onone is a compound that gives violets their aroma The small, edible, purple flowers of violets are used in salads and to make teas. Liquid lonone has a density of 0.935 g/ml. X Incorrect: Try Again; 6 attempts remaining Part H How many mililiters of hydrogen gas are needed at STP to completely react 3.9 mL of ionone? Express your answer to two significant figures and include the appropriate units. 12 Submit PA 4 A mL Previous Answers Request Antwer X Incorrect Try Again: 4 attempts remaining

onone is a compound that gives violets their aroma The small, edible, purple flowers of violets are used in salads and to make teas. Liquid lonone has a density of 0.935 g/ml. X Incorrect: Try Again; 6 attempts remaining Part H How many mililiters of hydrogen gas are needed at STP to completely react 3.9 mL of ionone? Express your answer to two significant figures and include the appropriate units. 12 Submit PA 4 A mL Previous Answers Request Antwer X Incorrect Try Again: 4 attempts remaining

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter5: Gases

Section: Chapter Questions

Problem 5.103PAE

See similar textbooks

Similar questions

What is the value of the ideal gas constant R if the volume is specified in milliliters rather than liters?
5-46 Calculate the molar mass of a gas if 3.30 g of the gas occupies 660. mL. at 735 mm Hg and 27°C.
A four-liter tank is filled with propane gas, C3H8. The mass of the tank filled with gas is 1236 g. The pressure in the tank is 2.68 atm. The temperature in the room is 37C. The propane in the tank is used up under the same conditions of temperature and pressure. What is the mass of the empty tank?
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
5-37 A sample of a gas at 77°C and 1.33 atm occupies a volume of 50.3 L. (a) How many moles of the gas are present? (b) Does your answer depend on knowing what gas it is?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
Although we: generally think of combustion reactions as involving oxygen gas, other rapid oxidation reactions are also referred to as combustions. For example, if magnesium metal is placed into chlorine gas, a rapid oxidation takes place, and magnesium chloride is produced. msp;Mg(s)+Cl2(g)MgCl2(s) at Volume of chlorine gas, measured at STP, is required to react completely with 1.02gof magnesium?
5-39 An 8.00-g sample of a gas occupies 22.4 L at 2.00 atm and 273 K. What is the molar mass of the gas?
An alternate way to state Avogadro’s law is A1l other things being equal, the number of molecules in a gas is directly proportional to the volume of the gas. (a) What is the meaning of the term directly proportional? (b) What are the other things that must be equal
What is the temperature of an 11.2-L sample of carbon monoxide, CO, at 744 torr if it occupies 13.3 L at 55 C and 74-4 torr?
5-38 What is the volume in liters occupied by 1.21 g of Freon-12 gas, CCI2F2, at 0.980 atm and 35°C?
perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.