Half-Reaction Standard Reduction Potential, E (V) Ag* (aq) +e- -→ Ag(s) +0.80 Cu?+ (aq) + 2 e- → Cu(s) +0.34 Pb²+(ag) + 2 e- → Pb(s) -0.13 A+ (ag) + 3 e- → Al(s) -1,66 A standard galvanic cell is made using Pb-Pb(NO,), and Cu-Cu(NO,), half-cells. Which of the following modifications to the cell will cause the greatest increase in E" cell, and why? Assume all solutions are1 M. cell = +0.67 V A Replacing the Cu-Cu(NO,), half-cell with a Ag-AGNO, half-cell, because the reduction of 1 mol of Agt requires only 1 mol of e, resulting in E'. B Replacing the Cu-Cu(NO,), half-cell with a Ag-AGNO, half-cell, because less current flows through the cell, resulting in E = +0.93 V. Replacing the Pb-Pb(NO,), half-cell with an Al-Al(NO,), half-cell, because the oxidation of A1(s) is more thermodynamically favorable than the oxidation of Pb(s), resulting in E cell = +2.00 V. D Replacing the Pb-Pb(NO,), half-cell with an Al-Al(NO,), half-cell, because 6 mol of e flow through the cell, resulting in Ei= +5.66 V.

Half-Reaction Standard Reduction Potential, E (V) Ag* (aq) +e- -→ Ag(s) +0.80 Cu?+ (aq) + 2 e- → Cu(s) +0.34 Pb²+(ag) + 2 e- → Pb(s) -0.13 A+ (ag) + 3 e- → Al(s) -1,66 A standard galvanic cell is made using Pb-Pb(NO,), and Cu-Cu(NO,), half-cells. Which of the following modifications to the cell will cause the greatest increase in E" cell, and why? Assume all solutions are1 M. cell = +0.67 V A Replacing the Cu-Cu(NO,), half-cell with a Ag-AGNO, half-cell, because the reduction of 1 mol of Agt requires only 1 mol of e, resulting in E'. B Replacing the Cu-Cu(NO,), half-cell with a Ag-AGNO, half-cell, because less current flows through the cell, resulting in E = +0.93 V. Replacing the Pb-Pb(NO,), half-cell with an Al-Al(NO,), half-cell, because the oxidation of A1(s) is more thermodynamically favorable than the oxidation of Pb(s), resulting in E cell = +2.00 V. D Replacing the Pb-Pb(NO,), half-cell with an Al-Al(NO,), half-cell, because 6 mol of e flow through the cell, resulting in Ei= +5.66 V.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Similar questions

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?