Given the following thermochemical equations:C2H2(9 +5 029) → 2C02(9) + H20aAH° = -1229.5 kJAH° = –393.5 kJ%3DnoAH° = 285.5 kJCalculate the enthalpy (in kJ) for this reaction:2Cs) + H2(g) → C2H2«g)

Answered: Image /qna-images/answer/0528b0a3-e84c-4fa9-bcac-bab37ab413f3.jpg

Answered: Given the following thermochemical…

Given the following thermochemical equations: C2H2( +5 02(9) → 2C0219, + H2Oa → CO219) AH° = -1229.5 kJ AH° = -393.5 kJ no + AH° = 285.5 kJ Calculate the enthalpy (in kJ) for this reaction:

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 97E: A substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC...

See similar textbooks

Related questions

Q: Using the following thermochemical equation, determine the amount of heat produced per kg of CO2…

A: Answer:- This question is answered by using the given balanced chemical equation the stoichiometry…

Q: Calcium carbide (CaC2) reacts with water to form acetylene(C2H2) and Ca(OH)2. From the following…

A: Given equation is,

Q: Suppose you burned 1.726 g of benzoic acid, C6H5 CO2H, in a constant volume calorimeter and found…

A: we have to calculate the value of ∆U per mole of benzoic acid

Q: THERMODYNAMICS: Calculate the value of AH (in kJ) for the reaction, AR3 (g) + Q (s) → A2R4 (g) + QR2…

Q: The standard heat of the reaction, C2H4(g) + 2Cl2 (g) --> C2HCl3(l) + H2(g) + HCl(g) is ∆Hr° =…

A: The change in the internal energy of a system is the sum of the heat transferred and the work done.…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: Data given: The molar heat capacity at constant pressure for CO(g), cp = 6.97 cal mol-1 K-1 Mass of…

Q: Find the heat of reaction and explain what happen to it. Calculate the ∆H of reaction for: C3H8 (g)…

A: Solution - C3H8 (g) + 5O2 (g) →→ 3CO2 (g) + 4H2O (l) ∆H∘rxn =∑∆H°f,products-∑∆H°f,reactants…

Q: From the following enthalpy changes, calculate the value of AH° for the reaction N21e) + O21g) > 2…

A: If any coefficient is multiplied to the reaction, then that coefficient should also be multiplied…

Q: THERMODYNAMICS: The combustion of 1.00 mol of glucose (C6H1206) liberates 2820 kJ of heat. If 1.79 g…

A: Given: Heat released due to combustion of 1 mole glucose = 2820 KJ Molar weight of glucose = 180…

Q: The complete combustion of 1.05 g of cinnamaldehyde (C9H8O, one of the compounds in cinnamon) in a…

A: Given information, 1.05 g of cinnamaldehyde Ccalorimeter = 3.60 kJ/°C Increase in…

Q: 11-12. The same quantity of energy is added to 25.0 g pieces of gold (molar heat capacity = 25.41…

A: Given data,Mass of Au=25gMass of Mg=25gMass of…

Q: Octane (C8H18) undergoes combustion according to the following thermochemical equation: 2 C3H18(1) +…

A: Given reaction is : 2C8H18 (l) + 25O2 (g) -------> 16CO2 (g) + 18H2O (l), ΔH0 = -11200 KJ…

Q: Given the following reactions: N2(g) + 2O2(g) → 2NO2(g) ΔH = 66.4 kJ…

Q: 1. Given the following thermochemical equations: Pb + Cl2 → PBC12 ΔΗ -223 kJ PbCl2 + Cl2 → PBC14 AH…

A: Answer: ∆H = 136 KJ

Q: Given the following reactions: N2(g) + 202(g) –→ 2NO2(g) AH = 66.4 kJ NO(g) + ½ O2(g) → NO2(g) AH =…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: What is the heat of combustion of ethane, C2H6, in kilojoules per mole of ethane? Enthalpy of…

A: Heat of combustion of ethane C2H6 : For this first we need the balanced equation for combustion of…

Q: Calculate the change in internal energy (ΔE) for a system that is giving off 25.0 kJ of heat and is…

A: Heat given Q = 25.0 kJ Initial volume Vi = 12.00 L Final volume Vf = 6.00 L Constant pressure P =…

Q: Given the following reactions Fe2O3 (s) + 3CO (s) - 2Fe (s) + 3CO2 (g) AH = -28.0 kJ 3Fe (s) + 4CO2…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: Here Molar mass of CO 12.011g/mol + 15.999g/mol = 28.01g/mol Given mass of CO = 0.59 g Now…

Q: Given the following reactions 2NO → N2 + O2 AH = -180 kJ 2NO + O2 → 2NO2 AH = -112 kJ

A: Solution Given that 2NO N2 + O2 ∆H = -180 kJ 2NO +…

Q: THERMODYNAMICS: Given the following hypothetical thermochemical equations: 2QJ3 (g) + 3Q2X (g) – 4Q2…

Q: Calculate the standard enthalpy (kJ) change of the preparation of nitric acid below: 4NH3(g) + 502g)…

Q: From the following enthalpies of reaction H2(g) + F2(g) – 2HF(g) AH = -537 kJ C(s) + 2 F2(g) →…

Q: For a certain system, q = -850 J and the volume changes from 16.37 L to 370. cm³ at a constant…

A: The given conditions are as follows: Heat energy, q = -850 J Initial volume, V1 = 16.37 L Final…

Q: Write thermochemical equations for the decomposition of one mole of the following compounds into the…

A: The compound given is C2H5OH which is a liquid at 25 oC and 1 atm. The elements present in C2H5OH…

Q: Show the calculation of the heat of reaction (AHrxn) for the reaction: CH4 (g) + 2O₂ (g) → CO₂ (g) +…

Q: Calculate AHrxn for the following reaction: Cr2 O3 (s) + 3CO(g) → 2Cr(s) + 3CO2 (g) Use the…

Q: Given the standard heats of formation for the following compounds, calculate the ΔH° heat of…

A: The enthalpy change of a chemical reaction can be calculated by the standard heat of formation of…

Q: 9. Given the following enthalpy of reactions: (1) C:H«(g) + /½ O:(g) → 2 CO:(g) + 3 H20(1); AH =…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

Q: The heat of combustion of 1-pentanol is -3331 kJ/mol. Given the following information, calculate the…

Q: 1. Why are styrofoam cups often used as improvised calorimeter? What would be the effect on the…

A: We know that, The specific heat capacity of Styrofoam is calculated experimentally as 1.131 J/goC.…

Q: How much heat is produced by combustion of 125 g of methanol under standard state conditions? CH3OH…

A: The standard conditions are partial pressure of all gas at 1 bar of pressure (1 bar=0.987 atm, so…

Q: Calculate AH,° in kJ/mol for hydrogen peroxide, H2(g) + O2(g) → H2O2(), from these thermochemical…

Q: Consider the following thermochemical data: Cl2(g) → 2CI(g) AH° = 242.3 kJ l2(g) → 21(g) AH° = 151.0…

Q: A metal sample weighing 56.7 g at temperature of 98.0°C was placed in 50.0 g of water in a…

Q: The balanced chemical equation for the combustion of 1 mol of ethyne gas, C2H2(g), is: C2H2(g) +…

A: The energy difference between the products and reactants is known as the energy change of a…

Q: Calculate AH for the process: N2(g) + 202(g) → 2NO2(g) from the following information: N28) +O2(g) →…

Q: Benzoic acid is used to determine the heat capacity of bomb calorimeters because it can be obtained…

A: Given that : The energy of combustion (Hcombustion) = -26.43 kJ/g Temperature increase (∆T) =…

Q: Given the following decomposition reaction 2H2O2 (l)---> 2H2O(l) + O2 (g) ΔH = –196.1 kJ A. How…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Fe O3(s) + 3CO(g) → 2Fe(s) + 3CO;g); AH® = -26.8 kJ %3D FeO(s) + CO(g) -Fe(s) + CO2(g); AH° = -16.5…

A: The given equations are Let us number the final equation to be number 3.

Q: Determine the enthalpy of the reaction: 3Fe,O3 (s) + CO (g)→ CO2 (g) + 2Fe;O4 (s), given the…

Q: If ΔHrxn for the thermal decomposition of 2 moles of TNT is –20,306.00 kJ, how much TNT is needed to…

A: Thermochemistry is the study of heat energy changes that are associated with chemical reactions and…

Q: Given the following data: 2NO(g), N2(g) + 2NO(g) + O2 (g) → O2 (g) → 2NO2(g), 2N2O(g) → ΔΗ 180.7 kJ…

A: The answer is given as follows

Q: 48 A 1.45 g sample of acetic acid , HC2H3O2 was burned in excess oxygen in a bomb calorimeter. The…

A: 1.45 g sample of acetic acid was burned in excess oxygen in a bomb calorimeter.Heat capacity of…

Q: Given the thermochemical equations X, + 3 Y, → 2XY; AH| = -370 kJ X, + 2Z, → 2 XZ, AH2 = -180 kJ 2…

Q: Her) is a commonly used acid for adding bromine to organic compounds. As bromine makes for an easily…

A: The enthalpies of the reactions are given . We have to calculate enthalpy for the synthesis of HBr…

Q: Suppose 9.44 g of calcium chloride, CaCl2, (MM=111.0 g/mol) is added to 222. g water at 21.84oC in a…

Q: Given the following combustion reaction and its molar enthalpy of reaction: 2NO(g) + O2(g) 2NO2(g)…

A: Given reaction: 2NO(g) + O2(g) → NO2(g) ΔHo = -112 KJ

Question

Given the following thermochemical equations:
C2H2(9 +5 029) → 2C02(9) + H20a
AH° = -1229.5 kJ
AH° = –393.5 kJ
%3D
no
AH° = 285.5 kJ
Calculate the enthalpy (in kJ) for this reaction:
2Cs) + H2(g) → C2H2«g)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Consider the combustion of propane: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)H=2221KJ Assume that all the heat in Example 7-3 comes from the combustion of propane. What mass of propane must be burned to furnish this amount of energy assuming the heat transfer process is 60.% efficient?
When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
A substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC Hfus 5.0kj/mol C(l) 2.5j/gC bp 75C C(g) 2.5j/gC mp 15C
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
A 5.00-g sample of aluminum pellets (specific heat capacity = 0.89 J/C g) and a 10.00-g sample of iron pellets (specific heat capacity = 0.45 J/C g) are heated to 100.0C. The mixture of hot iron and aluminum is then dropped into 97.3 g water at 22.0C. Calculate the final temperature of the metal and water mixture, assuming no heat loss to the surroundings.