Given the reaction: X(g) + 2Y(g) z(g) 2.00 moles of X and 3.00 moles of Y are placed in a 6.00-L container. If the equilibrium concentration of X is 0.300 mol/L. calculate the equilibrium concentration of Y (in mol/L)? O 0.433. O 0.133 O 0.033 O 0.233 O 0.333

Given the reaction: X(g) + 2Y(g) z(g) 2.00 moles of X and 3.00 moles of Y are placed in a 6.00-L container. If the equilibrium concentration of X is 0.300 mol/L. calculate the equilibrium concentration of Y (in mol/L)? O 0.433. O 0.133 O 0.033 O 0.233 O 0.333

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.98PAE

See similar textbooks

Related questions

Q: The equilibrium system 2SO:(g)+ O2(g) = 2S03(g) is an exothermic reaction. Which change will result…

A: Lechatelier's principle :- It states that , when a system at equilibrium is subjected to a change in…

Q: If this reaction is at equilibrium, how will each change affect it? 2NO2(g) + heat 2NO(g) + O2(g) 1.…

A: Solving first three subparts in accordance with guidelines. You can repost remaining questions.

Q: Consider the equilibrium system described by the chemical reaction below, which has a value of Kc…

A: Given the equilibrium reaction is: I₂(g) + Br₂(g) ⇌ 2 IBr(g); Kc = 280 Initial moles of IBr(g) =…

Q: Consider the equilibrium system described by the chemical reaction below, which has a value of Kc…

A: I2(g) + Br2(g) ⇌ 2…

Q: Carbon dioxide and water react to form methanol and oxygen, like this: 2 CO2(9)+4 H,O(g)→2…

A: Given: Mass of CO2 = 2.24 gm Mass of H2O = 4.82 gm Mass of CH3OH = 4.11 gm Mass of O2 = 2.03 gm…

Q: system is allowed to once again reach equilibrium. PCI5(g) PCI3(g) + Cl2(g) K= 5.01×10² at 523 K (a)…

Q: Consider the combustion of methane (as represented by the following equation). This is the reaction…

A: Le Chatelier's principle: This principle is used to predict the effect of a change in conditions on…

Q: Suppose a 500. mL flask is filled with .60 mol of H2 and .80 mol of HI. The following reaction…

A: Find the initial concentration of hydrogen and hydrogen iodide.

Q: 1. Consider the following equilibrium: A+2B 3 C +D Are the reactants or products favored at…

A: 1) Since the value of equilibrium constant for the reaction is very very less than 1 Hence it means…

Q: Consider the following system at equilibrium at 500 K: PCl5(g) PCl3(g) + Cl2(g) When some PCl3(g)…

A: Le Chatelier’s principle finds application in reactions dealing with equilibrium. According to this,…

Q: Consider the following reaction at equilibrium. What effect will adding NO2 have on the system?…

A: Ans According to the Le-chatlier's principle for a chemical reaction if reactants added to the…

Q: The equation below shows a reaction at equilibrium. What happens to the equilibrium if the…

A: Given reaction : 2NO2(g) <====> N2O4(g) + 58.8 KJ Here , heat energy 58.8 KJ is on product…

Q: Kc = 2.6 × 10^8 at 825 K for the reaction 2 H2(g) + S2(g) ⇀↽ 2 H2S(g) The equilibrium concentration…

A: Given, an equilibrium chemical reaction,2H2(g)+S2(g)⇌2H2S(g)the equilibrium constant Kc for the…

Q: For the reaction, CO(g) + H₂O(g) = CO2 (g) + H2 (g), the value of the equilibrium constant, K, is…

Q: Natural gas provides the starting point for the industrial production of CO(e) and H2(g), which are…

A: given, CO(g) + 2 H2(g) ⇔ CH3OH(g) at equilibrium, concentrations are [CO(g)] = 0.25 mol/L [H2(g)] =…

Q: 4. Consider the following exothermic reaction which is used as a source of O2 in some self-contained…

A: The given exothermic reaction is:4 KO2(s) + 2 CO2(g) ⇋ 2K2CO3 (s) + 3O2 (g)

Q: At a certain temperature, a chemist finds that a 8.3 L reaction vessel containing dioxide, water,…

Q: The equilibrium constant, Kc, for the following reaction is 9.37 x 10–3 at 35 oC. A system at…

A: The balanced Equilibrium Chemical Reaction is given in the question is - N2O4(g) ⇌ 2NO2(g)…

Q: Calculate equilibrium molarity of O2 ?Suppose a 250 mL. flask is filled with 0.40 mole of N2 and 1.1…

A: Consider the given information is as follows; Initial moles of N2 = 0.40 mol Initial moles of NO =…

Q: Consider the following equilibrium system: 2 NO(g) + Cl(2 g) ⇌ 2 NOCl(g) (a)What does Le Châtelier’s…

Q: Calcium carbide (CaC2(s)) reacts violently with gaseous hydrogen chloride (HCl(g)) to produce…

Q: SO2(g)+NO2(g)−⇀↽−SO3(g)+NO(g)SO2(g)+NO2(g)↽−−⇀SO3(g)+NO(g) the equilibrium constant at a certain…

Q: Calculate the value of the equilibrium constant for the reaction, 4NH3(g)+3O2(g)⇌2N2(g)+6H2O(g)…

A: Equilibrium is the physical state at which the rate of forward reaction is equals to the rate of the…

Q: Methanol and oxygen react to form carbon dioxide and water, like this: 2CH,OH(1)+30,(g)-2…

Q: Consider the following reaction at equilibrium. What effect will removing NO2 have on the system?…

Q: For the following equilibrium reaction: Energy + 2AB2 (g) 2 AB (g) + B2 (g)…

A: A reaction is said to be in equilibrium if the rate of the forward reaction is equal to the rate of…

Q: Consider the equilibrium: * (Баллов: 1) in which direction will equilibrium shift when the…

A: According to Le Chatelier's principle on the addition of heat to a reaction ( i.e on increasing…

Q: If 1.34 moles each of Br2 and Cl2 are introduced into an 11.0 liter flask and allowed to come to…

A: Consider the given information is as follows; Initial moles of Br2 = 1.34 mol Moles of of Cl2 = 1.34…

Q: Consider the reaction represented by the equation 25O2g) + O2(g) 2S03(g). For the system at chemical…

A: Thermodynamics is concerned with the energy changes while kinetic is concerned with the rate of…

Q: For the equilibrium 2IBr(g) ⇌ I₂(g) + Br₂(g) Kc = 8.50 × 10⁻³ at 150°C. If 0.0550 mol of IBr is…

Q: Calcium oxide and carbon dioxide react to form calcium carbonate, like this: CaO(s)+CO,(g)–CaCO3(s)…

Q: When the equilibrium constant, K << 1, A. The mixture contains mostly reactants B. The mixture…

Q: 2 NH3(g) ⇌ 3 H2(g) + N2(g) When 1.2 mol of hydrogen gas and 0.40 mol of nitrogen gas are placed…

A: Given that: Number of moles hydrogen gas = 1.2 mol Number of moles nitrogen gas =…

Q: 3. 3. Some CO, is removed from the equilibrium system shown below. Which of the following statements…

Q: Consider the following reaction: 2 NH3(g) 2 3 H2(g) + N2(g) Kc = 2.20 1.10 mol/L of nitrogen gas,…

Q: Explain the effect of each of the following stresses on the position of the equilibrium SO;(g) 2…

A: The given equilibrium reaction is SO3g⇄SO2g+12O2g Le Chatelier's Principle is used in order to…

Q: 1. In an experiment, 0.30 mol H2 and 0.30 mol I2 are mixed in a 1.00-L container, and the reaction…

A: Formula used : Molarity = moles /volume Equilibrium constant = [products]/[reactants]

Q: The dissociation of PCl5(g) to PCl3(g) and Cl2(g) is an endothermic reaction. PCl5(g) PCl3(g) +…

A: Le Chatelier's principle: This principle is used to predict the effect of a change in conditions on…

Q: At a certain temperature, the reaction 2HF(g) H2(g) + F2(g) has K 1.2 x 10 13. Does this reaction…

A: Reaction: 2HF(g) <=> H2(g) + F2(g) Kc = 1.2 × 10-13 Moles of HF = 0.013 mol Volume of…

Q: For the equilibrium, 2NO(g)+2H2(g)→N2(g)+2H2O(g), what will happen if it were in a rigid vessel and…

A: According to Le Chatelier's principle when factors(like temperature,molar concentration,pressure…

Q: As you are walking across your laboratory, you notice a 5.25 L flask containing a gaseous mixture of…

Q: Use each expression for the equilibrium constant to write a chemical equation. [A,] [A]? [AB?…

Q: Consider the combustion of methane (as represented by the following equation). This is the reaction…

A: Given reaction is : CH4 (g) + 2O2 (g) <-------> CO2 (g) + 2H2O (g) What happens if the…

Q: Consider the following reaction: PCl3(g)+ Cl2(g) -><-PCl5(g) K = 4.30 x 10-6…

A: Recall the given reaction PCl3g + Cl2g→PCl5g K=PCl5PCl3×Cl2Value of…

Q: Consider the following equation: N2(g) + 2O2(g) + heat 2 NO2(g) In what…

A: if dynamic equilibrium changed by factors like pressure ,temperature,concentration,…

Q: Iron and water react to form iron(III) oxide and hydrogen, like this: 2 Fe(s) + 3 H₂O(g)…

A: First write down the Kc formula for given reaction and then plug all values of concentration to find…

Q: At elevated temperatures, carbon dioxide (CO2) can decompose into carbon monoxide and oxygen by the…

Q: Given the reaction: PCl3(g) + Cl2(g) ⇌ PCl5(g) Kc = 24.3 Suppose the system at that particular…

A: Given- PCl3+Cl2<->PCl5. Kc=24.3 [PCl3]=0.10M [Cl2]=0.15M [PCl5]=0.55M

Q: Consider the following reaction: 2 NO (g) + O2 (g) ⇌ 2 NO2 (g) Kp = 5.0 x 1012…

Question

Given the reaction:
X(g) + 2Y(g)
z(g)
2.00 moles of X and 3.00
moles of Y are placed in a
6.00-L container.
7.
10
If the equilibrium
concentration of X is 0.300
mol/L. calculate the
equilibrium concentration
of Y (in mol/L)?
13
Fin
att
O 0.433.
O 0.133
O 0.033
O 0.233
O 0.333

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 25C. Kp = 5.3 105 for the reaction N2(g)+3H2(g)2NH3(g) When a certain partial pressure of NH3(g) is put into an otherwise empty rigid vessel at 25C, equilibrium is reached when 50.0% of the original ammonia has decomposed. What was the original partial pressure of ammonia before any decomposition occurred?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of CI2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm? Cl2(g)+Br2(g)2BrCl(g)KP=4.7102
A student studies the equilibrium I2(g)2I(g)at a high temperature. She finds that the total pressure at equilibrium is 40% greater than it was originally, when only I2 was present. What is K for this reaction at that temperature?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?