Which of the following reactions involve homogeneous equilibria and which involve heterogeneous equilibria?[References]2NO(g) + O2(g) 2NO, (g)a.O homogeneousO heterogeneousb.CACO3 (s) CaO(s) + CO; (9)O homogeneousheterogeneousC.Fe, O3 (s) + 3CO(g) 2Fe(s) + 3CO2 (9)OhomogeneousOheterogeneousd.2NH, (g) + 3CUO(s) 3H2 O(g) N2 (g) 3Cu(s)homogeneousheterogeneous

Answered: Image /qna-images/answer/c83947cc-13fe-4d41-997c-aa7d7e1f1a91.jpg

nich of the following reactions involve homogeneous equilibria and which involve heterogeneous equilibria? [References] 2NO(g) + O2(g) = 2NO2 (9) a. homogeneous O heterogeneous b. CACO3 (s) CaO(s) + CO2 (g) O homogeneous O heterogeneous Fe2 O3 (s) + 3C0(g) 2Fe(s) + 3CO2 (9) C. O homogeneous heterogeneous d. 2NH3 (9) + 3Cu0(s) = 3H20(g) + N2 (g) + 3Cu(s) Ohomogeneous heterogeneous

nich of the following reactions involve homogeneous equilibria and which involve heterogeneous equilibria? [References] 2NO(g) + O2(g) = 2NO2 (9) a. homogeneous O heterogeneous b. CACO3 (s) CaO(s) + CO2 (g) O homogeneous O heterogeneous Fe2 O3 (s) + 3C0(g) 2Fe(s) + 3CO2 (9) C. O homogeneous heterogeneous d. 2NH3 (9) + 3Cu0(s) = 3H20(g) + N2 (g) + 3Cu(s) Ohomogeneous heterogeneous

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 5RQ: What are homogeneous equilibria? Heterogeneous equilibria? What is the difference in writing K...

See similar textbooks

Similar questions

Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
What are homogeneous equilibria? Heterogeneous equilibria? What is the difference in writing K expressions for homogeneous versus heterogeneous reactions? Summarize which species are included in the K expression and which species are not included.
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?
The following data are for the system A(g)2B(g) (a) How long does it take the system to reach equilibrium? (b) How does the rate of the forward reaction compare with the rate of the reverse reaction after 45 s? After 90 s?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
. Gaseous phosphorus pentachloride decomposes according to the reaction PCl5(g)PCl3(g)+Cl2(g)The equilibrium system was analyzed at a particular temperature, and the concentrations of the substances present were determined to be [PCl5]=1.1102M,[PCl3]=0.325M. and [Cl2]=3.9103M. Calculate the value of K for the reaction.
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
In Table 12.1 (←Sec. 12-3a) the equilibrium constant for the reaction ⇋ is given as 4.2 × 1052. If this reaction is so product-favored, why can large piles of yellow sulfur exist in our environment (as they do in Louisiana and Texas)?
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
12.42 The following reaction is in equilibrium in lake water: HCO,_(aq) + H+(aq)«=*H,CO,(aq) Predict the change in the reaction quotient, Q, for each disturbance below and use that prediction to explain how the equilibrium is shifted by the stress. NaHCOj is added to the lake. H,CO}is added. NaOH is added.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?