Liquid hexane (CH3(CH2)¸CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2) and gaseous water (H,O). What is the theoretical yield of water formed from the reaction of 6.89 g of hexane and 45.7 g of oxygen gas? Round your answer to 3 significant figures.

Liquid hexane (CH3(CH2)¸CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2) and gaseous water (H,O). What is the theoretical yield of water formed from the reaction of 6.89 g of hexane and 45.7 g of oxygen gas? Round your answer to 3 significant figures.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 114E: a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and...

See similar textbooks

Related questions

Q: (CH3(CH),CH,) Liquid octane reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH;(CH,),CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Liquid hexane (CH, (CH,),CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2)…

A: Given, Mass of methane gas = 10.1 g Mass of oxygen gas = 68.9 g Required, Theoretical yield of…

Q: Liquid hexane (CH3(CH,) CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

Q: Liquid octane (CH;(CH,) CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide…

A: The combustion reaction of octane i.e CH3(CH2)6CH3 can be written as, => CH3(CH2)6CH3 + O2…

Q: Iron(III) oxide is reacted with ammonia to produce solid iron, gaseous nitrogen, and water. 1…

A: Consider the given reaction is as follows; Given information is as follows;

Q: Ammonia NH3 chemically reacts with oxygen gas O2 to produce nitric oxide NO and water H2O .…

Q: Gaseous butane (CH,(CH,),CH3) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide…

Q: Gaseous methane (CH) reacts with gaseous oxygen gas (O to produce gaseous carbon dioxide (CO,) and…

A: This question can be solved using the stoichiometry and Limiting reagent. We will do this question…

Q: Ammonia (NH,) chemically reacts with oxygen gas (0,) to produce nitric oxide (NO) and water (H,0).…

Q: Liquid hexane (CH3(CH2),CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given, Liquid hexane (C6H14) react with gaseous oxygen (O2) to produce gaseous carbon dioxide (CO2)…

Q: Liquid octane (CH;(CH,) CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Given: mass of octane=10.3 gmass of oxygen=69.8 g To find: Theoretical yield of water

Q: Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: We have to calculate mass of NaBr formed.

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: Mass of butane = 33.1 g Mass of O2 = 228 g

Q: Gaseous butane (CH3(CH2),CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH3(CH,) CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Mass of hexane = 3.45 g Molar mass of hexane = 86.18 g.mol - Mass of O2 = 10.6 g Molar mass of…

Q: Combustion reactions are a notable source of carbon dioxide in the environment. Using the following…

A: 100 g of Propane is used. The molar mass of Propane = 44.1 g/mol

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Limiting reagent is the reactant molecule that is consumed first in the reaction and therefore…

Q: Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

A: Given,

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Gaseous butane CH3CH22CH3 will react with gaseous oxygen O2 to produce gaseous carbon dioxide…

Q: Gaseous methane (CH) reacts with gaseous oxygen gas (O,) to produce gaseous carbon dioxide (CO,) and…

Q: Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

A: The explanation is given below-

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NAOH) to produce aqueous sodium…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: The Balanced chemical reaction is NaOH + HCl = NaCl + H2O Thus 1 mol of NaOH reacts with 1 mol…

Q: 2/5 Liquid hexane (CH3(CH2)¸CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon…

Q: Liquid hexane (CH;(CH,)¸CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: The theoretical yield of water formed from the reaction of 17.2 g of hexane and 120 g of oxygen has…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Given, Mass of HCl = 1.8 g Mass of NaOH = 3.0 g What is the theoretical yield of NaCl when NaOH…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: The balanced chemical reaction of ethane and oxygen is as follows: The stoichiometry of the…

Q: Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

A: Moles of ethane and Oxygen are calculated for the given reaction as follows,

Q: Gaseous butane (CH(CH, CH reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: First we have to find out the limiting agent

Q: Gaseous ethane (CH;CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,)…

A: Given that, mass of ethane= 13.2 g, molar mass=30 g mol-1 mass of oxygen=45.8 g, molar mass= 32 g…

Q: Gaseous butane (CH3(CH2)2CH3) reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

A: We have to calculate the theoretical yield of carbon dioxide.

Q: Gaseous butane (CH, (CH,) CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide…

Q: Gaseous butane (CH3(CH,) CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given: Combustion reaction of butane i.e. C4H10 Mass of C4H10 taken = 1.7 g. Mass of O2 taken = 9.9…

Q: Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

A: The reaction for the combustion of methane is as follows: Thus it implies that 1 mole of methane…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Aqueous sulfuric acid (H,SO, reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Chemical Reaction :- H2SO4 + 2NaOH ----> Na2SO4 + 2H2O Given mass of H2SO4 = 73.6 g Given…

Q: Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

A: The balanced chemical reaction between methane and oxygen is shown below.

Q: Gaseous butane (CH,(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Aqueous sulfuric acid (H,SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Sulfuric acid reacts with sodium hydroxide to form sodium sulfate and water. The equation for the…

Q: Ammonia NH3 chemically reacts with oxygen gas O2 to produce nitric oxide NO and water H2O. What mass…

A: Ammonia NH3 chemically reacts with oxygen gas O2 to produce nitric oxide NO and water H2O. The…

Q: Liquid octane (CH3(CH,) CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Consider the balanced reaction of octane with gaseous oxygen gas as follows; To determine the…

Q: Gaseous ethane (CH,CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Ethane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: Gaseous ethane (CH CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Liquid hexane (CH3 (CH,)¸CH;) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: The molecular formula of the compound being combusted is C6H14. Hence the combustion reaction can be…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (O,) to produce gaseous carbon dioxide (CO,)…

A: The theoretical yield of carbon dioxide during the combustion of ethane (CH3-CH3) in the presence of…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Liquid hexane (CH3(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous
4
water (H,O). What is the theoretical yield of water formed from the reaction of 6.89 g of hexane and 45.7 g of oxygen gas?
Round your answer to 3 significant figures.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

You are making cookies and are missing a key ingredienteggs. You have most of the other ingredients needed to make the cookies, except you have only 1.33 cups of butter and no eggs. You note that the recipe calls for two cups of butter and three eggs (plus the other ingredients) to make six dozen cookies. You call a friend and have him bring you some eggs. a. What number of eggs do you need? b. If you use all the butter (and get enough eggs), what number of cookies will you make? Unfortunately, your friend hangs up before you tell him how many eggs you need. When he arrives, he has a surprise for you to save time, he has broken them all in a bowl for you. You ask him how many he brought, and he replies. I cant remember. You weigh the eggs and find that they weigh 62.1 g. Assuming that an average egg weighs 34.21 g. a. What quantity of butter is needed to react with all the eggs? b. What number of cookies can you make? c. Which will you have left over, eggs or butter? d. What quantity is left over?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of water formed from the reaction of 8.62g of hexane and 54.1g of oxygen gas?Be sure your answer has the correct number of significant digits in it.
Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of water formed from the reaction of 51.2g of butane and 139.g of oxygen gas?Be sure your answer has the correct number of significant digits in it.
Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. What is the theoretical yield of water formed from the reaction of 33.1g of butane and 228.g of oxygen gas? Be sure your answer has the correct number of significant digits in it.