Answered: Hydrogen gas H2 reacts with nitrogen…

Hydrogen gas H2 reacts with nitrogen gas N2 to form ammonia gas NH3 = 3H2g +N2g=2NH3g How many molecules (not moles) of NH3 are produced from 2.09×10^-4g of H2

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter2: Chemical Formulas, Equations, And Reaction Yields

Section: Chapter Questions

Problem 21P: For each of the following chemical reactions, calculate the mass of the underlined reactant that is...

See similar textbooks

Related questions

Q: Calculate the grams of precipitate formed if you react 29.2 g AgNO3 with 34.6 g of Na2S according to…

A: Silver nitrate reacts with sodium sulfide to form silver sulfide and sodium nitrate. The equation…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Aqueous sulfuric acid reacts with solid sodium hydroxide to produce aqueous sodium sulfate and…

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous…

Q: For the following reaction, 0.120 moles of silver nitrate are mixed with 0.329 moles of copper(II)…

A: Answer to both the questions is given below.

Q: how many grams of H2 are produced

A: Given :- mass of Na = 130 g To calculate :- mass of H2 produced (in g)

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Balanced equation: HCl (aq) + NaOH (aq) -----> NaCl(aq) + H2O(l) This equation shows that 1…

Q: How many grams of oxygen gas are produced when 2.43x10^-4 g of KClO3 are completely reacted…

A: • No. of moles = Given MassMolar Mass• Mass = No. of Moles x Molar Mass• Molar Mass of O2 = 32…

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: Balanced equation: 2C4H10 (g) + 13O2 (g) -------> 8CO2 (g) + 10H2O (g) Number of moles =…

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous…

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: Given : Mass of butane, C4H10 taken = 26.7 g Mass of oxygen, O2 taken = 46.9 g And mass of water…

Q: Consider the reaction below: MnO2 + HCl --> MnCl2 + Cl2 + H2O If 1.92 mol of MnO2 and 96.4g of…

A: Solution of this question depends on stoichiometric calculations.

Q: Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: The balanced reaction for the liquid hexane, CH3(CH2)4CH3 with oxygen gas, O2 to produce gaseous…

Q: indicate that the coefficients indicate the number of moles that combine and are formed in the…

A: Given, that the coefficients indicate the number of moles that combine and are formed in the…

Q: CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

Q: if 6.7x10^25 molecules of co2 are produced in a combustion reaction how many liters of co2 is…

A: Since moles = number of molecules / Avogadro's number Avogadro's number = 6.022 X 1023 => moles…

Q: For the reaction shown, calculate how many moles of each product form when the given amount of each…

A: Given reaction is a combustion reaction in which a hydrocarbon is burnt in presence of oxygen to…

Q: determine how much lead iodide (in grams) can be formed from 115g of lead nitrate and 265g of…

Q: In the complete combustion of C3H8O3, how many moles of carbon dioxide are produced when 23.0 grams…

Q: N2 + 3H2 ---> 2NH3 How many molecules of ammonia are produced from the reaction of 9.5 x 1023…

A: Nitrogen reacts with hydrogen to form ammonia. The equation for the balanced chemical reaction is…

Q: How many moles of water are produced when 6.33 moles of CH4 react? CH4 (g) + 2O2 (g) --> CO2 (g) +…

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous…

Q: Automobile airbags inflate due to the formation of nitrogen gas from the chemical reaction…

A: The given balanced equation, 2NaN3 (s) --------------> 3N2 (g) + 2 Na (s)

Q: 3. Ammonia can be generated by heating together the solids NH.Cl and Ca(OH)2. CaCl ar H2O are also…

A: Ammonia can be generated by heating together the solids NH4Cl and Ca(OH)2 CaCl2 and H2O are also…

Q: react to form aqueous nitric acid and nitrogen monoxidegas. Suppose you have 7.0 mol of NO2 and 9.0…

Q: If 0.879g of water is produced from the reaction of 1.7g of hexane and 4.0g of oxygen gas,…

Q: 1. How much carbon dioxide (in litres) comes from the reaction of 30.0 g of sodium carbonate…

A: The balanced chemical reaction is given below.

Q: A mixture of 100.0 g of CS2 and 200.0 g Cl2 is passed through a hot reaction tube, where the…

Q: A student runs the reaction represented by the equation below. What mass of H2 gas would be produced…

A: Given, Zn + HCl ------> ZnCl2 + H2 The student have 13.57 g of each reactant. Molar mass of Zn…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: The reaction is: H2SO4 (aq) + 2NaOH (s)→ Na2SO4 (aq) + 4H2O (l) It is an acid base reaction, where…

Q: How many grams of C12H4Cl6 are reacted when 100.25 g CO2 is produced? How many grams of HCl are…

A: In a balanced chemical equation there are equal number of atoms of each element involved in the…

Q: What mass of HCl is produced when 3.00 mol of Cl2 react completely in the following…

Q: Determine the mass of carbon dioxide gas produced (theoretical yield) when 68.0 g of lead (III)…

A: Theoretical yield is the quantity of product obtained when all of the limiting reactant is consumed.…

Q: Based on the balanced equation 4C5H5N + 25O2 → 20CO2 + 10H2O + 2N2 calculate the number of H2O…

A: From the balanced equation: 4 molecules of C5H5N react with 25 molecules of O2 to form 10 molecules…

Q: 2NO(g) + O2(g) → 2NO2(g) You are provided with 4.12 molmol of nitrogen monoxide gas. Using the…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Number of moles can be determined as follows: No.of moles of H2SO4=massmolar mass=42.2 g98.079…

Q: student runs the reaction represented by the equation below. What mass of H2 gas would be produced…

A: Given Reaction:- Zn + HCl --> ZnCl2 + H2 Mass of Zn = 5.63g Balanced Chemical reaction:- Zn…

Q: Aqueous hydrobromic acid HBr reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

Q: A student runs the reaction represented by the equation below. What mass of H2 gas would be produced…

A: Zinc reacts with hydrogen chloride to form zinc chloride. The equation for the balanced chemical…

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: It is given that 1.2 g of butane is reacting with 7.6 g of oxygen gas to produce 1.67 g of carbon…

Q: For the reaction shown, calculate how many moles of each product form when the given amount of each…

Q: The reaction consumes ______ moles of oxygen.

A: Given ;- number of moles of butane = 4 mol To calculate :- Number of moles of O2 Number of moles…

Q: Mercury can be isolated from its ore by the reaction: 4 HgS + 4 CaO → 4 Hg + 3 CaS + CaSO4 How…

A: Balanced chemical equation: 4 HgS + 4 CaO → 4 Hg + 3 CaS + CaSO4 From the above balanced equation:…

Q: The reaction MnO2+HCl--> MnCl2+Cl2+H2O. If 1.92 mol of MnO2 and 96.4g of HCl react, determine the…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Amount of water produced = 0.373 g Mass of H2SO4 = 3.9 g Mass of NaOH = 5.8 g Mass of H2SO4 =…

Q: Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in the…

A: The reaction is given as,

Q: how many molecules of NH3 are produced? molecules of NH3:______ What is the limiting reactant?

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

A: The ratio of actual yield to the theoretical yield multiply by 100 is known as percent yield.

Q: Interpret the following equation for a chemical reaction using the coefficients given: 2 CO(g) +…

A: The balanced reaction taking place is given as, => 2 CO (g) + O2 (g) ----> 2 CO2 (g)

Q: If 25.8g of P4 is allowed to react with 19.2g of S8, which is the limiting reactant. P4+S8 -> P4S3

A: The limiting reagent is the reagent that is used up completely. This stops the reaction and no…

Q: For the reaction shown, calculate how many moles of each product form when the given amount of each…

A: In a chemical reaction, it is the limiting reactant and not the excess reactant that decided the…

Question

Hydrogen gas H2 reacts with nitrogen gas N2 to form ammonia gas NH3 = 3H2g +N2g=2NH3g How many molecules (not moles) of NH3 are produced from 2.09×10^-4g of H2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
4.27 Copper reacts with sulfuric acid according to the following equation: 2H2SO4+CuCuSO4+2H2O+SO2 How many grams of sulfur dioxide are created by this reaction if 14.2 g of copper reacts with 18.0 g of sulfuric acid?
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
One way to remove nitrogen oxide (NO) from smoke-stack emissions is to react it with ammonia. 4NH3(g)+6NO(g)5N2(g)+6H2O(l) Calculate (a) the mass of water produced from 0.839 mol of ammonia. (b) the mass of NO required to react with 3.402 mol of ammonia. (c) the mass of ammonia required to produce 12.0 g of nitrogen gas. (d) the mass of ammonia required to react with 115 g of NO.
For each of the following chemical reactions, calculate the mass of the underlined reactant that is required to produce 1.000 g of the underlined product. (a) Mg_+2HClH2_+MgCl2 (b) 2CuSO4_+4KI2CuI+I2_+2K2SO4 (c) NaBH4_+2H2ONaBO2+4H2_
For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?