Given the following combustion reaction and its molar enthalpy of reaction: 2NO(g) + O2(g) 2NO2(g) AH° = -112 kJ What is the heat (q) associated with the combustion of 2.00 mole of NO(g)? O -112 kJ O -224 kJ +56.0 kJ -56.0 kJ O +112 kJ

Given the following combustion reaction and its molar enthalpy of reaction: 2NO(g) + O2(g) 2NO2(g) AH° = -112 kJ What is the heat (q) associated with the combustion of 2.00 mole of NO(g)? O -112 kJ O -224 kJ +56.0 kJ -56.0 kJ O +112 kJ

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter5: Principles Of Chemical Reactivity: Energy And Chemical Reactions

Section5.5: Enthalpy Changes For Chemical Reactions

Problem 5.6CYU: The combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written...

See similar textbooks

Related questions

Q: Consider the following reaction: CH, (9) + 20, (9) → CO2(9) + 2H, O(1) AH =-891 kJ a. Calculate the…

A: The balanced reaction taking place is given as, ΔH = -891…

Q: The thermochemical equation for the combustion of methanol is CH₂OH (g) + 3/2 0₂(g) → CO₂(g) + 2 H₂O…

A: To find kJ of heat, convert the given mass of methanol to moles. Then, multiply the obtained moles…

Q: What is the enthalpy change when 0.1 moles of ethanol undergoes complete combustion? The molar…

Q: Calcium hydroxide, which reacts with carbon dioxide to form calcium carbonate, was used by the…

A: Given, moles of CaCO3 formed = 3.8 mol

Q: Given the standard enthalpy changes for the following two reactions (1) 4C(s) + 5H2(g)–C,H10(g) AH°…

A: If the given reaction is multiplied by 2 by two, then value of the given standard enthalpy change…

Q: The thermochemical equation for the combustion of butane is shown below. 2 C 4H 10(g) + 13 O 2(g)…

A: Enthalpy change is a state function. The change in enthalpy of a chemical reaction depends on the…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H2(g) C,H10(g) AH°…

Q: 2. The hydrogenation of coal is a method of producing methane by the following reaction: Ca + 2H2@)…

Q: Octane (C8H18) undergoes combustion according to the following thermochemical equation: 2 C3H18(1) +…

A: Given reaction is : 2C8H18 (l) + 25O2 (g) -------> 16CO2 (g) + 18H2O (l), ΔH0 = -11200 KJ…

Q: Given the following reactions: N2(g) + 202(g) –→ 2NO2(g) AH = 66.4 kJ NO(g) + ½ O2(g) → NO2(g) AH =…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: Given the reaction: 4 Fe(s) +302(g) → 2 Fe,03(s) A H= -1652 kJ, what is the enthalpy change when…

A: Given reaction is 4 Fe(s) + 3 O2(g) ----> 2 Fe2O3(s) ; ∆H = -1652 kJ We need to find the…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H₂(g) →C4H10(g)…

Q: The standard enthalpy change for the following reaction is -104 kJ at 298 K. 3 C(s,graphite) +4…

Q: When 150 mL of 1.00 M NaOH is added to 100 mL of 1.30 M HCl in an insulated calorimeter, the…

A: To calculate the enthalpy change for the neutralization reaction, the following quantities are…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) +…

A: • The required thermochemical equation is, 2C2H4(g)+ H2(g) → C4H10(g) ; ∆H° = ? • The given…

Q: Given the standard enthalpy changes for the following two reactions: ΔΗ° = 9.2 kJ (1) N₂(g) + 2O2(g)…

Q: Determine the enthalpy change for the reaction using the given AH values, X (s) + 6 H₂O (g) --> XO6…

Q: Ammonia reacts with oxygen as follows: 4NH3(g) + 702(g) → 4NO2(g) + 6H20(g) AH° = -1132 kJ Calculate…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: PCI5(s) can be prepared by the reaction PCI3(1) + Cl2(g) - PCI5(s). Calculate the enthalpy change…

Q: Top fuel dragsters and funny cars burn nitromethane as fuel according to the following balanced…

A: Given,Standard enthalpy of combustion = -1,418 kJ.

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H,(g) C,H1o(g) AH°…

A: According to Hess law, the enthalpy change of a reaction is equal to the sum of the enthalpy change…

Q: A bomb calorimetry experiment is performed with xylose, C₅H₁₀O₅ (s), as the combustible substance.…

A: Mass of xylose burned = 2.365 g initial calorimeter temperature = 23.29 degree centigrade final…

Q: Palmitic acid (C16H32O2) is a dietary fat found in beef and butter. The caloric content of palmitic…

A: The combustion of palmitic acid is given as follows: C16H32O2 (s) + 23 O2 (g) → 16 CO2 (g) + 16 H2O…

Q: Given the following reactions 2NO → N₂ + O₂ AH = -180 kJ 2NO+ 0₂ → 2NO2 AH = -112 kJ the enthalpy of…

Q: For the chemical reaction Ca (s) + ½ O2 (g) → CaO (s) AH° = -635 kJ/mol. What is the enthalpy (in…

A: Heat of reaction is defined as difference of energy of product and energy of Reactant. If heat of…

Q: 2. The industrial method currently used to produce butanol is the hydration of butene. C,Ha(g) +…

A: Given 4C(s) + 4 H2(g) → C4H8(g) ∆H = -7.1 KJ/mol…

Q: 12. The value of AH° for the reaction below is -126 kJ. The amount of heat that is released by the…

A: As per guidelines first question is allowed if multiple questions posted , please repost seperately…

Q: The standard enthalpy change for the following reaction is -731 kJ at 298 K. 2 N2(g) + 4 H2(g) + 3…

A: Rule : on dividing the reaction with any constant, the value of enthalpy change also gets divided by…

Q: 3. Methanol undergoes combustion according to the equation: 2CH,OH + 30, → 2CO0 + 4H,0 ) AH = -1…

A: Given,

Q: Consider the following reaction: 2 Mg(s) + O2(g) --> 2 MgO(s) ΔH = - 1204 kJ/rxn Is this…

A: In an exothermic reaction heat is evolved in the surroundings and the container becomes hot after…

Q: Determine ΔH in kJ/mol for the following reaction: 2NO(g) + O2(g) --> 2NO2(g) The standard…

A: Given that: 2NO(g) + O2(g) <......> 2NO2(g) dH°NO = 90.4 KJ/mol dH°NO2 = 33.9 KJ/mol

Q: The standard enthalpy changes for the combustion of carbon and carbon monoxide are shown below. C(s)…

Q: Use the data given below to find the enthalpy of reaction for the following reaction: CaCO3(s) →…

Q: H2 (g) + '/½ O2 (g) → H2O (1) 2 Na (s) + '/½ O2 (g) → Na2O (s) Na (s) + '/½ O2 (g) + '½ H2 (g) →…

A: Hess's law states that "the standard reaction enthalpy is the sum of the standard enthalpies of the…

Q: Given H2(g) + (1/2)02(g)H20(1), AH° = -286 kJ/mol, determine the standard enthalpy change for the…

A: Given data H2(g)+12O2(g)→H2O(l) , ∆H°=-286 KJ/mol To be determine 2 H2O(l)→2 H2(g)+O2(g) , ∆H°=?

Q: Given the standard enthalpy changes for the following two reactions: (1) 2C(s) + 2H2(g) C2H4(g) AH°…

Q: Given the following decomposition reaction 2H2O2 (l)---> 2H2O(l) + O2 (g) ΔH = –196.1 kJ A. How…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H2(g)→C„H1(g) AH°…

A: ∆H° is negative means that it is e reaction To get equation 3 we should multiply equation 2 by 2…

Q: For the chemical reaction Ca (s) + 02 (g)→CAO (s) AH° = -635 kJ/mol. What is the enthalpy for the…

A: Given reaction, Ca(s) + 1/2 O2(g) → CaO(s) ∆H0 = - 635 kJ/mol

Q: [2] When 1.045 g of CaO is added to 50.0 ml of water at 22.0 °C in a coffee-cup calorimeter, the…

A: Heat release during reaction = heat gain by water and calorimeter.

Q: When 25.0 mL of 1.00 M H2SO4 is added to 50.0 mL of 1.00 M NaOH in a coffee-cup calorimeter at 25°C,…

A: Given: Density= 1.00 g/mL The volume of H2SO4= 25.0 mL The volume of NaOH= 50.0 mL The concentration…

Q: Consider the following two reactions and write down the balanced chemical equations. Reaction 1:…

A: Enthalpy of a reaction at a given temperature is defined as the enethalpy change produced in the…

Q: Given the standard enthalpy changes for the following two reactions: (1) N2(g) + 202(g)2NO2(g) AH° =…

A: The reactions given are 1) N2 (g) + 2 O2 (g) -----> 2 NO2 (g)…

Q: Determine the molar heat of combustion for CH4(g) CHĄ(g) +2 O2(g) -CO2(g) +2 H2O{le) Given: C(s) +2…

Q: 2. The decomposition of ammonia gas into nitrogen gas and hydrogen gas is endothermic: 2 NH3 (g) →…

Q: PCI5(s) can be prepared by the reaction PCI3() + Cl2(g) - PCI5(s). Calculate the enthalpy change (in…

A: Answer is attached below hope it would help.

Q: THERMODYNAMICS: A 1.96 g sample of acetic acid (HC;H3O2) was burned in excess oxygen in a bomb…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H₂(9) C4H10(g) AH°…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: （1）Consider the reaction: 2A (g) + 3 B (g) → 2 C (g) ΔHrxn = +254.3 kJ What will be the…

A: 2A (g) + 3 B (g) → 2 C (g) ΔHrxn = +254.3 kJ Moles of B = 0.471 moles Enthalpy Change = ?

Q: The enthalpy of reaction for the combustion of C to CO2 is -393.5 kJ/mol C, and the enthalpy for the…

A: The reactions given are, 1) C (s) + O2 (g) ------> CO2 (g) ΔH = -393.5…

Question

Given the following combustion reaction and its molar enthalpy of reaction:
2NO(g) + O2(g)
2NO2(g) AH° = -112 kJ
What is the heat (q) associated with the combustion of 2.00 mole of NO(g)?
O -112 kJ
O -224 kJ
+56.0 kJ
-56.0 kJ
O +112 kJ

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
The combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written below. Calculate H for the combustion of 15.0 g of C2H6. 2 C2H6(g) + 7 O2(g) 4 CO2(g) + 6 H2O(g) rH=2857.3kJ/mol-rxn
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
When a 0.740-g sample of trinitrotoluene (TNT), C7H5N2O6, is burned in a bomb calorimeter, the temperature increases from 23.4 C to 26.9 C. The heat capacity of the calorimeter is 534 J/C, and it contains 675 mL of water. How much heat was produced by the combustion of the TNT sample?