given the following equation: 2KCIO3-->2KCI+302, how many g of 02 can be produced by letting 550g of KCIO3 react?211.4g215.4g200g250.5gnone of the above

Given :- mass of KClO3 = 550 g To calculate :- mass of O2 produced

Answered: , how many g of O2 can be produced

Science

Chemistry

, how many g of O2 can be produced

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.67E

See similar textbooks

Related questions

Q: 3. How many grams of oxygen are used in the combustion of 1.9 moles of CH,?

A: Combustion reaction is the reaction between organic compound with Oxygen in the presence of heat to…

Q: In a chemical reaction, what is the limiting reactant?

A: The component (substance) that gets completely consumed in a chemical reaction is known as the…

Q: Explain why the statement, “The limiting reactant is thereactant with the lowest mass” is incorrect.

A: Limiting reactant is the reactant which completely consume in the reaction after some time and then…

Q: What is the percent yield of BrCl?

A: Kc = Kp /(RT)∆n . ∆n = 2-2 = 0 Hence, Kc = Kp So, mass of BrCl in g = 12.71214 g Calculation :

Q: If the theoretical yield of a reaction is 0.118 g and the actual yield is 0.104 g, what is the…

A: The given data contains, Theoretical yield = 0.118 g. Actual yield = 0.104 g.

Q: How many grams of Fe is produced if 16.5g of C is reacted with an excess of Fe,O,?

A: Given :-mass of C = 16.5 g To calculate :- mass of Fe Mass of 1 mol C = 12.01 g Mass of 1 mol Fe…

Q: What is the smallest whole number value of the stoichiometric coefficient of HCI ? How about H2…

Q: For the reaction З КОН + Н, РО, — К, РО, + 3Н,О 4 4 how many grams of potassium phosphate, K3PO4,…

A: We have given the balance chemical equation as follow 3KOH + H3PO4 → K3PO4 + 3H2O We have…

Q: If 0.87 g of acetone is allowed to react with an excess of Benzaldehyde to form an organic product…

A: Given,

Q: Calculate the number of moles of solid mercury (I) oxide that can be produced by the reaction of…

A: moles of any species contains 6.022 × 1023

Q: What is the percent yield for this reaction?

A: Number of moles = mass/molar mass Percent yield = (actual yield/theoritical yield) × 100%

Q: Hydrogen gas and nitrogen gas react to give ammonia gas. How many moles of hydrogen are needed to…

A: In a chemical reaction, when number of atoms of each element present in reactants are equal to…

Q: Determine the percent yield for the reaction between 45.9 g of NaBr and excess chlorine gas to…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: What is the mass of one mole of CO2

A: Given Moles of CO2 = 1 mol

Q: What is the expected mass of AgBr in grams?

Q: How many molecules (not moles) of NH3 are produced from 2.21*10^-4g of H2?

A: Given:Mass of H = 2.21 X 10-4 g of H2We need to find the number of molecules (not moles) of NH3 are…

Q: A typical aluminum can has a mass of about 14.9 g. Determine the mass of alum that could be produced…

Q: For the following reaction, 0.214 moles ofphosphorus () are mixed with 0.402 moles of chlorine gas.…

A: Given that, moles of P=0.214 mol moles of Cl2= 0.402 mol then,

Q: Determine the percent yield for the reaction between 45.9 g of NaBr and excess chlorine gas to 6.…

A: All the details are explained in handwritten solution.

Q: d. How many grams of phosphorus pentachloride are theoretically produced? If 0.450g of phosphorus…

A: From the given problem, the balanced equation is: P4 (s) + 10 Cl2 (g) → 4PCl5 (s) For chlorine gas…

Q: Nitroglycerine decomposes violently according to the chemical equation below, What mass of carbon…

Q: In an actual experiment using 10.0 g of magnesium and 10.0g oxygen, 14.3 g of magnesium oxide was…

Q: Acetylene gas C,H, burns in the oxyacetylene torch for welding. How many grams of C,H, are burned if…

A: Molar mass of CO2 = 44g/mol Molar mass of C2H2 = 26 g/ mol

Q: Consider the balanced chemical reaction below. What is the maximum amount of grams of Fe that can be…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: What is the molar mass of CO2? Enter your answer rounded to four sig figs, without units.

Q: If 15.0 g of methanol (CH3OH) reacted, how many grams of carbon dioxide (CO2) gas would be produced?

Q: How many moles of NH3 will be producex when 7 moles of N2 are consumed

A: The production of ammonia from nitrogen gas is done by Haber’s process. The chemical equation for…

Q: D. Aluminium metal reacts with sulphuric acid, H2SO4, to yield aluminium sulphate and hydrogen gas.…

A: In balance reaction 2 mole of aluminium react 3 mole sulphuric acid and produced 3 mole H2

Q: Consider the mixture of ethanol, C2H5OH, and O2 shown inthe accompanying diagram. (a) Write a…

A: A combustion reaction is the reactions in which the organic carbon compound burns in the presence of…

Q: s. How much O2 could be produced

Q: Carbon dioxide can be created by burning carbon in oxygen: C+ O2 → CO2 Approximately how many moles…

A: Given : C + O2 → CO2 Mass of C reacts with excess O2 = 24 g To calculate : No.of moles of CO2…

Q: What is the balanced chemical equation of Calcium Carbonate above?

A: Calcium oxide is also referred to as the lime and generally used for many purposes such as in the…

Q: How many moles of NH, can be produced from 2.61 moles of nitrogen in the following reaction: N, (g)…

A: Balanced Reaction N2 (g) + 3 H2 (g) ---> 2 NH3 (g) N2 reacts with hydrogen molecule to form…

Q: Carbon dioxide can be created by burning carbon in oxygen: C + O2 → CO2 Approximately how many…

Q: How many grams of sulfur dioxide can be produced when 31.0 gg of oxygen reacts?

A: The answer to the following question is given as:

Q: What is the limiting reactant?

A: Limiting reagents get completely used up in a chemical reaction. after limiting reagent reacts…

Q: Using the balanced chemical equation below, what mass of H3PO4 is formed given 41.36 grams of water…

A: Given that: Mass of water = 41.36 g To find: Mass of phosphoric acid formed =?

Q: During the analysis, 0.163 g H2O and 6.00 g CO2 are produced. Calculate the moles of H2O formed by…

A: Step : 1 Calculate the moles of H2O formed by combustion of 0.400 g vitamin c.

Q: How many atoms in co2?

A: When a group of atoms bond together to form a compound that take part in chemical reaction is called…

Q: How much Mol S2O32- consumed and how much I3- was produced?

A: Sodium thiosulfate is Na2S2O3 which is responsible for furnishing S2O32-. Concentration of S2O32- in…

Q: References Use the References to access important values if needed for this question. How many grams…

A: Given, Mass of iron(II) phosphate produced, Fe3(PO4)2 = 42.6 g Moles of Fe3(PO4)2 produced can be…

Q: 13. How many moles of K are formed from 68 grams of KCI?

A: The mass of a substance and the number of moles are related by the equation, Number of moles=Mass…

Q: Determine how many grams of CO2 13.72 g carbon dioxide are produced by burning 5.45 g of C4H10.

Q: The moles of H2 produced from the reaction of 2 mol of HCl is:

A: Number of moles = mass/molar mass Zinc + hydrochloric acid ---> Zinc chloride + hydrogen gas…

Q: For a theoretical yield of 5 g and percent yield of 53.7015%, calculate the actual yield for a…

A: Given :- Theoretical yield = 5 g Percent yield = 53.7015% To calculate :- Actual yield (in g)

Q: What mass of carbon dioxide can be produced the from burning of 25.0 g of hexane

A: combustion of the hydrocarbon is the reaction in which hydrocarbon is burnt in presence of the…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

given the following equation: 2KCIO3-->2KCI+302, how many g of 02 can be produced by letting 550g of KCIO3 react?
211.4g
215.4g
200g
250.5g
none of the above

Expert Solution

Step 1

Given :- mass of KClO₃ = 550 g

To calculate :- mass of O₂ produced

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
Uranium can be isolated from its ores by dissolving it as UO2( NO3)2, then separating it as solid UO2(C2O4)3H2O. Addition of 0.4031 g of sodium oxalate, Na2C2O4, to a solution containing 1.481 g of uranyl nitrate, UO2( NO3)2, yields 1.073 g of solid UO2(C2O4)3H2O. Na2C2O4+UO2( NO3)2+3H2OUO2(C2O4)3H2O+2NaNO3 Determine the limiting reactant and the percent yield of this reaction.
how many moles of O2 will react with 15.5 moles of Fe?
determine the theoretical and percent yield of carbon dioxide when 48.95g of ethane (C2H6) reacts with 94.98g of oxygen gas and 72.67g of carbon dioxide product was collected. C2H6(g) + O2(g) ---> CO2(g) +H2O(l) theoretical yield= ? percent yield=?
Ammonia is produced by the millions of tons annually foruse as a fertilizer. It is commonly made from N₂ and H₂ by theHaber process. Because the reaction reaches equilibrium beforegoing completely to product, the stoichiometric amount of am-monia is not obtained. At a particular temperature and pressure,10.0 g of H₂ reacts with 20.0 g of N₂ to form ammonia. When equilibrium is reached, 15.0 g of NH₃ has formed. (a) Calculatethe percent yield. (b) How many moles of N₂ and H₂ are presentat equilibrium?
How many moles of O2 will form when 40.0 moles of CO2 react with excess KO2? Enter your answer to the tenths place. Do not include units. 4KO2(s) + 2CO2(g) ⟶ 2K2CO3(s) + 3O2(g)
how many moles of CO2 would be produced from 7.123 moles of O2according to 2C2H6+7O2=4CO2+6H2O