Answered: Rank the following species in order of…

Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter21: Benzene And The Concept Of Aromaticity

Section21.4: Phenols

Problem 21.6P: Arrange these compounds in order of increasing acidity: 2,4-dichlorophenol, phenol, cyclohexanol.

See similar textbooks

Related questions

Q: Rank these compounds from weakest to strongest acid H3C OH F3C. C H₂ II OH F3C III OH Cl3C O IV OH

Q: H2 NH2 NH3 -NH2 -NH2 с. O,N CH d. CgH;NH, (CHs)2NH -NH2

A: In case of nitrogenous compound greater the availability of lone pair on nitrogen atom greater it's…

Q: Rank the compounds in each group in order of increasing acidity.

Q: Arrange the molecules and ions in set in order of increasing acidity (from least acidic to most…

A: Concept introduction: Resonance effect: Organic compound contains double bonds, it will involve in…

Q: Rank the following compounds in order of increasing acidity: COOH ОН CH3 СООН NO2 CI I II III IV

Q: CH3 -N' O,N- NH2 NH2 CI NH2 CH30 NH2

A: The basicity of any molecule is directly proportional to the tendency of the molecule to donate…

Q: Rank the following in order of increasing acidity. HS. H3C° НО. A

Q: Rank the compounds in each group in order of increasing basicity. NH2 NH2 NH2 a. NH3 -NH2 -NH2 ON CH…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Rank the following compounds in order of increasing acidity of their most acidic hydrogen atom.…

A: Acidic character of an organic compound depends on the stability of its conjugate base. If an…

Q: Arrange in order of increasing acidity НО. Но. HO. Но HO, Arrange in order of decreasing acidity HO,…

A: I) When carboxylic acids are dissolved in water they dissocitates into carboxylate ion and the…

Q: Arrange the following compounds in order of decreasing their acidity (most first) I. H20 II. C2H6…

A: The acidic strength of any compound depends on the stability of their conjugate bases. with the…

Q: Rank the following compounds in order of decreasing acidity, putting the most acidic first. CH4 NH3…

A: Acidity is defined as tendency to lose a proton (H+) . More stable the conjugate base, greater is…

Q: Rank the compounds in each group in order of increasing basicity.

A: a) Since the basicity of molecules depends on the tendency to donate lone pair electrons. And since…

Q: Arrange the following hydrogens in the order of DECREASING pK, values (from least acidic to most…

A: (1) Acidity of a proton is determined by the stability of the anion formed after deprotonation. pka…

Q: Arrange each group of compounds in order of increasing acidity.(a) phenol, ethanol, acetic acid

A: The pKa values of given compounds are, Acetic acid = 4.8 Phenol = 10 Ethanol = 16 In generally more…

Q: What is the correct rank of the following compounds in order of decreasing acidity? LOH _NH2 он II…

Q: HN-CH3 CH2 NO2 H2C-CI COOH COOH ČOOH II III

A: In this question, we will arrange all these three Compounds in Increasing order of Acidity. You can…

Q: Arrange the following compounds in increasing order of basicity: CH3NH2, (CH3)2NH, NH3, C6H5NH2 *…

A: Increasing order of basicity is given below

Q: Rank the following organic compounds in order of increasing basicity. A)I< III < || CH2 B) I| < III…

A: The explanation is given below-

Q: which of the following compound shows the strongest acidity A-ch3oh B-ch3ch2oh C-h2o D-c6h5oh 1-A…

A: D. C6H5OH shows stronger acidity.

Q: Rank the compounds in each group in order of increasing acidity.

A: The more the electronegative substituent, the stronger the acid. This is because it weakens the bond…

Q: Rank the following species in order of increasing acidity. Explain your reasons for ordering them as…

A: HF will dissociate to a greater extent when placed in water than the other acids. HCN will…

Q: Arrange these compounds in terms of decreasing acidity:

Q: Rank the compounds in each group in order of increasing acidity.

A: The ease of losing H+ and thereby forming a stable anion would make the acid amongst the choices to…

Q: Rank the following in order of decreasing basicity and explain why (based on their structures).…

Q: он SO3H COOH SO3H ČH3 ČH3 NO2 ČH3 III IV I II

Q: Of the following, which is the strongest acid? H2SO3 HSO4- HSO3- H2SeO4…

A: Answer: The strongest acid is H2SO4 (sulfuric acid) among them.

Q: Rank the following molecules from least acidic to most acidic please! - Br3CCO2H - H3CCO2H -…

A: The acidity of carboxylic acid: Carboxylic acids are acidic in nature. The dissociation of…

Q: NH2 NH2 `NH2 NH NH H2N NH

A: Basicity is the tendency to donate electrons. Lesser the s-character in an atom greater will be its…

Q: Rank the compounds in each group in order of increasing basicity.

Q: Rank the following compounds in order of increasing acidity of their mostacidic hydrogen atom. (See…

A: The compound C is the least acidic because the electronegativity of nitrogen is less than that of…

Q: Rank the following species in order of increasing acidity. The least acidic should be on top, most…

A: With increase in the electron withdrawing effect, Carbonyl carbon becomes more electrophilic in…

Q: Rank in order of increasing acidity: CI .CO2H .CO2H .CO2H CO2H CO2H .CH2OH CI

A: The acidity of any compound is the power to dissociate as more as protons in a free form in the…

Q: Rank the compounds in each group in order of increasing acidity.

A: a. When we see the first set of compound given we compare the electronegativity of the halogens ,…

Q: Arrange the given compounds based on their relative Brønsted acidities. H-F H-Br H-SH H-CH3…

A: By Bronsted theory, a species that is capable of giving away a proton are termed as Bronsted acids.…

Q: Rank the following compounds in order of increasing basicity: NH₂ NH₂ NH₂ NH₂ A) B) D) OCH3 NO₂ 2

Q: Which of the following straight-chain organic compounds has the highest acidity? (Note: All numbers…

Q: Rank the following compounds in order of increasing acidity: ОН ОН HO- HO- ČH3 NO2 I II III IV

A: We have to rank the following given compounds in the increasing order of acidity as follows in step…

Q: Predict the stronger acid in each pair: (a) HCl or HF;(b) H3PO4 or H3AsO4; (c) HBrO3 or HBrO2; (d)…

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: Determining the Relative Acidity of Compounds Rank the following compounds in order of increasing…

A: Since the acidic strength of molecules depends on the stability of anion formed by the removal of…

Q: СООН ОН CH3 СООН NO2 CI

A: The order of acidity is as follows: I>II>IV>III Acidity is basically, the tendency to loose…

Q: Rank the following compounds in order of increasing basicity.

A: Since in molecule 2 and molecule 3 we have lone pair electrons of N involved in resonance while in…

Q: Rank the following according to increasing acidity of the hydrogen atom. HO CH3 `CH3 но II II

Q: Rank the compounds in each group in order of increasing acidity. CI Br .COOH .COOH .COOH а. C. СООН…

A: 'Since you have posted a question with multiple sub-parts , we will solve first three sub-parts for…

Q: "OH CH3 CH3

A: Basicity of these anions depends upon the electron density on oxygen atom.

Q: Rank the following species in order of increasing basicity. Explain your reasons for ordering them…

A: According to Bronsted-Lowry acid base theory the compounds which have ability to donate proton or…

Q: Rank the compounds in each group in order of increasing basicity. NH2 NH, HN a. NH3 -NH, -NH2 O,N…

A: Basicity is the tendency to donate lone pair of electrons. The more the tendency more will be the…

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Rank the following substances in order of increasing acidity: (a) (CH3)2CHOH, HCâ‰¡CH, (CF3)2CHOH, CH3OH (b) Phenol, p-methylphenol, p-[trifluoromethyl) phenol (c) Benzyl alcohol, phenol, p-hydroxybenzonic acid
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
As we shall see in Chapter 19, hydrogens on a carbon adjacent to a carbonyl group are far more acidic than those not adjacent to a carbonyl group. The anion derived from acetone, for example, is more stable than is the anion derived from ethane. Account for the greater stability of the anion from acetone.
Arrange these compounds in order of increasing acidity: 2,4-dichlorophenol, phenol, cyclohexanol.
Rank the following compounds in their correct order of acidity. 1=Most acidic and 4=least acidic.
Rank these compounds in order of decreasing acidity.
1. Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O2. Consider the following compounds that vary from nearly nonacidic to strongly acidic. Draw the conjugate bases of these compounds, and explain why the acidity increases so dramatically with substitution by nitro groups. CH4 CH3NO2 CH2(NO2)2 CH(NO2)3
Arrange the following organic molecules in order of increasing acidity, starting with the least acidic and explain your answer CH3CH3, HC≡CH and CH2=CH2
Which of the following correctly places the three compounds in order of increasing acidity? H3BO3 < HClO3 < H2SO3 H2SO3 < H3BO3 < HClO3 HClO3 < H2SO3 < H3BO3 H3BO3 < H2SO3 < HClO3
Arrange the compounds in order of increasing acidity.
Rank the following compounds in order of increasing acidity (1 = least acidic, 3 = most acidic) and in the space provided use resonance (of the conjugate base) to explain why the compound you have labelled “3” is the most acidic.
Arrange each group of compounds in order of increasing acidity.butyric acid, a@bromobutyric acid, b@bromobutyric acid