Organic Christry The resulting the reaction CH3TH3C-C-CH3H3CCH3Na₂Cr₂O7H₂O, 95 °C зовОН??ОН

In the first case the two methyl group are oxidized to acid , but the bulky group remain unchanged…

Answered: Organic Christry The resulting the…

Science

Chemistry

Organic Christry The resulting the reaction

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter4: Organic Compounds: Cycloalkanes And Their Stereochemistry

Section4.SE: Something Extra

Problem 40AP: From the data in Figure 4-12 and Table 4-1, estimate the percentages of molecules that have their...

See similar textbooks

Related questions

Q: 2. Describe the type of browning reaction and catalyst involved in the following equation: OH LOH 2…

Q: 2-methylpropanoic acid has a higher pH than 2-chloropropanoic acid. Select one: O True O False

Q: 3. What mass of water would need to evaporate from your skin in order to dissipate 1.7X10³ J of heat…

A: Given : ∆Hvap = 2261 J/g Heat given (q) = 1.7 x 105 J

Q: Calculate the degrees of unsaturation of the following molecular formula, and propose valid…

Q: 7. One mole of an ideal gas at 27°C and 1 atm is compressed adiabatically and reversibly to a final…

Q: A solution is prepared by mixing 5 ml of ethyl alcohol in 100 ml of water. What is the volume…

A: Here we are required to find the volume percentage of ethanol in the solution

Q: 1. Find the pH of a solution having H+ concentration of 3.52 x 10-11. 2. What is the pH of a…

Q: Volhard method is supported by the following statements EXCEPT_ Choose the best answer. Titration…

A: The given statements are 1-Titration can be done even at a pH lower than 6.5 2-The endpoint of the…

Q: Choose the correct answer and briefly explain yo a. The most reactive alkyl halide in a E1 reactio…

A: Here we are required to compare the compound towards a Particular reaction pathway .

Q: 2. Calculate the amount of heat needed to melt 2.00 kilogram of iron at its melting point (1,809 K),…

Q: Question 6 Which type of distillation is used for miscible liquids with large gap of vapor pressure?…

A: Distillation can be defined as the process of separation of components of a liquid mixture. There…

Q: Match the following redox titration methods to their corresponding titrants. KMnO4 solution Na2S2O3…

Q: 4. Calculate the rate constant. A. 0.30 B. 3.0 C. 15 D. 30. 5. What is the unit of the rate…

Q: 1. How much work was done when 46 kJ of energy was spent on compressing a gas as it released 28 kJ…

Q: Which of the following reactions is an example of an elimination reaction? A) CH₂ CH₂ CH₂CH₂ Ch -…

Q: what electrochemical reaction uses in Disk battery - Lithium Battery and why the electrochemical…

A: In a disc-shaped Lithium-ion battery, the chemicals used are CoO2, Li+, and LiC6 polymer.

Q: A water sample was analyzed for the total hardness through the reaction between the sample and EDTA.…

A: given data EDTA mass consumed caco3 0.5467 g volume consumed 8.40 ml HARDNESS OF WATER volume 25.0…

Q: The IR spectrum below represents which of the following compounds? Absorbance/% WWW 100 4000 3000…

A: IR spectroscopy is an important tool for the determination of the functional group in the compound.…

Q: Question 16 Which one of the following is a physical change? A. CH4(g) +202(g) → 2H₂O(g) + CO2(g) C.…

A: Q-16) A physical change is :- H2O (s) →H2O (l) (Option- C)

Q: 4. Based on the equation below, how many moles of aluminum sulfate (Al(SO4)3) will be produced from…

A: Solutions- Given-5.8 moles of aluminum hydroxide Al(OH)3) and excess sulfuric acid (H2S04)?…

Q: 6. 5. 3. 2. Name: Net Ionic Equation Worksheet. Date: Write balanced molecular, ionic, and complete…

A: 1) NaCl(aq) + Pb(NO3)2(aq) --------> PbCl2(s) + NaNO3(aq)…

Q: Calculate the amount of 6M HCl required to neutralize the solutions in beakers #1 and #2. Note:…

A: Solution - According to the question - Given -

Q: Knowing that ds = (C₂/T)dT - VadP, show that -(1/V) (av/aP), =B/y, where y = Cp/Cy.

A: We follow the cyclic rule and here we consider the entropy constant,so dS=O, and by the formula of…

Q: In a diffractometer, X-rays with a wavelength of 0.213 nm were used to produce a diffraction pattern…

Q: Given the reactions, X(s) + O₂(g) → XO(s) XCO,(s) — XO(s) + CO,(g) X(s) + }O,(g) + CO, (g) — XCO,(s)…

Q: Ph HO CH3 H H H multiple steps NaOMe MeOH Draw in this box the reactive chair conformation Ph. H CH3…

A: In an Sn2 reaction, reversal of configuration takes place. In an E2 elimination, hydrogen and the…

Q: How many liters of CO2 form from 28 g C2H4 and excess O2 at 1.0 atm and 25 °C? C₂H4 +302 → 2CO2 +…

Q: OCH 3 SO,NH2 What type of pharmacophore is the following compound made of? `N ZI IZ

A: Answer. A Pharmacophore is an assemblage of steric and electronic features that is necessary to…

Q: Which of the following is TRUE about D-glucose? Select one: O a. It is capable of forming…

Q: The IR spectrum below represents which of the following compounds? Absorbance/% миру 100 4000 3000…

A: O-H bond in an alcohol absorbs at a high wavenumber with respect to carboxylic acid somewhere…

Q: Write the letter of the correct answer. 1. How many phases exists below the curve? a. 0 b. 1 c. 2 d.…

A: The relationship between the number of components, phases and degrees of freedom in a mixture system…

Q: I. Identify the substance being oxidized and the substance being reduced in each reaction. 1. 2H2 +…

Q: h of the following best describes a catalyst? t increases the number of collisions between reacting…

A: Catalyst is the substance which accelerate the rate of reaction by decreasing activation energy.

Q: The total pressure of the following system is used to monitor the progress of the chemical reaction.…

A: The reaction for which the total pressure, Ptotal(kPa) data is given is: SO2Cl2(g) → SO2(g) + Cl2(g)…

Q: A. For the reaction: * (aq) → Al³+ (aq) + Fe(s) Standard Reduction Potential, Eº Half-reaction…

Q: collowing best describes the rate law? cal equation that describes how the rate of reaction depends…

A: Rate of reaction is experimental expression which relates rate of reaction and concentration of…

Q: 2. At 500 K, butadiene gas converts to cyclobutene gas. CH₂ ·| CH₂=CH-CH=CH₂ CH₂ -CH From the…

A: The conversion of butadiene gas to cyclobutene is purely first order reaction. The rate of decrease…

Q: Given this molecule, provide the amount of non-equivalent hydrogens, the integration, the shielding…

A: 1H-NMR gives a valuable information regarding complete structure of the molecule. Form the chemical…

Q: For the decomposition of A into B and C, what is the order of the reaction given the following data?…

Q: The IR spectrum below represents which of the following compounds? 2. O b. Oc O d. الله امد حله سم N

A: IR spectroscopy helps to identify functional group. Each functional group gives fixed peak.In the…

Q: A hexose can be formed by reacting a pentose with Br2, H2O, and then Fe2(SO4)3. True or False

Q: Arrange the following in increasing reactivity towards nucleophilic addition. 0₂N- Select one: O a.…

A: The carbonyl compounds give nucleophilic addition reactions. The carbon atom of the carbonyl carbon…

Q: Activity 1; Write the correct equilibrium constant for the following reaction. C2H6(g) 1. C₂H2(g) +…

A: Since you have asked multiparts, we will solve the first three subparts for you. If you want any…

Q: 4NH3 + 50₂ → 4NO + 6H₂0 Given: 2NH3 → N₂ + 3H₂ AH = +92 kJ 2H₂O → 2H₂ + O₂ AH = +572 kJ N₂0₂ + 2NO…

Q: Question 21 What is the systematic name for the compound CCL? a) monocarbon tetchloride c)…

A: CCl4 is made up of carbon and chlorine.

Q: Based on the given NMR spectrum, does the molecule match the spectrum?

A: To predict whether the given NMR spectrum belong to the given molecule or not.

Q: Prepare a procedural flow chart that provides a simplified overview of the entire extraction…

A: The procedural flow chat of extraction process is explained in step 2.

Q: 5. Assume you have a 3.60m solution that depressed the freezing point of the solution by 0.851°C.…

A: Colligative properties: The colligative properties are those properties of solutions that depend on…

Q: Question 12 Which of the following best describes the rate law? O A theoretical equation that…

A: Chemical kinetics is branch of chemistry in which we deal speed at which rates of reaction occurs.

Q: Fluorescent Light Bulbs contain a noble gas such as argon. How many moles of Argon is in a 121-mL…

A: Given, Volume of the fluorescent bulb (V) = 121 mL = 0.121 L Pressure (P) = 325 Pa = 0.00321 atm…

Concept explainers

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.

Question

Organic Christry The resulting the reaction

CH3
T
H3C-C-CH3
H3C
CH3
Na₂Cr₂O7
H₂O, 95 °C

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Hi! Are tou sure it's not [H2O] / [CO] [H2] ?
C6H12O6(s)→C3H6O3(s)+C2H5OH(l)+CO2(g) Calculate ΔH∘rxn
Estimate the heat released when ethene(CH2=CH2) reacts with HBr to giveCH3CH2Br. Bond enthalpies areC-H : 412 kJ/mol; C-C : 348 kJ/mol;C=C : 612 kJ/mol; C-Br : 276 kJ/mol;Br-Br : 193 kJ/mol; H-Br : 366 kJ/mol. Choose the correct answer:1. 1036 kJ/mol2. 58 kJ/mol3. 424 kJ/mol4. 200 kJ/mol5. 470 kJ/mol
table of thermodynamic properties: - C2H4(g) Hf = 52.4 Gf = 68.4 S = 219.3 - H2O(l) Hf = -285.8 Gf = -237.1 S = 70.0 - C2H5OH(l) Hf = -277.6 Gf = -174.8 S = 160.7
Given the following for the oxidation of 1-decanol. CH3(CH2)8CH2OH(l) + O2(g) → CO2(g) + H2O(l) a) Calculate the work done when 1 mole is oxidized at 1 atm pressure.
a) H2O b) CH4 c) H3O+ d) NH3 e) C2H4
Draw an expanded structural formula of pent-1-en-3-yne/ CH3-CC-CH=CH2 and then label each carbon. Indicate the longest and shortest C-H bond and predict the C—C single bond that has the highest BDE(bond dissociation energy).
Estimate the heat released when 1-butene(CH3CH2CHCH2) reacts with bromine to give CH3CH2CHBrCH2Br. Bond enthalpies are CH : 412 kJ/mol; CC : 348 kJ/mol;CC : 612 kJ/mol; CBr : 276 kJ/mol;BrBr : 193 kJ/mol. 1.317 kJ/mol 2.507 kJ/mol 3.95 kJ/mol 4.288 kJ/mol 5.181 kJ/mol
Answer the following questions about the conversion of the sucrose (C 12H 22O 11) in sugarcane to ethanol (C 2H 6O) and CO 2 according to the following unbalanced equation. In this way sugarcane is used as a renewable source of ethanol, which is used as a fuel additive in gasoline. C12H22O11(s) + H2O(l)---------->C2H6O(l) + CO2(g) sucrose ethanol a. What is the molar mass of sucrose? b. Balance the given equation. c. How many moles of ethanol are formed from 2 mol of sucrose? d. How many moles of water are needed to react with 10 mol of sucrose? e. How many grams of ethanol are formed from 0.550 mol of sucrose? f. How many grams of ethanol are formed from 34.2 g of sucrose? g. What is the theoretical yield of ethanol in grams from 17.1 g of sucrose? h. If 1.25 g of ethanol are formed in the reaction in part (g), what is the percent yield of ethanol?
Do ethanol (C2H5OH) C and D
Calculate the energy change of the following reaction: 2NO + O2→ 2NO2 ΔH: NO = 90.0 kJ/mol NO2= 34.0 kJ/mol O2= 0.0 kJ/mol a -180 kJ b -112 kJ c 35.0 kJ d -248 kJ
Explain why the boiling point of CH3CONH2 (221 °C) is signicantly higher than the boiling point of CH3CO2H (118 °C).