7. In experiment #1, A mixture was prepared using 20 mL of 2.0M acetone, 20mL of 1.50 M C2CHCOOH 1, 10 mL of 0.0050M iodine and 50 mL H20,when the reaction reached to equilibrium the concentration of Cl2CHCOO= 0.032 M, the Ka is:a) 3.82 × 103c) 1.2 x 105e) 0.025b) 0.055d) 3.08 x 104

Given data,Molarity of acetone=2.0MVolume of acetone=20mLMolarity of Cl2CHCOOH=1.50MVolume of…

In experiment #1, A mixture was prepared using 20 mL of 2.0M acetone, 20 mL of 1.50 M Cl2CHCOOH 1, 10 mL of 0.0050M iodine and 50 mL H2O when the reaction reached to equilibrium the concentration of C2CHCOO = 0.032 M, the Ka is: a) 3.82 x 103 c) 1.2 x 105 e) 0.025 b) 0.055 d) 3.08 x 104

In experiment #1, A mixture was prepared using 20 mL of 2.0M acetone, 20 mL of 1.50 M Cl2CHCOOH 1, 10 mL of 0.0050M iodine and 50 mL H2O when the reaction reached to equilibrium the concentration of C2CHCOO = 0.032 M, the Ka is: a) 3.82 x 103 c) 1.2 x 105 e) 0.025 b) 0.055 d) 3.08 x 104

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 16Q: Suppose a reaction has the equilibrium constant K = 1.7 108 at a particular temperature. Will there...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
What are the concentrations of PCl5, PCl3, and Cl2 in an equilibrium mixture produced by the decomposition of a sample of pure PCI5 with [PCl5]=2.00M? PCl5(g)PCl3(g)+Cl2(g)Kc=0.0211
What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
The following question is taken from a Chemistry Advanced Placement Examination and is used with the permission of the Educational Testing Service. Solve the following problem: MgF2(s)Mg2+(aq)+2F(aq) In a saturated solution of MgF2 at 18 C, the concentration of Mg2+ is 1.21103M . The equilibrium is represented by the preceding equation. (a) Write the expression for the solubility-product constant, Ksp, and calculate its value at 18 C. (b) Calculate the equilibrium concentration of Mg2+ in 1.000 L of saturated MgF2 solution at 18 C to which 0.100 mol of solid KF has been added. The KF dissolves completely. Assume the volume change is negligible. (c) Predict whether a precipitate of MgF2 will form when 100.0 mL of a 3.00103 -M solution of Mg(NO3)2 is mixed with 200.0 mL of a .2.00103 -M solution of NaF at 18 C. Show the calculations to support your prediction.. (d) At 27 C the concentration of Mg2+ in a saturated solution of MgF2 is 1.17103M . Is the dissolving of MgF2 in water all endothermic or an exothermic process? Give an explanation to support your conclusion.
. The solubility product of iron(III) hydroxide is very small: Ksp=41038at 25 °C. A classical method of analysis for unknown samples containing iron is to add NaOH or NH3. This precipitates Fe(OH)3, which can then be filtered and weighed. To demonstrate that the concentration of iron remaining in solution in such a sample is very small, calculate the solubility of Fe(OH)3in moles per liter and in grams per liter.
Data for the reaction [Mn(CO)5(CH3CN)]+ + NC5H5 (Mn(CO)5(NC5H5)]+ + CH3CN are given in the table. Calculate Ea from a plot of In k versus 1/T.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
. Lead(II) chloride, PbCl2(s), dissolves in water to the extent of approximately 3.6102Mat 20 °C. Calculate Kspfor PbCl2(s), and calculate its solubility in grams per liter.