GRAVITY AND ACCELERATION (II) Name ihe distance covered by a freely falling body is calculated by the following formula, at2 Example 1: How far will an object fall in 5 seconds? d = Answer: d = 9.8 m/s) (5s)2 = 122.5 meters where d = distance a = acceleration t= time Example 2: What is the average velocity of a ball that attains a velocity of 39.2 m/s after 4 seconds? Answer: = V,-V, = 2 39.2 -0 = 2 (2) 19.6 m/s Solve the following problems. 11 How far will a rubber ball fall in 10 seconds? Answer: 2 How far will a rubber ball fall in 20 seconds? Answer: 3 How long will it take an object dropped from a window to fall a distance of 78.4 meters? Answer: 4 Calculate the final velocity of the ball in Problem 1. Answer: 5. What is the average velocity of the ball in Problem 1? Answer: 6. An airplane is traveling at an altitude of 31,360 meters. A box of supplies is dropped from its cargo hold. How long will it take to reach the ground? Answer: 7. At what velocity will the box in Problem 6 be traveling when it hits the ground? Answer: 8. What is the average velocity of the box in Problem 6? Answer:

GRAVITY AND ACCELERATION (II) Name ihe distance covered by a freely falling body is calculated by the following formula, at2 Example 1: How far will an object fall in 5 seconds? d = Answer: d = 9.8 m/s) (5s)2 = 122.5 meters where d = distance a = acceleration t= time Example 2: What is the average velocity of a ball that attains a velocity of 39.2 m/s after 4 seconds? Answer: = V,-V, = 2 39.2 -0 = 2 (2) 19.6 m/s Solve the following problems. 11 How far will a rubber ball fall in 10 seconds? Answer: 2 How far will a rubber ball fall in 20 seconds? Answer: 3 How long will it take an object dropped from a window to fall a distance of 78.4 meters? Answer: 4 Calculate the final velocity of the ball in Problem 1. Answer: 5. What is the average velocity of the ball in Problem 1? Answer: 6. An airplane is traveling at an altitude of 31,360 meters. A box of supplies is dropped from its cargo hold. How long will it take to reach the ground? Answer: 7. At what velocity will the box in Problem 6 be traveling when it hits the ground? Answer: 8. What is the average velocity of the box in Problem 6? Answer:

Introductory Chemistry: An Active Learning Approach

6th Edition

ISBN:9781305079250

Author:Mark S. Cracolice, Ed Peters

Publisher:Mark S. Cracolice, Ed Peters

Chapter3: Measurement And Chemical Calculations

Section: Chapter Questions

Problem 128E: In Active Example 3-29 you calculated that you would have to work six weeks to earn enough money to...

See similar textbooks

Similar questions

A race car goes around a level, circular track with a diameter of 1.00 km at a constant speed of 85 km/h. What is the car's centripetal acceleration in m/s2? m/s2
If the Km = 3mM and Vi = 35mM when the [s] = 3mM, then what is the velocity (V0) if [s] = 18mM?
Taking the density of air to be 1.29 kg/m3, what is the magnitude of the linear momentum of a cubic meter of air moving with the following wind speeds? (a) 48 km/h kg · m/s(b) 74 mi/h—the wind speed at which a tropical storm becomes a hurricane kg · m/s
A. B. and C. already solved (https://www.bartleby.com/questions-and-answers/chemistry-question/a89691d6-2162-4677-b0cc-dc84fcceda08). Please answer E, F and GCircle in pencil in the image on th eirght cide of the diagram is a "2"( Pb(NO3)2 ).
These organic solvents are used to clean compact discs : (a) If a 15.00-mL sample of CD cleaner weighs 11.775 g at 208C, which solvent does the sample most likely contain? (b) The chemist analyzing the cleaner calibrates her equipment and finds that the pipet is accurate to +-0.02 mL, and the balance is accurate to +-0.003 g. Is this equipment precise enough to distinguish between ethanol and isopropanol?
List down real life applicationd of the three fundamental law of chemistry
For the numbers 116.0, 97.9, 114.2, 106.8 and 108.3, find the rangeb and 90% confidence interval for the mean.
In Active Example 3-29 you calculated that you would have to work six weeks to earn enough money to buy a 1082.49 television. You would be working five shifts of four hours each at 9.25/hr. But, alas, when you received your first pay check, you found that exactly 23 of your earnings had been withheld for social security, federal and state income taxes, and workers compensation insurance. Taking these into account, how many weeks will it take to earn the 1082.49?
You are on the management team of a company that is considering purchasing a tanker truck. The truck you want has a volume of 26,000 liters and an empty mass/weight of 15,500 kg. However, the route you wish to travel has a bridge with a weight limit of 25 tons. If you purchase the truck and fill it to capacity with a liquid whose density is 0.80kg/L, what will the mass of the truck be?
In a metered-dose inhaler (MDI), such as those used for asthma medication, medicine isdelivered by a compressed-gas propellant. (The device is similar in concept to a can of spraypaint.) When the inhaler is activated, a fixed amount of the medicine suspended in thepropellant is expelled from the mouthpiece and inhaled. In the past, chlorofluorocarbons(CFCs) were used as propellants; however, because of their reactivity with the Earth's ozonelayer, they have been replaced by hydrofluorocarbons (HFCs), which do not react withozone. Now HFC use is also being reduced due to their high global warming potential. In one brand of inhalers, the original CFC propellant was replaced by HFC 227ea (C3HF7,heptafluoropropane). The volume of the inhaler propellant reservoir is 1.00×102 mL, and thepropellant is charged into the reservoir to a gauge pressure of 4.443 atm at 23°C. An onlinesearch for properties of HFC 227ea yields the information that the critical temperature andpressure of the substance…
7. From the normal curve of error, find the probability that a result is outside the limits of ±2σ from the mean. What is the probability that a result has a more negative deviation from the mean than -2σ?
A 795-centigram sample of borax was placed in a certain volume of water at 25 degrees celsius. After adding the sample, the graduated cylinder was read at 35 mL, where a rise of 2.7 mL was observed. What is the weight (grams) of sample? What was the initial volume (millimeters) of water? What will be the weight of displaced water in grams? What is the specific gravity of the solid? What will be its specific volume?