pentanenitrile CH,BICH,CHO 2-methylbutylamine

Q: Which functional groups are present in each of the following medicines? OH HO2C, F -C=CH b. `N' NH,…

A:

Q: The functional group 0 -C-N- H found in proteins is called a (an) Multiple Choice O O O amide.…

A:

Q: Which rock and roll star has the same name as this hexapeptide in single letter code? NH₂ SH NH₂ NH₂

A:

Q: The major product formed in the reaction is:

A: The reagent NaNH2 mainly works as "strong base" and named "sodium amide". The reagent (NaNH2)…

Q: How many chiral carbon atoms are in this structure? Br ОН HO. CI

A: Only 2 carbons.

Q: Strural formula of 3,3 dimethyl-N-phenyl-2-aminohexane

A: In the given question, amine (-NH2) is the only functional group present. Thus, the correct name…

Q: (a) || CH3CH2CCHCH3 CH3 (Ь) _CH2CH2CHO

A: IUPAC names : (a)  2-Methylpentan-3-one   (b) 3-Phenylpropanal

Q: Draw the structures of the 2 isomers of C8H18 that contain 2 methyl branches on the same carbon of…

A: The two structural isomers of C8H18 that contain 2 methyl branches on the same carbon of the main…

Q: How many chiral carbon? Br 2 3 O 5 4.

A: If a carbon atom in the molecule is attached with four different groups, then the carbon is known as…

Q: Which of the following functional groups is non-polar? A В D E А. А В. В

A: When two uniformly strong (electronegative) atoms are joined, their electron sharing is equal. When…

Q: Draw one possible structure of CgH14 given that it contains one methyl group attached to a longer…

A: The answer to the following question is given as:

Q: O₂N O OCH 3 H₂, Pd-C draw structure ...

A:

Q: 14. Determine functional groups in ibuprofen. CH3 OH CH3

A:

Q: Determine the structure from the following name: (S)-3-aminopent-4-enoic acid NH2 HO NH2 HO. NH2 H.…

A:

Q: Q 1 What is the repeating unit/ Short hand Cor each of these polymers? CI CI CI N-

A: Polymers are large molecules made up of long chains or networks of smaller molecules called…

Q: The monomers NH2 and HO-C (CH FOH would react with each other to form a polyamide a polycarbonate a…

A:

Q: Identify the functional groups of the encircled item: STRUCTURE A1 #2 OH N. #1 CI STRUCTURE A2 3 HO…

A: Given structures are :  Identify the circle functional groups = ?

Q: What is the compound name of Hg2(CH3COO)2 ?

A: The name of an ionic compound is written as follows: First, write the name of the cation, if the…

Q: 6. How are fhese selated: (25,3R) 2 bromo 3chloro butane (25,35) 2bromo 3ch loro butane

A:

Q: .OH 1. NaH 2. CH3CH2CH2Br

A: Alcohol react with base (NaH) deprotonation occurred (alkoxide formed) Alkoxide undergo substitution…

Q: HO 1. TSCI, Pyridine 2. CH3CH2S

A:

Q: Identify the functional groups of the encircled item: STRUCTURE A1 #2 OH #1 STRUCTURE A2 HO N. S 2 1…

A:

Q: 1. NaOCH2CH3 2. CH3CH,CH2I

A: Nucleophilic substitution then, Ester hydrolysis and finally decarboxylation. Beta keto-ester have…

Q: Explain Compounds Containing a C=O Group ?

A: The functional group composed of a carbon atom double-bonded to an oxygen atom, i.e, C=O is called…

Q: 1. Amine are basic in nature. True/False 2. Farmic acids are found in vinegar. True/False 3. Ketones…

A: The acidity of the vinegar is due to the presence of the acetic acid (generated by the ethanol…

Q: What is the structure of bicyclo[1.1.0]butan-2-amine?

A: The bicyclo name states that the molecules contain two cycles of carbon atoms.

Q: Draw the structure corresponding to following name. 3,3-dimethylpentanenitrile j.…

A: Given Draw the structure corresponding to following name. 3,3-dimethylpentanenitrile j.…

Q: 2. Write the structural formula for the ff A. methylpropylamine. B. 2-chloroaniline.

A:

Q: Draw structures for the following compounds.  Show all of the  hydrogen atoms in the molecules.…

A:

Q: WAP. OH 대표 3 CHA

A: Identify the functional groups for a, b, c and d--

Q: HBr 4) diethylacety lene H2O, Hg2*, H2SO4 5) dimethylacetylene

A:

Q: The substance below is or но N-COC-N- n = a large # O a polyketone a polyester a polyaldehyde O a…

A: When the large number of monomer reacts with to form the polymer .

Q: Whats the kekule structure for C3H7NO3

A: Kekule structure is a Lewis structure structure in which the bonded electron pairs between the two…

Q: Draw the following structures: 1. Propan-1,3-diamine 2.7-Amino-4-methylheptan-2-one

A: Since you have posted questions with multiple subparts, we will solve first three subparts for you…

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: 5. What is the correct structure for aniline? NH2 OCH CH3 II IV A) I B) II II D) IV

A:

Q: Which is NOT a functional group found in this molecule? H2N -CH -C- CH2 CH2 NH2 amine Earbexylie…

A:

Q: On your paper draw the L- enatomer (on the straight skeleton structure) for this carbohydrate: CHOH…

A: Draw the L-enantiomer for this carbohydrate.

Q: Ch., 11 eny arlviram ec e pisj Something is wrong with the name given above. What is the correct…

A: 3 b. Select the long parent hydrocarbon with maximum substitutions. Therefore the compound name is…

Q: 1) ethanamine CI 2) LİAIH, / H,O

A: First step is nucleophilic substitution reaction and second step is reduction step

Q: Which of the following may be possible structures for malic acid, C4H6O5? HO- CH 3 но- 0-CH…

A: The formula of maleic acid given is C4H6O5.

Q: Give the name for this molecule: ОН CH3CH2CH2-C- CH2CH3 | CH,CH3

A: The name of the given Molecule will be completely based on IUPAC Nomenclature -

Q: How many chiral carbon atoms do each of the following molecules 2) contain? LOCH3 OH ОН HO, b) c) ÓH

A: Interpretation: We have to assign the number of chiral carbon atoms.

Q: CH, -N H,C- НО H,C CH; ||C H

A: Steroids are the compounds having fused ring structure. Most of the steroids have four interlinked…

Q: a carbon peptide bond CH C-NH-CH–C–O CH2 CH,COO CH,CHCH,

A: A polypetide chain mainly contains following groups - Amino terminus Alpha carbon R group (present…

Q: Give the name for this molecule: CH2CH 13CH2 CH2CH3

A:

Q: - Draw the skeletal structure for 1-aminocyclohexene. |- Name the following compound. CH3CH2CHBrCOH

A: The skeletal structure and IUPAC name of the above compounds are given below

Q: A H3PO4 B PCC CH₂Cl2 с PPh3 THE

A: