Which statement is true about the reaction quotient Qc? It tells if a system is at equilibrium but cannot predict how it will shift It is calculated based on the initial concentrations It can be determined for homogeneous equilibria only O It cannot be equal to Kc

Which statement is true about the reaction quotient Qc? It tells if a system is at equilibrium but cannot predict how it will shift It is calculated based on the initial concentrations It can be determined for homogeneous equilibria only O It cannot be equal to Kc

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 37P

See similar textbooks

Related questions

Q: At a certain temperature the equilibrium constant, Kc, equals 0.11 for the reaction: 2 ICl(g) ⇌…

A: To solve this problem we will first write the Equilibrium expression of given chemical equation .…

Q: The equilibrium constant for the reaction N2(g) + 3H2(g) ➡ 2NH3(g) is 1.0 x 10-1 at…

A: The change in temperature affect the rate of reaction. As the rate of reaction is changes the…

Q: For an exothermic reaction A(aq) + B(s) ⇌ 2C(aq) + D(aq), the concentration-based equilibrium…

Q: 2. Define reaction quotient. How does it differ from equilibrium constant?

A: Dear student, since you have asked multiple questions but according to guidelines we will solve 1st…

Q: At 100 °C, Keg = 1.5E8 for the reaction: CO(g) + Cl2(g) - COCI2(g) Using appropriate approximation,…

Q: Ammonia was produced by reacting nitrogen and hydrogen gases at 350°C according to the reaction…

Q: Consider this equilibrium reaction at 400 K. Br, (g) + Cl, (g) = 2 BRCI(g) K. = 7.0 = 0.00415 M,…

Q: Consider the reaction CO(g)+H2O(g)⇄CO2(g)+H2(g) Kc= 102 at 500 K If a reaction mixture…

A: Given: Reaction: CO (g) + H2O (g)⇔CO2 (g) + H2 (g) Kc = 102 Initial moles of CO = 0.0625 mol Initial…

Q: You place 1.95 mol of NOCI(g) in a reaction vessel. Equilibrium at constant pressure is established…

A: ∆H°f is enthalpy of formation when 1 mole of compound is formed from its element at standard…

Q: For the gas-phase reaction 2SO2 + 02 2SO3, observed mole fractions for a certain equilibrium mixture…

A: Mole fraction is equal to number of moles of a compound divided by total number of moles of present…

Q: Initially, a mixture of 0.200 M NO, 0.100 M H2, 0.200 M H2o was permitted to reach equilibrium(…

A: Solution- Kc is the equilibrium constant, which is defined as the ratio of the concentration of…

Q: For the reaction: 2 NO2 (g) ⇄ N2O4 (g) Kc = 68.6 at 298.15 K • A reaction mixture starts with the…

Q: Write the equilibrium-constant, Kp, expression for the reaction A(g) + 4 B(1) = 3 C(g) + D(g) Answer…

Q: NH4HS decomposes according to the following reaction, with an equilibrium constant K of 0.11 to 298…

A: NH4HS decomposes according to the following reaction: NH4HS(s) ↔ NH3(g)+H2S(g) KP=0.11 at 298K

Q: Calculating equilibrium concentrations using the reaction quotient 1. For the reaction H2(g) + F2(9)…

Q: Explain in what circumstances (in other words, what kind of questions you would be answering) when…

A: Answer -1

Q: 2) Consider the reaction: Br2(g) + Cl2(g) 2BRCI(g) KR = 1.11 x 10-4 at 150 K A reaction mixture…

A: KP is called the equilibrium constant at constant pressure The formula to express the KP is…

Q: The equilibrium constant, Kc, for the following reaction is 1.29x10-2 at 6000 K. cocI2(g) co(g) +…

Q: The equilibrium constant for the reaction 2HI (g) ⇌ H2 (g) + I2 (g) is 115. If 2.7 mol HI is put…

Q: The equilibrium constant (K) of the reaction below is K = 6.0 x 10-2, N2(g) + 3H2(g) ⇌ 2NH3(g)…

A: Nitrogen and hydrogen react to form ammonia. The equilibrium of the ammonia formation is as follows:…

Q: An equilibrium mixture, 2 SO2e) + Oz@) was found to contain 96.0 g SO3, 25.6 g SO2 and 19.2 g O2.…

A: Consider the given information is as follows; Equilibrium mass of SO3 = 96.0 g Equilibrium mass of…

Q: The equilibrium constant Kp= 8.70x10^-1 for the following reaction in the gas phase at a given…

A: Pressure of H2O and Cl2O are given equal to 0.386 bar for each. Kp = 0.870

Q: A flask containing pure NO2 was heated to 1250 K, a temperature at which the value of Kp for the…

Q: The equilibrium constant K. for the reaction 2A + B5C+D is 0.133 at a certain temperature. What…

A: Equilibrium constant ( Kc) is the ratio of concentration of products to concentration of reactants…

Q: 5.2 At 1000 K, the value of Kp is 0.0342 for the reaction: 2 SO3 (g) 2 SO2 (g) + O2 (g) If the…

A: Solution: For the reverse reaction its equilibrium constant is one of the important factor we have…

Q: Consider the following reaction: A+B+C+3 D The reaction mixture is initially at equilibrium with [A]…

A: The reaction given is, => Given: Initial equilibrium concentrations of species are . And all the…

Q: If the reaction quotient for a reaction is larger than the equilibrium constant (i.e., Qc > K) then…

A: We have to predict correct statement for direction of equilibrium

Q: Equilibrium is established for the reaction 2X(s) + Y(g) - 22(g) at 500K, K, = 100. Determine the…

A: Kc is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: A vessel originally contained 0.200 mol iodine monobromide (IBr), 0.0010 mol I2, and 0.0010 mol…

Q: For the exothermic reaction 2HI = H + I) , K, = 1.81 x 10² at 700K. %3D a. If a 1.00 L container of…

A: The given reaction is: 2 HI (g) ⇌ H2 (g) + I2 (g) T= 700 KKp =…

Q: The equilibrium below was studied at 273K and was determined to have Kc to be 1.4 × 10^2 for the…

A: Given Initial Concentration of H2 and Cl2 = 0.1M Kc = 1.4 × 102

Q: Consider the reaction 2NO(g)+Br2(g)⇌2NOBr(g) Kp=28.4, at 298 K In a reaction mixture at…

A: Kp is a equilibrium constant and it is define for partial pressure of reactant and product KPis the…

Q: Write the equilibrium-constant, Kp, expression for the reaction A(g) + 4 B(1) = 3C(g) + D(g) Answer…

A: Answer:- This question is answered by using the simple concept of writing the expression of…

Q: Consider the reaction 2HIl (g) H2(g) + H2(g) The partial pressures of H2 and l2 at equilibrium are…

A: Consider the given reaction is as follows; 2 HI g ↔ I2 g + H2 g Given…

Q: The equilibrium constant, K., for the following reaction is 1.51×102 at 635 K. 2HI(g) =H2(g) + I½(g)…

A: Given- Reaction 2HI (g) <---> H2 (g) + I2 (g) Kc= 1.51 x 10-2…

Q: 5. Consider the following reaction: 2NOCI (g) = 2NO (g) + Cl2 (g) a. Write the reaction quotient and…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: A reaction is prepared by adding 2.000 mol each of H2, 12, and HI gases to a 1.0 L container. They…

Q: At 100 °C, Kea = 1.5E8 for the reaction: CO(g) + Cl2(g) – COCI2(g) Using appropriate approximation,…

A: The given equilibrium reaction is: CO(g) + Cl2(g) ⇌ COCl2(g) ; Keq = 1.5*108 Initially we have…

Q: Consider the following reaction: 2HI(g) ⇄ H2(g) + I2(g) At 500 K, the equilibrium constant, Kp is…

A: From the initial concentration of HI, we need to find the equilibrium concentration of H2. Given,Kp…

Q: A chemical engineer is studying the following reaction: 2 NO(9)+2H,(g) N(g)+2H,0(9) At the…

A: Answer: To solve this question we have to calculate the reaction quotient of the reaction. Reaction…

Q: Consider the reaction: CO(g)+H2O(g)⇌CO2(g)+H2(g) Kc=102 at 500 K A reaction mixture initially…

A: The reaction and the given data is,

Q: 2. For the reaction A, 2A in a closed container, the relation between the degree of dissociation…

Q: quilibrium constant, Ke, for the following reaction is 77.5 at 600 K. D- Ch(e) COC½(g) late the…

A: Volume = 1.00 L Moles of CO = 0.593 moles

Q: The reaction NO (g) « N2 (g) + O2 (g) has a value of KC = 2400 at a temperature of 2000 K. If 0.61 g…

A: Equilibrium constant can be written as the ratio of product to the reactant.

Q: Consider the equilibrium system described by the chemical reaction below. The decomposition of NOBr…

Q: Consider the reaction; N2(g) + O2(g)⇆ 2 NO(g) where K = 0.10. Starting with initial…

A: Given : Initial concentrations as [N2 ] = 0.04 M And [O2 ] = 0.40 M The reaction given is N2(g) +…

Q: The equilibrium constant, Kc, for the following reaction is 33.3 at 297 K. 2CH2CI2(g)=CH4(g) +…

Q: Consider the following reaction: CO(g) + H2O(g) = CO2(g) + H2(g) K, = 0.0611 at 2000 K A reaction…

Question

100%

Which statement is true about the
reaction quotient Qc?
It tells if a system is at equilibrium but
cannot predict how it will shift
It is calculated based on the initial
concentrations
It can be determined for
homogeneous equilibria only
O It cannot be equal to Kc

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
5.22. True or false: If for a gas-phase reaction, then all equilibrium partial pressures of reactants and products must equal . Explain your choice.
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the system 2SO3(g)2SO2(g)+O2(g) K=1.32 at 627. What is the equilibrium constant at 555C?
For the following system, K=4.86105 at 298K: HClO(aq)+F(aq)ClO(aq)+HF(aq) Assuming that you start with equal concentrations of HClO and F, and that no ClO or HF is initially present, which of the following best describes the equilibrium system: a the forward reaction is favored at equilibrium; b the reverse reaction is favored at equilibrium; c appreciable quantities of all species are present at equilibrium?
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
7.6. The production of nitrogen gas for automobile airbags takes advantage of the following chemical reaction: If this reaction were in equilibrium, how many degrees of freedom would be necessary to describe the system?
The following reaction has KP=4.50105 at 720 K. N2(g)+3H2(g)2NH3 If a reaction vessel is filled with each gas to the partial pressures listed, in which direction will it shift to reach equilibrium? P(NH3)=93atm,P(N2)=48atm, and P(H2)=52
5.16. In atmospheric chemistry, the following chemical reaction converts , the predominant oxide of sulfur that comes from combustion of S-containing materials, to , which can combine with to make sulfuric acid (and thus contribute to acid rain): (a) Write the expression for K for this equilibrium. (b) Calculate the value of for this equilibrium using the values in Appendix 2. (c) Calculate the value of K for this equilibrium. (d) If of and of are enclosed in a system in the presence of some liquid, in which direction would the reaction move?
Carbon tetrachloride, an important industrial solvent, is prepared by the chlorination of methane at 850 K. CH4(g)+4Cl2(g)CCl4(g)+4HCl(g) What is the equilibrium constant for the reaction at 850 K? Would the reaction vessel need to be heated or cooled to keep the temperature of the reaction constant?