Rola...TURN INShareFile Edit ViewInsert100%Normal textArialHARLES' LAWA balloon, originally at 6.28 L and 211K has its temperature increased to 419K What wilvolume be?A balloon, originally at 6.28 L and 211K has its volume increased to 34 1L What will tstemperature be?AY-LUSSAC's LAWntmeenheree hae ite temneII

since you have posted more than one question, we can solve only first for you. If you want other…

Answered: Rola... File Edit View Insert 100%…

Rola... File Edit View Insert 100% Normal text Arial ARLES' LAW A balloon, originally at 6.28 L and 211K has its temperature increased to 419K What wil volume be?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter5: Gases

Section: Chapter Questions

Problem 143CWP: A certain flexible weather balloon contains helium gas at a volume of 855 L. Initially, the balloon...

See similar textbooks

Similar questions

What is the temperature of an 11.2-L sample of carbon monoxide, CO, at 744 torr if it occupies 13.3 L at 55 C and 74-4 torr?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
A cylinder of medical oxygen has a volume of 3S.4 L. and contains O2 at a pressure of 1S1 atm and a temperature of 2S C. What volume of O2 does this correspond to at normal body conditions, that is. 1 atm and 37 C?
While resting, the average 70-kg human male consumes 14 L of pure O2 per hour at 25 C and 100 kPa. How many moles of 02 are consumed by a 70 kg man while resting for 1.0 h?
A mixture of chromium and zinc weighing 0.362 g was reacted with an excess of hydrochloric acid. After all the metals in the mixture reacted, 225 mL dry of hydrogen gas was collected at 27C and 750. torr. Determine the mass percent of Zn in the metal sample. [Zinc reacts with hydrochloric acid to produce zinc chloride and hydrogen gas; chromium reacts with hydrochloric acid to produce chromium(III) chloride and hydrogen gas.]
5-118 Isooctane, which has a chemical formula C8H18 is the component of gasoline from which the term octane rating derives. (a) Write the balanced chemical equation for the combustion of isooctane. (b) The density of isooctane is 0.792 g/mL. How many kg of C02 are produced each year by the annual U.S. gasoline consumption of L? (c) What is the volume in liters of this CO2 at STP? (d) The chemical formula for isooctane can be represented by (CH3)3CCH2CH(CH3)2. Draw a Lewis structure of isooctane. (e) Another molecule with the same molecular formula is octane, which can be represented by: When comparing isooctane and octane, one structure is observed to have a boiling point of 99°C, while another is known to have a boiling point Of 125°C. Which substance, isooctane or octane, is expected to have the higher boiling point? (f) Determine whether isooctane or octane is expected to have the greater vapor pressure.
A certain flexible weather balloon contains helium gas at a volume of 855 L. Initially, the balloon is at sea level where the temperature is 25C and the barometric pressure is 730 torr. The balloon then rises to an altitude of 6000 ft, where the pressure is 605 torr and the temperature is 15C. What is the change in volume of the balloon as it ascends from sea level to 6000 ft?
5-113 Ammonia and gaseous hydrogen chloride react to form ammonium chloride according to the following equation: If 4.21 L of NH3(g) at 27°C and 1.02 atm is combined with 5.35 L of HCI(g) at 26°C and 0.998 atm, what mass of NH4CI(s) will be generated?
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
5-54 Automobile air bags are inflated by nitrogen gas. When a significant collision occurs, an electronic sensor triggers the decomposition of sodium azide to form nitrogen gas and sodium metal. The nitrogen gas then inflates nylon bags, which protect the driver and front-seat passenger from impact with the dashboard and windshield. What volume of nitrogen gas measured at 1 atm and 27°C is formed by the decomposition of 100. g of sodium azide?
You have a helium balloon at 1.00 atm and 25C. You want to make a hot-air balloon with the same volume and same lift as the helium balloon. Assume air is 79.0% nitrogen and 21.0% oxygen by volume. The lift of a balloon is given by the difference between the mass of air displaced by the balloon and the mass of gas inside the balloon. a. Will the temperature in the hot-air balloon have to be higher or lower than 25C? Explain. b. Calculate the temperature of the air required for the hot- air balloon to provide the same lift as the helium balloon at 1.00 atm and 25C. Assume atmospheric conditions are 1.00 atm and 25C.
97 Homes in rural areas where natural gas service is not available often rely on propane to fuel kitchen ranges. The propane is stored as a liquid, and the gas to be burned is produced as the liquid evaporates. Suppose an architect has hired you to consult on the choice of a propane tank for such a new home. The propane gas consumed in 1.0 hour by a typical range burner at high power would occupy roughly 165 L at 25°C and 1.0 atm, and the range chosen by the client will have six burners. If the tank under consideration holds 500.0 gallons of liquid propane, what is the minimum number of hours it would take for the range to consume an entire tankful of propane? The density of liquid propane is 0.5077 kg/L.