Given the following half cell reactions and their standard elctrode potentials: Which species is the strongest reducing agent? Give a reason for your choice. Given the following half cell reactions and their standard electrode poterntials:Half reactionE"/VCu?* + 2e = Cu(s)B Zn2 (aq) + 2e = Znc C,0, (aq) + 14H (aq) + 6e = 2Cr (aq) + 7H,0(1)1,(aq) + 2e = 21(aq)Fe (aq) + e Fe*(aq)A+ 0.34- 0.76+ 1.33D+ 0.54+ 0.77

The process of gain of electrons is known as reduction whereas loss of electrons is called…

Answered: iven the following half cell reactions…

iven the following half cell reactions and their standard elctrode potentials: Which species is the strongest reducing agent? Give a reason for your choice.

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.4QAP

See similar textbooks

Related questions

Q: Calculate the equilibrium constant, Keg, for the galvanic cell performing the following reaction at…

Q: Explain the galvanic cell in terms of oxidation and reduction half-cells whose voltages can be used…

A: Galvanic cell is an electrochemical cell which converts chemical energy of the redox reactions into…

Q: Calculate AGixn and Eo (cell

Q: A concentration cell similar to the one shown is composed of two Mn electrodes and solutions of…

A: Concentration cells use same electrode but the concentration of electrolytic solution varies. They…

Q: Consider an electrolytic cell where silver metal is plated (reduced) from an aqueous silver nitrate…

Q: Calculate the standard cell potential for the reaction below and note whether the reaction is…

A: Since we know that for spontaneous reaction standard Gibbs free energy change is negative....

Q: 1. Write the reduction half-cell reaction and their corresponding standard reduction potentials (°E)…

Q: The galvanic cell utilizes the following reaction of oxidation of iron and reduction of cadmium at…

A: Fe + Cd+2 - - - - - > Fe+2 + Cd Cd+2 +2e- - - - - - > Cd E° = - 0.40 V Fe - - -…

Q: A certain half-reaction has a standard reduction potential E=-1.33 V. An engineer proposes using…

A: Answer: For an electrical cell its cell potential will always be: E°cell=E°cathode-E°anode Given…

Q: SHE and cadmium electrode.

A: the SHE (standard hydrogen electrode) is universally accepted reference electrode, whose potential…

Q: Why is zero potential possible in electrolysis but not in galvanic cell?

A: In an electrolytic cell, the external electric source is applied for the chemical reaction to occur.…

Q: A galvanic (voltaic) cell consists of an electrode composed of chromium in a 1.0 Mchromium(III) ion…

A: Here we are required to find the standard cell potential of the given electrochemical reaction

Q: Calculate the theoretical cell potential of the following cell. If the cell is short-circuited,…

A: The given cell notation is: Ag(s)|Ag+(aq)(0.0575 M) || H+(aq)(0.0333 M)| O2(g)(1.12 atm), Pt The…

Q: Calculate the standard cell potential, ?∘cell, for the equation Zn(s)+F2(g)⟶Zn2+(aq)+2F−(aq) Use…

Q: How is the cell potential of an electrochemical cell (E°cell) related to the potentials of the…

A: The cell potential, Ecell is the measure of the potential difference between two half cells in an…

Q: Batteries are charged and discharged due to the concentration of the solutions inside. Calculate the…

A: The standard Reduction potential of Zn2+, E◦red.= -0.76 V The standard Reduction potential of X2+,…

Q: What is the standard cell potential of an electrochemical cell with the overall reaction below? Is…

Q: For the following electrochemical cell: a)Calculate the thermodynamic potential and the free energy…

Q: Calculate the standard state cell potential for the reaction below given the standard reduction…

A: To solve this problem we need to write the oxidation half and reduction half reaction and According…

Q: Describe how to predict the spontaneity of redox reactions, based on overall cell potential as…

A: A question to describe about determining spontaneity, which is to be accomplished.

Q: (a) Write the half-reactions predicted to occur at the anode and cathode, based on the standard cell…

Q: In a galvanic cell, a full redox reaction takes place, one half-reaction at each electrode. How is…

Q: An electrolytic cell for depositing copper from copper sulfate solutions is placed in series with…

A: We use the formula below to find the weight of a metal(W) deposited in an electrode during…

Q: b. Assuming the two half cells operate at standard conditions, calculate the standard reduction…

A: Recall the given half-cell reactions : HgO s + H2O l + 2 e- → Hg l +…

Q: Discuss why it is impossible to measure the standard reduction potential of a single half-reaction.

A: A Redox reaction leads to oxidation and reduction processes simultaneously. Oxidation and reduction…

Q: Consider an electrochemical cell constructed from the following half cells, linked by an external…

A: Standard reduction potential (SRP) values of given electrodes are EAl+3/Alo = - 1.66 V <…

Q: identify the half-reaction and calculate the cell potential of the following reactions. The cell…

A: Greater the value of standard reduction potential, greater is the tendency to get reduce and…

Q: +6H20

Q: What is the standard cell potential for the reaction below?

A: In the given reaction: Lead (Pb) is getting oxidized. Bromine (Br) is getting reduced. So, the…

Q: Determine the overall reaction and its standard cell potential at 25 °C for the reaction involving…

A: The galvanic cell involves the conversion of the energy associated with the redox chemical reaction…

Q: In an electrolytic cell, does the reaction of electrolysis of water take place in a standard state?

A: Here we to explain whether the reaction of elctrolysis of water takes place in standard state or…

Q: What is the EMF of a galvanic cell if the standard reduction potential of the reduction…

Q: A certain half-reaction has a standard reduction potential Ered=-0.53 V. An engineer proposes using…

A: A question based on electrochemical cells that is to be accomplished.

Q: What aspects of an electrochemical cell can be manipulated to obtain the highest cell potential for…

A: A question based on the performance of electrochemical cell, which is to be accomplished.

Q: How is the cell potential of an electrochemical cell related to the potentials of the half-cells?

A: An electrochemical cell or a galvanic cell is a device that can generate electricity due to the…

Q: a) The more (positive or negative) the value of the standard reduction electrode potential, the…

A: Two half-reactions are involved in the net cell reaction. They occur in separate containers or…

Q: At 25 C, the standard hydrogen electrode (SHE) has a half-cell potential that is defined to be 0.00…

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M iron(II) ion solution…

A: Answer: the standard potential for this cell at 25°C is 1.96 V.

Q: What is the decomposition potential and how it can be measured?

Q: The Nernst equation can be used to calculate... A. cell potentials from standard cell potentials…

A: According to the nernst equation, the cell potential is given as Ecell = E0cell - (0.0591/n) log(Q)…

Q: Batteries are charged and discharged due to the concentration of the solutions inside. Calculate the…

A: Given, The voltage of a battery made from zinc in a 0.1M solution of Zn2+ and a metal X in a 1 M…

Q: Calculate the standard cell potential and note whether the reaction is spontaneous under standard…

A: The more positive reduction potential of reduction reactions are more spontaneous. When viewing a…

Q: A certain half-reaction has a standard reduction potential Eed = +0.01 V. An engineer proposes using…

A: E˚cathode is given as 0.01 V. E˚cell is 1.00 V. Thus E˚anode can be calculated as follows:

Q: The electrode in any half-cell with a [ Select ] tendency to undergo reduction is negatively charged…

A: First let us discuss some basic of OXIDATION and REDUCTION - OXIDATION is defined as loss of…

Q: Given the following half cell reactions and their standard elctrode potentials: Which of the…

A: Oxidizing agent is the compound that that has the ability to oxidized other substances with help of…

Q: A galvanic (voltaic) cell consists of an electrode composed of nickel in a 1.0 M nickel(II) ion…

A: Standard potential for this cell, E°cell = E°cathode-E°anode Now, E°(Ag+/Ag) = 0.80 V E°(Ni2+/Ni)…

Q: Determine the overall reaction and its standard cell potential at 25 °C for these reactions. Is the…

A: 2H+aq+2e-→H2g E°=0.00 VoltBr2l+2e-→2Br-aqE°=1.07 voltCell RepresentationAnode II…

Q: A certain half-reaction has a standard reduction potential E=-0.80 V. An engineer proposes using…

A: Answer

Q: Determine the overall reaction and its standard cell potential at 25 °C for the reaction involving…

A: Aluminum nitrate = Al(NO3)3

Q: 3. Suppose you discovered un unknown metal called "Dodatium". A series of experiments where the new…

A: We are given the cell reactions of Dodatium(Do) with Zn, Cu, and Ag along with the respective…

Question

Given the following half cell reactions and their standard elctrode potentials:

Which species is the strongest reducing agent? Give a reason for your choice.

Given the following half cell reactions and their standard electrode poterntials:
Half reaction
E"/V
Cu?* + 2e = Cu(s)
B Zn2 (aq) + 2e = Zn
c C,0, (aq) + 14H (aq) + 6e = 2Cr (aq) + 7H,0(1)
1,(aq) + 2e = 21(aq)
Fe (aq) + e Fe*(aq)
A
+ 0.34
- 0.76
+ 1.33
D
+ 0.54
+ 0.77

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?