I can't fit both sections of the question itto one shot, so please answer both parts. Thank you very much Identify the neutral element represented by this excited-state electron configuration.excited state: 1s22s²2p 3s²3p³4s'element symbol:Write the full ground-state electron configuration for that element.ground state:25SA stvW Group the electronic configurations of neutral elements in sets according to those you would expect to show similarchemical properties.Note that as long as the configurations are grouped correctly with regard to each other, it does not mattereach group.Set ASet BAnswer Bank1s21. 252p?1s25²2p°3s²3p©4s²3d104p®5s²4d!O5p°6s°4f145d!06p²1s 25 2p°3s²3p®4s²1s2s21s 252p°3523p°4s²3d104p65s²4d105p²25A étv

Since you have posted multiple completely unrelated questions, we are entitled to answer the first…

Identify the neutral element represented by this excited-state electron configuration. excited state: 1s 2s²2p°3s²3p³4s' element symbol: Write the full ground-state electron configuration for that element. ground state:

Identify the neutral element represented by this excited-state electron configuration. excited state: 1s 2s²2p°3s²3p³4s' element symbol: Write the full ground-state electron configuration for that element. ground state:

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter3: Atomic Shells And Classical Models Of Chemical Bonding

Section: Chapter Questions

Problem 10P

See similar textbooks

Related questions

Q: The energy required to ionize sodium is 496 kJ/mol. What minimum frequency of light is required to…

Q: Consider the elements selenium (Z = 34), bromine (Z = 35), and krypton (Z = 36). In their part of…

Q: 3- The electron configurations of two different atoms are: ls²2s²2p° and 1s°2s²2p°3s'. The first…

A: The amount of energy required to eject the most loosely bound electron of an isolated atom in the…

Q: The energies, ? , for the first few states of an unknown element are given in the table in arbitrary…

A: The final energy of electron is the sum of energy in the atom and the energy in the photon and its…

Q: 48,Using complete subshell notation (not abbreviations, 1s22s22p6, and so forth), predict the…

A: solution- (a) carbon - C atomic number- 6 electronic configuration - 1s2,2s2 2p2 (b); phosphorus…

Q: Which electron transition produces light of the highest frequency in the hydrogen atom? a) Sp 1s b)…

A: Correct answer is (a) 5p →1s . Photon of highest energy will release when the transition of electron…

Q: (1) What is the complete ground state electron configuration for the helium atom? (2) What is…

A: 1) Since the atomic number of Helium atom is 2 Hence the complete ground state electron…

Q: Indicate whether energy is emitted or absorbed when thefollowing electronic transitions occur in…

A: Energy is being absorbed when an electron makes a transition from lower energy level to a higher…

Q: The alkali metal, rubidium, has the photoelectric work function of (3.46*10-19) Joules (J). What…

Q: Which element has the spectroscopic notation 1s22s22p63s2 for its ground state electron…

A: Given :- Electron configuration : 1s22s22p63s2 To identify :- The element belongs to the above…

Q: Untitled + X tml?courseld=15539865&HeplD=676f177415469ec3dc78ff3c8bf724d9#10001 nalized Invit... The…

A: Hund’s rule: Each orbital must be singly occupied before electrons occupy orbital doubly. All the…

Q: 83 Which of the following electron configurations corre- sponds to the ground state and which to an…

A: An atom is mainly composed of three sub-particles; electrons, protons and neutrons. These particles…

Q: 1s'2s 2p°3s²3p³ Chemical symbol:

Q: Name the orbitals described by the following quantum numbers a. n = 3, = 2 b. n = 5, = 1…

A: Given quantum numbers are : a. n = 3, = 2 b. n = 5, = 1 c. n = 2, = 0 Name the orbitals = ?…

Q: Consider the atom whose electron configuration is [Ne]3s23p1. Write the one- or two-letter…

A: Electron configuration: [Ne}3s23p1 Atomic number = 13 So, the element is - Aluminum

Q: Write the ground-state electron configurations for the following elements: Ge, Fe, Zn, Ni, W, Tl.

A: The electronic configuration if the given elements is as follows:

Q: Which electron configurations of neutral atoms represent excited states? [Kr]5s'4d$ [Ar]4s?3d I 2s²…

A: For excited state configuration, electron moves from lower energy level to higher energy level. To…

Q: The following do not represent valid ground-state electronconfigurations for an atom either because…

A: According to Pauli's exclusion principle, no two electrons in an atom can have same values of all…

Q: Consider the atom whose electron configuration is [Ne]3s23p5. Write the one- or two-letter symbol…

Q: Which of the following is/ are not correct electron configuration for an atom in its ground state 1s…

A: Hund's rule of maximum multiplicity: According to this rule, while filling electrons in different…

Q: The following electron configurations represent excited states. Identify the element and enter its…

A: Given,Excited state electron configuration is [Kr] 5s2 4d2 5p1

Q: The ground-state electron configurations listed here are incorrect. Explain what mistakes have been…

A: The electronic configuration (electron configuration) given in subshell notation indicates how…

Q: The following orbital-filling diagram represents an excited state rather than the ground state of an…

A: • The given excited state orbital fill diagram of an atom is , • Since, we know that the atomic…

Q: Identify the neutral element represented by this excited-state electron configuration. excited…

A: In an excited state, electrons move from a lower energy level to a higher energy level.

Q: One reason spectroscopists study excited states is to gain information about the energies of…

Q: The following do not represent valid ground-state electron configurations for an atom either because…

A: Pauli's exclusion principles states that no two electrons can have the same value for all quantum…

Q: Question attached

A: The work function (φ∘) of the metal is the minimum energy that is required by the metal to remove…

Q: 1. Which of the following is the electron configuration of an excited state of a copper atom? A.…

A: Excited state configuration is the configuration in which electron from ground state configuration…

Q: Write the ground state electron configurations of the following atoms. а. О b. Р с. К d. Fe e. Sn

Q: Enter the symbol for which this is the electron configuration: 1s'25°2p°3s'3 3s°3p*4s°3d"4p°ss?4d

A: For given configuration, count the total electrons.

Q: A hydrogen atom in the ground state absorbs 13.6 eV of energy. What change does the energy cause to…

A: Given information: Energy absorbed by the hydrogen atom in the ground state = 13.6 eV

Q: quantum numbers corresponding to an atomic orbital is NOT feasible? * n=1, l=0, ml=0 O n=2, l=1,…

A: Given set of Quantum number Not feasible atomic Orbital =?

Q: Consider the atom whose electron configuration is [Ne]3s23p5. a.) Write the one- or two-letter…

A: Given that, An atom has electronic configuration = [Ne]3s23p5 a) the letter symbol for atom as per…

Q: Name the element described in each of the following:(a) Smallest atomic radius in Group 6A(16)(b)…

A: Periodic properties are those which occur after a definite interval of time. In the modern periodic…

Q: 6) Write an acceptable set of the first three quantum numbers for the following electron…

A: Principal quantum number, n is used to determine the energy of electron. Azimuthal quantum number, l…

Q: Of the following electron configurations of neutral atoms, which represents an atom in an excited…

A: Electronic configuration of elements is written by following Aufbau's principle According to…

Q: electron configuration

A: Dear student I have given answer to your question in the image format.

Q: Consider the elements selenium (Z = 34), bromine (Z = 35), and krypton (Z = 36). In their part of…

A: The detailed solution of your question given below- Since, we know that the subshell is s,p,d,f.…

Q: One reason spectroscopists study excited states is to gain information about the energies of…

A: The excited state configuration of an atom is given 1s2 2s2 2p6 3s1 3p1

Q: An atom with 23 electrons in it's ground state is 10 The following electronic configuration [Kr] 4s…

A: Atoms with unpaired electrons are termed as paramagnetic whereas atoms with paired electrons are…

Q: 8. Indicate whether each of the following electron configurations corresponds to the ground state or…

Q: The work function of metal is the minimum energy required to produce photoelectric effect on that…

Q: Using complete subshell notation (not abbreviations, 1s22s22p6, and so forth), predict the electron…

A: Electronic configuration is a way to represent the distribution of electrons in an atom.

Q: Identify the neutral element represented by this excited‑state electron configuration, then write…

A: Given is, excited state: 1s22s12p03s1

Q: Quantum mechanics predicts that the energy of the ground state of the H atom is –13.6 eV. Insight…

A: The energy is absorbed in the form of a photon or any other energy source when an electron from an…

Q: [Ne]3s23p3 is the electron configuration of a(n) ________ atom. a. Sb b. P c. Sn d. V e. As

Q: onsider the atom whose electron configuration is [Ne]3s^2 3p^1 Write the one-or two-letter symbol…

A: Given, electronic Configuration [Ne]3s23p1 Total electrons present are 13

Question

I can't fit both sections of the question itto one shot, so please answer both parts. Thank you very much

Identify the neutral element represented by this excited-state electron configuration.
excited state: 1s22s²2p 3s²3p³4s'
element symbol:
Write the full ground-state electron configuration for that element.
ground state:
25
SA stv
W

Group the electronic configurations of neutral elements in sets according to those you would expect to show similar
chemical properties.
Note that as long as the configurations are grouped correctly with regard to each other, it does not matter
each group.
Set A
Set B
Answer Bank
1s2
1. 252p?
1s25²2p°3s²3p©4s²3d104p®5s²4d!O5p°6s°4f145d!06p²
1s 25 2p°3s²3p®4s²
1s2s2
1s 252p°3523p°4s²3d104p65s²4d105p²
25
A étv

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Consider a hypothetical ionic compound AB (comprised of A+ and B- ions). Given the following enthalpy data and using a Born-Haber cycle calculation, predict ΔHlattice in kJ mol-1. A(s) + B(s) → AB(s) ΔrH = -422 kJ mol-1 A(s) → A(g) ΔrH = 104 kJ mol-1 B(s) → B(g) ΔrH = 92 kJ mol-1 First ionization energy of A(g) = 505 kJ mol-1 Electron affinity enthalpy of B(g) (exothermic) = -316 kJ mol-1
The lattice energy of MgO is 3890 kJ/mol. The first and the second ionization energies (IE1 and IE2) of Mg are 738 kJ/mol and 1450.6 kJ/mol, respectively. The first ionization energy of O is 1314 kJ/mol. The first electron affinity (EA1) of O is +141 kJ/mol. Using these data, as well as data from a table of thermodynamic data at 1 atm and 25°C, determine the second electron affinity for oxygen, EA2(O). kJ/mol
Givethreeexamplesofionsthatwouldbeisoelectronicwithneon1s 2 2s 2 2p 6
Draw a Born–Haber cycle for the formation of LiF(s) from its elements.
Write shortly about the followings:1- Types of bonding2- Ionization potential3- Electron affinity4- Semimetals or metalloids.5- The average valence electron energy (AVEE).
In the series of group 5A hydrides, of general formulaMH3, the measured bond distances are P¬H, 1.419 Å;As¬H, 1.519 Å; Sb¬H, 1.707 Å. (a) Compare these valueswith those estimated by use of the atomic radii inFigure 7.7. (b) Explain the steady increase in M¬H bonddistance in this series in terms of the electron configurationsof the M atoms.
Why is it not possible to displace fluorine from metallic fluorides by any other halogens? Explain based on how their anions behave and elaborate propely pls.
Chlorine reacts with oxygen to form Cl2O7. (a) What is thename of this product ? (b) Write a balancedequation for the formation of Cl2O7(l) from the elements.(c) Would you expect Cl2O7 to be more reactive towardH+(aq) or OH-(aq)? (d) If the oxygen in Cl2O7 is consideredto have the -2 oxidation state, what is the oxidation state ofthe Cl? What is the electron configuration of Cl in this oxidationstate?
1. Explain the anomalous behavior of Li and Be among Group 2 elements. 2. Predict the oxidation state of the central atom in the following oxyanions: 103 XeO4, ТеОб- Justify your answers using periodic trends. 3. Arrange the following elements in order of increasing electronegativity: O, CI, S, Si. Explain your reasoning. 4. Explain the differences in the physical and chemical properties of Na and K based on their atomic structure. 5. Draw the Lewis structure of XeOF4 and predict its VSEPR shape and hybridization. 6. Explain the stability of the dative bond in the complex ion [Fe(CN)6]3. m7. Compare and contrast the bonding in CO2 and SiO2. How do their structures differ? e8. Predict the geometry and magnetic properties of the following complex ions: [Co(NH3)6]3+, [Cr(H2O)6]3+..
Why alkali metals donot exist as free in nature?
Describe as oxides, peroxides or super-oxides the binary of the following oxygen compounds (answers without justification). (a) BaO2 (b) HNO3 (γ) H2S (δ) LiOH (ε) P4O6 (f) P4O10 (g) SO3 (h) RbO2 (i) SrO (i) ZnSO4
Although nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (Nl3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s)+3IF(g)BF3(g)+NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction ( 307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) ( 96 kJ/mol), and BF3(g) ( 1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every l mole of BN. one of the by-products isolated is [IF2]+ [BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?