If someone consumes 21 g of sodium chloride per day, what mass (in grams) of sodium does that person consume? Sodium chloride is 39 % sodium by mass Express the mass to two significant figures and include the appropriate units. ? Value Units

Q: 2) LOH 1) POCI, 2) NaN, 3) H₂O/H NH₂ or Z

A: Here we have to write the mechanism of reaction to get the required target compound from the given…

Q: What is the evidence that a chemical reaction took place?

A:

Q: lak 1/1 Determine the correct thermodynamic properties for this reaction: endothermic with As o…

A:

Q: Calculate the enthalpy change of the products. H₂ + MgCl₂ ΣAH , products = ( ( -641.8 ) + 0 =

A:

Q: A reaction vessel is charged with 0.50 atm of A and 0.850 atm of B. Once the reaction reaches…

A:

Q: Calculate the enthalpy change of the reactants Mg + 2 HCl ΣAH reactant ( 0 + 2 ( 92.3 ) =

A: The amount of energy lost or gained during the course of the reaction is known as the Enthalpy…

Q: Indicate whether the equilibrium will shift RIGHT (products), LEFT (reactants), or NOT AT ALL for…

A: Given :        Zn(s) + 2HCl ⇌ZnCl2(s) +H2 (g) + Heat To find : Effect of change of concentration,…

Q: 9) The major product for the following reaction is: 1. NaBH4 2. H20, H+ OH OH B O-Na+

A: Sodium borohydride, NaBH4 is a reducing agent and it can selectively reduce a carbonyl functional in…

Q: What is potential energy surface (PES)? Draw PES to represent the variation of energy during…

A: Potential energy surface describes the energy of a system, the interaction between different atoms…

Q: Draw structural formulas for the alkoxide ion and the alkyl(aryl)bromide that may be used in a…

A:

Q: 1) HCO + NH3 2) HCl + H₂O → CO² + NH4 H₂O + CI

A:

Q: Rank the following compounds a) diethyl malonate b) 2,4,pentan dione c) ethyl acetoacetate toward…

A: 1) Answer- C 2) Answer- D

Q: O d Oe O a Which of the following bonding patterns of carbon is not allowed in the formation of an…

A: -> Valence electrons in Carbon is 4 .hence , carbon can form maximum 4 bonds .

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: a. b. HBr, A Peroxide NBR, A Peroxide

A: In  reaction a)  Alkene is treated with HBr  in presence of peroxide which follows anti markonikov's…

Q: A cylinder fitted with a frictionless piston contained an ideal gas, with a volume of 23 m³, a…

A:

Q: descrive four factors that influence the sizes of crystal filed splittings in transition metal…

A:

Q: d. ethylpropanoate

A:

Q: The ratio of atoms in HCL is

A: A molecule contains the atoms in a fixed ratio. If this ratio is the minimum possible ratio, the…

Q: H8. Write a children's facts book about electrochemistry for a 5-10-year-old to understand.

A:

Q: Fusion reactions can only occur at high temperatures (thermonuclear reactions). Explain this…

A: The energy liberated is carried primarily by gamma positrons, and neutrinos, as can be seen from the…

Q: Calculate the final volme of diluted 0.70 MM HCl solution prepared from 23 mL of a solution that…

A:

Q: A 34.8 mL sample of a 0.542 M aqueous hypochlorous acid solution is titrated with a 0.325 M aqueous…

A:

Q: N + + -N

A: For aromatic 1) cyclic structure 2) all atoms in cyclic compound should be sp2 hybridised. 3) 4n+2…

Q: Design a buffer that has a pH of 7.24 using one of the weak base/conjugate acid systems shown below.…

A:

Q: Draw the lewis structure for Na2Cl₂?? Attempt only if you can answer in clear handwriting I'll…

A: A question based on atomic structure that is to be accomplished.

Q: 3. Solutions of aqueous CaCl, and aqueous CuSO, are mixed in a beaker. a) Write the balanced…

A: Given: Solutions of aqueous CaCl2 and aqueous CuSO4 are mixed in a beaker. We have to write the…

Q: The following figure shows the schematics of the energy and electronic distribution of the carbon…

A:

Q: A Identify the conjugate acid-base pairs in the following reactions: a. HNO3(aq) + H₂O(l) → NO₂¯(aq)…

A:

Q: Which intermolecular force is generally considered the weakest? O Covalent bonding O London…

A: In this question, we will see that which force is a weakest force between the molecules or atoms.…

Q: Question 10 Given that Keq 2.0 x 10-6 for the following reaction, what is the equilibrium…

A: The equilibrium constant is defined as the ratio of concentration of products to that of…

Q: In the following reactions, label the Lewis acid and Lewis base. Predict the products of the…

A:

Q: A 15% Copper Acetate Cu(CH3COO)2 test solution is prepared using 750 ml of purified water. Where:…

A: As per our guidelines we are supposed to answer only ? 3 sub-parts ( if there are multiple sub-parts…

Q: Which of the following represent closest packing of spheres? 11 III IV O II + IV OI + IV III+IV | +…

A:

Q: 3. Using the balanced equation for the combustion of acetylene (C₂H₂), answer the following…

A: 3) given 2 H-C≡C-H + 5 O2 ➝ 4 CO2 + 2 H2O a) moles of C2H2 react = 1.80 mol moles of O2 needed = ?…

Q: If the density of Carbon tetra chloride is 1.59 g/mL, what is the volume in L of 2.59 kg of carbon…

A:

Q: Q) Write the structure of the Dieckmann cyclization product formed on treatment of each of the…

A:

Q: the equilibrium constant for a particular reaction has been measured at different temperatures. The…

A: The thermodynamics relationship,  □H - T(□S) = -RT×ln(K) ln(K) =  □S/R - □H/T Slope of graph is…

Q: Question 8 Consider the reaction N204(g) + Cl2(g) → 2 NOCI(g) + O2(g) Using the following…

A: Given, a) 2 NOCl(g) ➝ 2 NO(g) + Cl2(g) ∆H° = +75.56 kJ/mol b) 2 NO(g) + O2(g) ➝ 2 NO2(g) ∆H° =…

Q: Assign the absolute configuration of the asymmetric carbon in this structure as R or S. Br OS o…

A:

Q: what would be the percent yeild for the reaction?

A:

Q: Which of the following is false? Maltose is composed of 2 molecules of glucose Galactose is composed…

A:

Q: When a 28.6 mL sample of a 0.394 M aqueous hypochlorous acid solution is titrated with a 0.481 M…

A: The solution is given below -

Q: QUESTION 3 33.64 grams of ammonium chloride ( NH4Cl ) is dissolved in 100.0 grams of water . For…

A: Here we are required to find the boiling point of solution

Q: Use the following information to answer the next question. OH When this compound reacts with an…

A: The compound having the hydroxyl group (-OH) is known as alcohol.  The compound having COOH group is…

Q: 150.0 mL of 0.200 mol/L HBr is added to 150.0 ml of 0.200 mol/L KOH. The temperature of the…

A:

Q: Calculate the pH at 25°C of a 0.0099 M solution of a weak base with a Kp of 8.4 x 10⁹. pH

A:

Q: Provide the correct IUPAC/systematic name for the following compound. Br

A:

Q: The conjugate base of a weak acid is? a. strong acid b. weak base c. weak acid d. strong base (i…

A: The answer is given below

Q: 1. Draw the following compounds 2-methyl butanoic acid b. 3-ethyl-2-hexanone

A: 1) 2-Methyl butanoic acid    2-Methyl butanoic acid are called as 2-methylbutyric acid is a…

Matter and Measurement

In the universe, there is matter, energy, and void space. The universe contains energy and void space. The definition of matter can be considered as something which possesses mass and consumes space. Chemistry is that branch of science which deals with the study of matter. Under chemistry, nature, composition, and the changes occurring to matter are discussed.