Pressure and temperature affect the amount of space between gas molecules, which affects the volume and, therefore, the density of the gas since Calculate the density of oxygen, O2, under each of the following conditions: • STP 1.00 bar and 20.0 °C density = mass volume Express your answers numerically in g L-1. Enter the density at STP first and separate your answers by a comma. The molar mass of a substance, however, is a constant and can be used to identify an unknown gas sample. Molar mass is found by dividing the mass of a sample (in grams) by the number of moles in that sample. The number of moles of gas can be calculated using the ideal gas law > View Available Hint(s) ? PV – nRT which can be rearranged as PV n = ir Submit Given the number of moles of a gas and its molar mass, you can calculate the mass of the gas. Since density is equal to the ratio of the mass and volume. • Part B To identify a diatomic gas (X2), a researcher carried out the following experiment: She weighed an empty 1.7-L bulb, then filled it with the gas at 2.01 bar and 26.0 °C and weighed it again. The difference in mass was 3.9 g. Identify the gas. Express your answer as a chemical formula.

Pressure and temperature affect the amount of space between gas molecules, which affects the volume and, therefore, the density of the gas since Calculate the density of oxygen, O2, under each of the following conditions: • STP 1.00 bar and 20.0 °C density = mass volume Express your answers numerically in g L-1. Enter the density at STP first and separate your answers by a comma. The molar mass of a substance, however, is a constant and can be used to identify an unknown gas sample. Molar mass is found by dividing the mass of a sample (in grams) by the number of moles in that sample. The number of moles of gas can be calculated using the ideal gas law > View Available Hint(s) ? PV – nRT which can be rearranged as PV n = ir Submit Given the number of moles of a gas and its molar mass, you can calculate the mass of the gas. Since density is equal to the ratio of the mass and volume. • Part B To identify a diatomic gas (X2), a researcher carried out the following experiment: She weighed an empty 1.7-L bulb, then filled it with the gas at 2.01 bar and 26.0 °C and weighed it again. The difference in mass was 3.9 g. Identify the gas. Express your answer as a chemical formula.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter8: Properties Of Gases

Section: Chapter Questions

Problem 122QRT

See similar textbooks

Similar questions

Methane (CH4) gas flows into a combustion chamber at a rate of 200. L/min at 1.50 atm and ambient temperature. Air is added to the chamber at 1.00 atm and the same temperature, and the gases are ignited. a. To ensure complete combustion of CH4 to CO2(g) and H2O(g), three times as much oxygen as is necessary is reacted. Assuming air is 21 mole percent O2 and 79 mole percent N2, calculate the flow rate of air necessary to deliver the required amount of oxygen. b. Under the conditions in part a, combustion of methane was not complete as a mixture of CO2(g) and CO(g) was produced. It was determined that 95.0% of the carbon in the exhaust gas was present in CO2. The remainder was present as carbon in CO. Calculate the composition of the exhaust gas in terms of mole fraction of CO, CO2, O2, N2, and H2O. Assume CH4 is completely reacted and N2 is unreacted.
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
The gas in the discharge cell of a laser contains (in mole percent) 11% CO2, 5.3% N2, and 84% He. (a) What is the molar mass of this mixture? (b) Calculate the density of this gas mixture at 32C and 758 mm Hg. (c) What is the ratio of the density of this gas to that of air (MM=29.0g/mol)at the same conditions?
a tank used for filling helium balloons has a volume of 0.600m3 and conntains 3.00 mole of helium gas at 30.0o C. Assuminng that the helium behaves like an ideal gas, 1. What is the total translational kinetic energy of the molecules of the gas ? 2. Also using the fact that the molar mass of helium is 4x10-3kg/mole, determine the rms speed of the atoms at 20.0 of the atoms at 20.0oC.
a) A certain sample of gas has a volume of 20.0 dm3 at 0oC and 1.0 atm. A plot of the experimental data of its volume against the celcius temperature, Ɵ, at constant pressure, gives a straight line of slope 0.074 dm3 /o From these data alone (without use of the perfect gas law) determine the absolute zero of temperature in degrees Celsius? b) Ballons are still used to deploy sensors that monitor meteorological phenomena. It is possible to investigate some of the technicalities of ballooning by using perfect gas law. Suppose your balloon has a radius of 3.0 m and that is spherical. What mass of H2 (in mol) is needed to inflate it to 1.0 atm in an ambient temperature of 25oC at sea level? What mass can the balloon lift at sea level,where the density of air is 1.22 kg /m3? What would be the payload if He were used instead of H2?
What is the value of the second virial coefficient of a 8.2 mmol gas at 300K and 20 atm, if the compression factor of the gas is 0.86 Select one:a. -0.15 dm3mol-1b. -0.15 cm3mol-1c. data is insufficientd. 0.15 dm3mol-1
Consider the following balanced reaction: 2 H₂S(g) + 3 O2(g) → 2 H₂O(l) +2 SO₂(g) 5.00 L of H₂S and 5.00 L of O2 are allowed to react. Assume the reaction goes to the maximum extent possible. What volume (in liters) of sulfur dioxide is produced? Assume STP (standard temperature and pressure). Enter the numerical value (no units), using 3 significant figures.
find the molar mass of a gas measured under the conditions specified 0.250g occupies 1.01L at 31C and 1.44 atom
49 mL of a gas are collected over water at 748 mm Hg and 298 K. If the vapor pressure of water at that temperature is 29 mm Hg, how many moles of the gas generated from the reaction were collected? (Express your answer using exponential notation (ex. 1.23e-3, or 1.23e3) to 3 significant figures, and don't round any calculations along the way!) moles
Find the density of Freon-11 (CFCl₃) at 120C and 1.5 atm
If a pressure of a gas in a 2.0x10-2m swaled vessel is 2.1kpa at 28degrees celcius what will the pressure be if the volume is reduced to 0.15x10-2m^3
While looking over some of her lab data, a chemistry student notices she forgot to record the numbers of moles of the gas molecule she looked at. The experiment she did that day had kept the pressure constant and the temperature went down two degrees in the process of the experiment. Assuming all variables are also ideal, how many moles was she dealing with? ***Explain thoroughly pls. Need this asap. Thank you.