(Q59) What is the difference between the C-H bond that exists in methane (CH4) versus the bonding that occurs in the diammine complex [Ag(NH3)2]*? O The complex only accepts one electron from each nitrogen atom O The complex exhibits ionic bonding and methane exhibits covalent bonding The carbon and hydrogen share electrons in the bond; the nitrogen atoms of each ammonia molecule donate their electron pairs to silver The electrons in the complex are shared equally by all atoms in the complex The ammonia and silver do not interact at all, generating the positive charge

(Q59) What is the difference between the C-H bond that exists in methane (CH4) versus the bonding that occurs in the diammine complex [Ag(NH3)2]*? O The complex only accepts one electron from each nitrogen atom O The complex exhibits ionic bonding and methane exhibits covalent bonding The carbon and hydrogen share electrons in the bond; the nitrogen atoms of each ammonia molecule donate their electron pairs to silver The electrons in the complex are shared equally by all atoms in the complex The ammonia and silver do not interact at all, generating the positive charge

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 31P

See similar textbooks

Similar questions

Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Draw the Crystal field diagrams for [Fe(NO2)6]4- and [FeF6]3-. State whether each complex is high spin or low spin, paramagnetic or diamagnetic, and compare ?oct to P for each complex.
Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?