Hydrogen produced from a hydrolysis reaction was collected over water. The data is compiled in the table.Total volume of H, (g) collected93.16 mLTemperatureBarometric pressure25.0 'C98.90 kPaVapor pressure of water at 25.0 C3.17 kPaCalculate the moles of hydrogen gas produced by the reaction.moles of H,:

To calculate moles of H2 , we would use ideal gas law and use given values. As gas is collected…

Hydrogen produced from a hydrolysis reaction was collected over water. The data is compiled in the table. Total volume of H, (g) collected 93.16 mL Temperature 25.0 'C Barometric pressure 98.90 kPa Vapor pressure of water at 25.0 C 3.17 kPa Calculate the moles of hydrogen gas produced by the reaction.

Hydrogen produced from a hydrolysis reaction was collected over water. The data is compiled in the table. Total volume of H, (g) collected 93.16 mL Temperature 25.0 'C Barometric pressure 98.90 kPa Vapor pressure of water at 25.0 C 3.17 kPa Calculate the moles of hydrogen gas produced by the reaction.

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter1: Gases And The Zeroth Law Of Thermodynamics

Section: Chapter Questions

Problem 1.25E

See similar textbooks

Similar questions

The chlorofluorocarbon CCl2F2 can be recycled into a different compound by reaction with hydrogen to produce CCl2F2(g), a compound useful in chemical manufacturing: CCl2F2(g)+4H2(g)CH2F2(g)+2HCl(g) (a) Outline the steps necessary to answer the following question: What volume of hydrogen at 225 atm and 35.5 C would be required to react with 1 ton (1.000103kg) of CCl2F2? (b) Answer the question.
Ethanol, C2H5OH, is produced industrially from ethylene, C2H4, by the following sequence of reactions: 3C2H4+2H2SO4C2H5HSO4+( C 2 H 5)2SO4C2H5HSO4+( C 2 H 5)2SO4+3H2O3C2H5OH+2H2SO4 What volume of ethylene at STP is required to produce 1.000 metric ton (1000 kg) of ethanol if the overall yield of ethanol is 90.1%?
A mixture of 0.200 g of 1.00 g of and 0.820 g of Ar is stored in a closed container at STP. Find the volume of the container, assuming that the gases exhibit ideal behavior.
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
An intermediate reaction used in the production of nitrogen-containing fertilizers is that between ammonia and oxygen: 4NH3(g)+5O2(g)4NO(g)+6H2O(g) A 150.0-L reaction chamber is charged with reactants to the following partial pressures at 500C: PNH3=1.3atm, PO2=1.5atm. What is the limiting reactant?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
What is the ratio of the average kinetic energy of a SO2 molecule to that of an O2 molecule in a mixture of two gases? What is the ratio of the root mean square speeds, urms, of the two gases?
Although we: generally think of combustion reactions as involving oxygen gas, other rapid oxidation reactions are also referred to as combustions. For example, if magnesium metal is placed into chlorine gas, a rapid oxidation takes place, and magnesium chloride is produced. msp;Mg(s)+Cl2(g)MgCl2(s) at Volume of chlorine gas, measured at STP, is required to react completely with 1.02gof magnesium?
A mixture of chromium and zinc weighing 0.362 g was reacted with an excess of hydrochloric acid. After all the metals in the mixture reacted, 225 mL dry of hydrogen gas was collected at 27C and 750. torr. Determine the mass percent of Zn in the metal sample. [Zinc reacts with hydrochloric acid to produce zinc chloride and hydrogen gas; chromium reacts with hydrochloric acid to produce chromium(III) chloride and hydrogen gas.]
Under what conditions does the behavior of a real gas begin to differ significantly from the ideal gas law?
Joseph Priestley first prepared pure oxygen by heating mercuric oxide, HgO: 2HgO(s)2Hg(l)+O2(g) (a) Outline the steps necessary to answer the following question: What volume of O2 at 23 C and 0.975 atm is produced by the decomposition of 5.36 g of HgO? (b) Answer the question.