Hard bases have filled orbitals and empty orbitals could be seen at high energy levels.

Q: Three point charges are located at the corners of an equilateral triangle as in the figure below.…

A:

Q: In your laboratory notebook, draw an energy diagram for your semiconductor sample. On your energy…

A: In semiconductor we know the conduction band contain null, and valence band is fully filled, and…

Q: How to calculate octahedral voids ?

A: Given question is : How to calculate octahedral voids = ?

Q: Why are the observed configurations of, for example, trigonal bipyramidal structures  sometimes…

A: The bond pairs and lone pairs of electrons around the central atom of a molecule are arranged as far…

Q: 5. Strontium (Sr: [Kr]5s2) crystal has a mass density of 2.64 g/cm3 and a molar mass of 87.62 g/mol.…

A: Mass density = 2.64 g cm-3 Molar mass   = 87.62 g mol-1

Q: Chemistry Why are the observed configurations of, for example, trigonal bipyramidal structures…

A: We are here asked about why are the observed configurations of, for example trigonal bipyramidal…

Q: Using lithium  of atomic number 3 and chlorine of atomic number 17 describe electroovalent bonding.

A: Given, Element Li having atomic number 3 Another element Chlorine of atomic number 17

Q: in meters) of an electromagneti

A:

Q: 22. What is the stationary phase column packing material for Q 21?

A: Chromatography is the method that is used to separate the components of the mixture. It has two…

Q: Antibonding molecular orbitals can be used to make bonds to other atoms in a molecule. For example,…

A: Antibonding orbitals are those which can make a bond weak. They are the vacant orbitals in which the…

Q: Under what conditions do zwitterions exist?

A: A zwitterion is adipolar ion that has a net charge equal to zero. An amino acid has both acidic and…

Q: ctrons in a nonpolar cov molecule are shared... Electrons are not shared Evenly Unevenly

A: Covalent Bonds are formed by sharing of Electrons. Covalent bonds are of 2 types   1. Polar…

Q: What is band broadening? Explain the phenomenon of eddy diffusion.

A: These are terms with reference to chromatography:

Q: Define the following terms: Tyndall scattering: Polarization of Radiation:

A: We have to Define the following terms: Tyndall scattering: Polarization of Radiation

Q: is mesosphere solid or liquid?

A: Is mesosphere solid or liquid has to be given.

Q: Calculate the planar density of a BCC element if the radius is 0.125 nm.

A:

Q: In the crystal structure, any missing atom from its normal site is producing a vacancy

A: True X Rays are widely used to study the structure material of the crystal structure. And only thing…

Q: If a bonding orbital is gerade, then the antibonding orbital is:

A: In this question we have to choose correct of the above statement with suitable reason.

Q: draw the 2D network structure of crystalline

A: Crystalline lattice is a periodic array of atoms. Examples include diamond, metals, salt etc.

Q: Why are these bravais lattices the same? B-monoclinic and primitive (P)-monoclinic (if b is the…

A: There are several ways to describe a crystalline plane. The most fundamental description is known as…

Q: What is the maximum bond order that is possible between two s-block elements?

A: The bond order of a molecule is furnished as half of the difference between the number of electrons…

Q: Objects that are associated with trigonal bipyramidal and octahedral.

A: Interpretation-  To tell about that objects that are associated with trigonal bipyramidal and…

Q: Why did the compounds acted differently when conductivity was tested?

A: Conductivity is basically the ability of movement of electricity or heat throughout the chemical…

Q: Why does ion polarization increases as the electronic cloud increase with in each period of the…

A: Ionic polarization means polarization in the ions. Ions are of two types- (i) Cations -->…

Q: Define the term voids.

A: Void is a empty space between close packed metal atoms in the crystals. Voids are of different shape…

Q: In how many allotropic forms does nitrogen exists?

A: Allotropes are different form of the same element. Different bonding arrangement between atoms…

Q: Give two typical applications where the band and bond model is used.

A: The bond models is mostly used for basic idea of what the individual electrons are doing in…

Q: what is the magnetic moment of diamagnetic substances?

A: Diamagnetic substances does not possess permanent magnetic dipole moment.  When these substances are…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Can atom have more than one ionization potentials?

A: Yes, I multi electron atoms have more than one ionisation potential values. For example Mn atom.

Q: What is valance for Be

A: Electronic configuration for Be is given as ~ 1s2 2s2   Hence we can see the valence shell of Be is…

Q: Nuclear magnetic resonance (NMR) logging tools provide: A. permeability estimate B. Pore Size…

A: Given : NMR logging tools . To find : Information that NMR logging tools provide. Solution : NMR…

Q: Delocalization delocalization metallic bonding True False of electrons and of electrons can give…

A: The correct answer about metallic bonding is given below

Q: Explain what the major difference in the XRD patterns of base-centered and body- centered…

A: Orthorhombic Unit cell: Orthorhombic unit cell is one of the 7 unit cells.

Q: 2. The drawing on the right belongs to the _ the same length and all angles are 90°. A. C: В. D. С.…

A: The given molecule has three symmetry elements: C2 axis of symmetry sigma-v plane of symmetry…

Q: Delectrons in the shell of the highest principal quantum number

A: So, Valence electrons is defined as an atom's valence electron is an electron in its outer shell…

Q: What is graphene?

A: Graphene is an allotrope of carbon. The carbon atoms in the graphene structure are present in a…

Q: bonding orbital nonbonding orbital phase degenerate antibonding orbital

A: In molecular orbital theory , we talk about bonding and antibonding molecular orbitals. We talk…

Q: What are the highest symmetry crystal systems the unit cells below can belong to ? and why? (a)…

A:

Q: Delocalization delocalization rise metallic bonding False O True of electrons and of electrons can…

A: The correct answer is given below

Q: What kind/type of force does Schottky defects induces on its neighboring atoms? Explain.

A: Schottky defect: The Schottky defect is a type of point defect formed by a vacant position in a…

Q: Qs) who many allotropes does carbon element has? Which is harder?

A: Ans 8 : There are three major allotropes of the carbon atom 1. Diamond 2. Graphite  3. Fullerenes…

Q: Explain infrared spectrum in detailed analysis.

A: The functional group is a key component associated with a molecule and they control the overall…

Q: Why is graphene unique?

A: Graphene is an allotrope of carbon. The carbon atoms in the graphene structure are present in a…

Q: How odd and even electron species can be cleaved?

A: The carbon atom which consists positive charge and bonded with three bonds is known as cation. The…