 ----> CO2 + H2O Now, Balanced…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: The balanced chemical reaction of ethane and oxygen is as follows: The stoichiometry of the…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (Co,)…

A: Given data of the compounds, mass of methane= 0.96 g, molar mass = 16 g mol-1 mass of oxygen= 5.5…

Q: Gaseous butane (CH, (CH,) CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH,(CH2)¸CH,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). What…

Q: Theoretical yield of chemical reactions Liquid hexane (CH(CH,) CH, reacts with gaseous oxygen gas…

A: Given Mass of hexane = 1.7 g Mass of oxygen = 3.5 g

Q: Gaseous butane (CH3(CH,) CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given: Combustion reaction of butane i.e. C4H10 Mass of C4H10 taken = 1.7 g. Mass of O2 taken = 9.9…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas to produce gaseous carbon dioxide (Co,) and…

A: Mass of ethane = 24.7 g Mass of oxygen gas = 80.8 g Theoretical yield of water (in g) = ?

Q: Gaseous butane (CH;(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Liquid octane (CH(CH, CH, reacts with gaseous oxygen gas (0, to produce gaseous carbon dioxide (CO,…

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2)…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: CH4 (g) + 2O2 (g) -----> CO2 (g) + 2H2O (g) One mole of…

Q: (CH(CH,),CH:) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and…

A: Firstly limiting Reagent will be calculated because moles of water formation will be depend upon…

Q: Gaseous methane (CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (Co,) and…

Q: Liquid octane (CH3(CH,) CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Consider the balanced reaction of octane with gaseous oxygen gas as follows; To determine the…

Q: Gaseous butane (CH;(CH2) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Butane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: Gaseous ethane (CH;CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO)…

A: In Balanced chemical equation number of atoms of each species are equal on both reactant and…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (Co,)…

A: The complete balanced Chemical Reaction between Methane and oxygen can be written as - CH4 + 2O2…

Q: Gaseous ethane (CH CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Gaseous butane (CH,(CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Theoretical yield is the quantity of a product obtained from the complete conversion of the limiting…

Q: Liquid hexane (CH3(CH2)¸CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH3 (CH,)¸CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: The molecular formula of the compound being combusted is C6H14. Hence the combustion reaction can be…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (O,) to produce gaseous carbon dioxide (CO,)…

A: The theoretical yield of carbon dioxide during the combustion of ethane (CH3-CH3) in the presence of…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

Gaseous butane (CH,(CH,) CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H,0). What is the
'2
theoretical yield of carbon dioxide formed from the reaction of 1.2 g of butane and 1.1 g of oxygen gas?
Round your answer to 2 significant figures.
g
x10

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
About 5 billion kilograms of benzene, C6H6, are made each year. Benzene is used as a starting material for many other compounds and as a solvent (although it is also a carcinogen, and its use is restricted). One compound that can be made from benzene is cyclohexane, C6H12. C6H6() + 3 H2(g) C6H12() rH = 206.7 kJ/mol-rxn; rS = 361.5 J/K mol-rxn Is this reaction predicted to be product-favored at equilibrium at 25 C? Is the reaction enthalpy- or entropy-driven?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
Gaseous ethane (CH3CH3) reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. What is the theoretical yield of carbon dioxide formed from the reaction of 1.5g of ethane and 2.5g of oxygen gas? Round your answer to 2 significant figures.
Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. What is the theoretical yield of water formed from the reaction of 2.10g of ethane and 15.1g of oxygen gas? Be sure your answer has the correct number of significant digits in it. I keep getting this problem wrong because of the sig. digits, dont round till the end because if it is off by 0.1, it will be incorrect.
Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium sulfate Na2SO4 and liquid water H2O . What is the theoretical yield of water formed from the reaction of 2.0g of sulfuric acid and 2.3g of sodium hydroxide? Round your answer to 2 significant figures.
Gaseous ethane (CH3CH3) reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. What is the theoretical yield of carbon dioxide formed from the reaction of 19.5g of ethane and 26.9g of oxygen gas? Be sure your answer has the correct number of significant digits in it.
Liquid octane (CH3CH26CH3) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). What is the theoretical yield of water formed from the reaction of 8.00g of octane and 11.5g of oxygen gas? Round your answer to 3 significant figures.
Aqueous sulfuric acid (H2SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium sulfate (Na2SO4) and liquid water (H2O). What is the theoretical yield of water formed from the reaction of 35.3g of sulfuric acid and 56.2g of sodium hydroxide?Round your answer to 3 significant figures.